| Drug General Information |
| Drug ID |
D0N0UC
|
| Former ID |
DNC002438
|
| Drug Name |
Lauric Acid
|
| Drug Type |
Small molecular drug
|
| Indication |
Discovery agent
|
Investigative |
[1]
|
|---|
| Structure |
|
Download
2D MOL
3D MOL
|
| Formula |
C12H24O2
|
| InChI |
InChI=1S/C12H24O2/c1-2-3-4-5-6-7-8-9-10-11-12(13)14/h2-11H2,1H3,(H,13,14)
|
| InChIKey |
POULHZVOKOAJMA-UHFFFAOYSA-N
|
| PubChem Compound ID |
|
| PubChem Substance ID |
5649, 71199, 587917, 819797, 819951, 821886, 822246, 826382, 830803, 830815, 832379, 833825, 838007, 838335, 3133731, 3718095, 5673162, 7849666, 7886898, 7888608, 7888612, 8014369, 8026553, 8026610, 8026623, 8026781, 8027199, 8027947, 8027951, 8027953, 8137853, 8145220, 8152452, 10507982, 11456907, 15195524, 17388953, 17389665, 24770717, 24874804, 24896365, 24896407, 24901204, 24901205, 26703021, 26703023, 26703378, 26703414, 26710306, 26710331
|
| Target and Pathway |
| Target(s) |
Toll-like receptor 4 |
Target Info |
Inhibitor |
[2]
|
|---|
| Genome polyprotein |
Target Info |
Inhibitor |
[2]
|
| Lymphocyte antigen 96 |
Target Info |
Inhibitor |
[2]
|
| Lactotransferrin |
Target Info |
Inhibitor |
[2]
|
| 3-oxoacyl-[acyl-carrier-protein] synthase II |
Target Info |
Inhibitor |
[2]
|
| Phospholipase A2, membrane associated |
Target Info |
Inhibitor |
[2]
|
| 3-oxoacyl-[acyl-carrier-protein] synthase 1 |
Target Info |
Inhibitor |
[2]
|
| Hepatocyte nuclear factor 4-alpha |
Target Info |
Inhibitor |
[2]
|
|
BioCyc Pathway
|
Phospholipases
|
|
KEGG Pathway
|
NF-kappa B signaling pathway
|
|
HIF-1 signaling pathway
|
|
Phagosome
|
|
PI3K-Akt signaling pathway
|
|
Toll-like receptor signaling pathway
|
|
Pathogenic Escherichia coli infection
|
|
Salmonella infection
|
|
Pertussis
|
|
Legionellosis
|
|
Leishmaniasis
|
|
Chagas disease (American trypanosomiasis)
|
|
Malaria
|
|
Toxoplasmosis
|
|
Amoebiasis
|
|
Tuberculosis
|
|
Hepatitis B
|
|
Measles
|
|
Influenza A
|
|
Proteoglycans in cancer
|
|
Inflammatory bowel disease (IBD)
|
|
Rheumatoid arthritishsa04064:NF-kappa B signaling pathway
|
|
Toxoplasmosishsa00564:Glycerophospholipid metabolism
|
|
Ether lipid metabolism
|
|
Arachidonic acid metabolism
|
|
Linoleic acid metabolism
|
|
alpha-Linolenic acid metabolism
|
|
Metabolic pathways
|
|
Ras signaling pathway
|
|
Vascular smooth muscle contraction
|
|
Pancreatic secretion
|
|
Fat digestion and absorptionhsa04152:AMPK signaling pathway
|
|
Maturity onset diabetes of the young
|
|
NetPath Pathway
|
IL5 Signaling Pathway
|
|
IL2 Signaling Pathway
|
|
IL4 Signaling PathwayNetPath_7:TGF_beta_Receptor Signaling Pathway
|
|
IL6 Signaling PathwayNetPath_7:TGF_beta_Receptor Signaling Pathway
|
|
TCR Signaling Pathway
|
|
PANTHER Pathway
|
Toll receptor signaling pathwayP00054:Toll receptor signaling pathway
|
|
Pathway Interaction Database
|
Endogenous TLR signalingtoll_endogenous_pathway:Endogenous TLR signalingglypican_1pathway:Glypican 1 networksmad2_3nuclearpathway:Regulation of nuclear SMAD2/3 signaling
|
|
FOXA2 and FOXA3 transcription factor networks
|
|
HIF-1-alpha transcription factor network
|
|
Reactome
|
Ligand-dependent caspase activation
|
|
Toll Like Receptor 4 (TLR4) Cascade
|
|
MyD88:Mal cascade initiated on plasma membrane
|
|
MyD88-independent TLR3/TLR4 cascade
|
|
TRIF-mediated programmed cell death
|
|
MyD88 deficiency (TLR2/4)
|
|
IRAK4 deficiency (TLR2/4)
|
|
Activation of IRF3/IRF7 mediated by TBK1/IKK epsilon
|
|
IKK complex recruitment mediated by RIP1
|
|
TRAF6 mediated induction of TAK1 complexR-HSA-140534:Ligand-dependent caspase activation
|
|
TRAF6 mediated induction of TAK1 complexR-HSA-1222556:ROS production in response to bacteria
|
|
Amyloid formationR-HSA-1482788:Acyl chain remodelling of PC
|
|
Acyl chain remodelling of PE
|
|
Acyl chain remodelling of PIR-HSA-383280:Nuclear Receptor transcription pathway
|
|
WikiPathways
|
Toll-like receptor signaling pathway
|
|
Toll-Like Receptors Cascades
|
|
MyD88:Mal cascade initiated on plasma membrane
|
|
MyD88-independent cascade
|
|
Primary Focal Segmental Glomerulosclerosis FSGS
|
|
Spinal Cord Injury
|
|
Corticotropin-releasing hormone
|
|
Pathogenic Escherichia coli infection
|
|
Regulation of toll-like receptor signaling pathwayWP75:Toll-like receptor signaling pathway
|
|
Regulation of toll-like receptor signaling pathwayWP2700:Latent infection of Homo sapiens with Mycobacterium tuberculosisWP2795:Cardiac Hypertrophic Response
|
|
Glycerophospholipid biosynthesis
|
|
Glycerophospholipid Biosynthetic Pathway
|
|
Eicosanoid Synthesis
|
|
MicroRNAs in cardiomyocyte hypertrophyWP2857:Mesodermal Commitment Pathway
|
|
Integrated Pancreatic Cancer Pathway
|
|
Nuclear Receptors
|
|
AMPK Signaling
|
| References |
| REF 1 | (http://www.guidetopharmacology.org/) Nucleic Acids Res. 2015 Oct 12. pii: gkv1037. The IUPHAR/BPS Guide to PHARMACOLOGY in 2016: towards curated quantitative interactions between 1300 protein targets and 6000 ligands. (Ligand id: 5534). |
|---|
| REF 2 | How many drug targets are there? Nat Rev Drug Discov. 2006 Dec;5(12):993-6. |
|---|
