| Drug General Information |
| Drug ID |
D0E9DB
|
| Former ID |
DNC006617
|
| Drug Name |
EPIGALOCATECHIN GALLATE
|
| Drug Type |
Small molecular drug
|
| Indication |
Discovery agent
|
Investigative |
[1]
|
|---|
| Structure |
|
Download
2D MOL
3D MOL
|
| Formula |
C22H18O11
|
| Canonical SMILES |
C1C(C(OC2=CC(=CC(=C21)O)O)C3=CC(=C(C(=C3)O)O)O)OC(=O)C4<br />=CC(=C(C(=C4)O)O)O
|
| InChI |
1S/C22H18O11/c23-10-5-12(24)11-7-18(33-22(31)9-3-15(27)20(30)16(28)4-9)21(32-17(11)6-10)8-1-13(25)19(29)14(26)2-8/h1-6,18,21,23-30H,7H2/t18-,21-/m1/s1
|
| InChIKey |
WMBWREPUVVBILR-WIYYLYMNSA-N
|
| PubChem Compound ID |
|
| Target and Pathway |
| Target(s) |
Beta-hydroxyacyl-acp dehydratase |
Target Info |
Inhibitor |
[2]
|
|---|
| Fatty acid synthase |
Target Info |
Inhibitor |
[2]
|
| HIV-1 reverse transcriptase |
Target Info |
Inhibitor |
[3]
|
| 3-oxoacyl-[acyl-carrier protein] reductase |
Target Info |
Inhibitor |
[2]
|
| Matrix metalloproteinase-14 |
Target Info |
Inhibitor |
[4]
|
| Enoyl-ACP reductase |
Target Info |
Inhibitor |
[5]
|
| 72 kDa type IV collagenase |
Target Info |
Inhibitor |
[4]
|
| Squalene monooxygenase |
Target Info |
Inhibitor |
[1]
|
| Leukocyte elastase |
Target Info |
Inhibitor |
[6]
|
|
BioCyc Pathway
|
Fatty acid biosynthesis initiation
|
|
Fatty acid elongation -- saturated
|
|
Palmitate biosynthesis
|
|
KEGG Pathway
|
Fatty acid biosynthesis
|
|
Biotin metabolism
|
|
Metabolic pathways
|
|
Fatty acid metabolismhsa00061:Fatty acid biosynthesis
|
|
Metabolic pathways
|
|
Fatty acid metabolism
|
|
AMPK signaling pathway
|
|
Insulin signaling pathwayhsa04668:TNF signaling pathway
|
|
GnRH signaling pathwayhsa04670:Leukocyte transendothelial migration
|
|
GnRH signaling pathway
|
|
Estrogen signaling pathway
|
|
Pathways in cancer
|
|
Proteoglycans in cancer
|
|
Bladder cancersce00100:Steroid biosynthesis
|
|
Sesquiterpenoid and triterpenoid biosynthesis
|
|
Metabolic pathways
|
|
Biosynthesis of secondary metabolites
|
|
Biosynthesis of antibioticshsa05202:Transcriptional misregulation in cancer
|
|
Systemic lupus erythematosus
|
|
NetPath Pathway
|
Leptin Signaling Pathway
|
|
TCR Signaling Pathway
|
|
ID Signaling Pathway
|
|
PANTHER Pathway
|
Alzheimer disease-presenilin pathwayP00004:Alzheimer disease-presenilin pathway
|
|
Pathway Interaction Database
|
p73 transcription factor network
|
|
Validated transcriptional targets of deltaNp63 isoformshif2pathway:HIF-2-alpha transcription factor network
|
|
Signaling events mediated by focal adhesion kinaselysophospholipid_pathway:LPA receptor mediated events
|
|
Plasma membrane estrogen receptor signaling
|
|
Osteopontin-mediated events
|
|
Validated transcriptional targets of AP1 family members Fra1 and Fra2
|
|
Angiopoietin receptor Tie2-mediated signaling
|
|
Direct p53 effectors
|
|
amb2 Integrin signaling
|
|
ATF-2 transcription factor network
|
|
FOXM1 transcription factor network
|
|
Regulation of nuclear beta catenin signaling and target gene transcription
|
|
Syndecan-2-mediated signaling eventsupa_upar_pathway:Urokinase-type plasminogen activator (uPA) and uPAR-mediated signaling
|
|
C-MYB transcription factor network
|
|
PathWhiz Pathway
|
Fatty Acid BiosynthesisPW000050:Steroid Biosynthesis
|
|
Reactome
|
ChREBP activates metabolic gene expression
|
|
Activation of gene expression by SREBF (SREBP)
|
|
Fatty Acyl-CoA BiosynthesisR-HSA-1442490:Collagen degradation
|
|
Degradation of the extracellular matrix
|
|
Activation of Matrix MetalloproteinasesR-HSA-1442490:Collagen degradation
|
|
Activation of Matrix Metalloproteinases
|
|
Regulation of Insulin-like Growth Factor (IGF) transport and uptake by Insulin-like Growth Factor Binding Proteins (IGFBPs)
|
|
EPH-ephrin mediated repulsion of cellsR-HSA-191273:Cholesterol biosynthesis
|
|
Activation of gene expression by SREBF (SREBP)R-HSA-1442490:Collagen degradation
|
|
WikiPathways
|
Fatty Acid Biosynthesis
|
|
Nuclear Receptors Meta-Pathway
|
|
Liver X Receptor Pathway
|
|
Activation of Gene Expression by SREBP (SREBF)
|
|
SREBF and miR33 in cholesterol and lipid homeostasis
|
|
SREBP signalling
|
|
Metabolism of water-soluble vitamins and cofactors
|
|
Integration of energy metabolism
|
|
Fatty acid, triacylglycerol, and ketone body metabolism
|
|
AMPK SignalingWP615:Senescence and Autophagy in Cancer
|
|
Activation of Matrix Metalloproteinases
|
|
Degradation of collagen
|
|
AGE/RAGE pathway
|
|
Matrix MetalloproteinasesWP2769:Activation of Matrix Metalloproteinases
|
|
Matrix MetalloproteinasesWP2840:Hair Follicle Development: Cytodifferentiation (Part 3 of 3)
|
|
Human Complement System
|
| References |
| REF 1 | J Nat Prod. 2001 Aug;64(8):1010-4.Ellagitannins and hexahydroxydiphenoyl esters as inhibitors of vertebrate squalene epoxidase. |
|---|
| REF 2 | J Med Chem. 2006 Jun 1;49(11):3345-53.Inhibition of Plasmodium falciparum fatty acid biosynthesis: evaluation of FabG, FabZ, and FabI as drug targets for flavonoids. |
|---|
| REF 3 | Bioorg Med Chem Lett. 2001 Oct 22;11(20):2763-7.Simplified catechin-gallate inhibitors of HIV-1 reverse transcriptase. |
|---|
| REF 4 | Bioorg Med Chem Lett. 2009 Aug 1;19(15):4171-4. Epub 2009 Jun 2.Regioselective synthesis of methylated epigallocatechin gallate via nitrobenzenesulfonyl (Ns) protecting group. |
|---|
| REF 5 | J Med Chem. 2007 Feb 22;50(4):765-75. Epub 2007 Jan 31.Green tea catechins potentiate triclosan binding to enoyl-ACP reductase from Plasmodium falciparum (PfENR). |
|---|
| REF 6 | Bioorg Med Chem Lett. 2010 Jan 15;20(2):513-5. Epub 2009 Nov 26.Evaluation of human neutrophil elastase inhibitory effect of iridoid glycosides from Hedyotis diffusa. |
|---|
