| Drug General Information |
| Drug ID |
D02UVH
|
| Former ID |
DNC002425
|
| Drug Name |
B-Octylglucoside
|
| Drug Type |
Small molecular drug
|
| Indication |
Discovery agent
|
Investigative |
[1]
|
|---|
| Structure |
|
Download
2D MOL
3D MOL
|
| Formula |
C14H28O6
|
| Canonical SMILES |
CCCCCCCCOC1C(C(C(C(O1)CO)O)O)O
|
| InChI |
1S/C14H28O6/c1-2-3-4-5-6-7-8-19-14-13(18)12(17)11(16)10(9-15)20-14/h10-18H,2-9H2,1H3/t10-,11-,12+,13-,14-/m1/s1
|
| InChIKey |
HEGSGKPQLMEBJL-RKQHYHRCSA-N
|
| PubChem Compound ID |
|
| PubChem Substance ID |
584280, 584291, 584502, 584647, 585869, 813225, 820187, 821369, 822092, 822097, 822455, 822691, 822702, 822788, 822794, 822795, 823843, 823846, 824855, 825420, 825590, 825596, 825599, 825943, 826391, 826438, 827538, 827540, 828754, 829208, 830059, 830125, 830492, 830570, 830755, 832901, 832903, 833551, 834448, 834461, 836814, 837232, 839078, 841302, 3139829, 6436210, 6436707, 7886299, 7887851, 8025150
|
| Target and Pathway |
| Target(s) |
Gastric triacylglycerol lipase |
Target Info |
Inhibitor |
[1]
|
|---|
| Mineralocorticoid receptor |
Target Info |
Inhibitor |
[1]
|
| Triacylglycerol lipase, pancreatic |
Target Info |
Inhibitor |
[1]
|
| Lanosterol synthase |
Target Info |
Inhibitor |
[1]
|
| Prostaglandin G/H synthase 1 |
Target Info |
Inhibitor |
[1]
|
| Rhodopsin |
Target Info |
Inhibitor |
[1]
|
| Prostaglandin G/H synthase 2 |
Target Info |
Inhibitor |
[1]
|
| Apolipoprotein A-II |
Target Info |
Inhibitor |
[1]
|
| Cytochrome B |
Target Info |
Inhibitor |
[1]
|
| Glucocorticoid receptor |
Target Info |
Inhibitor |
[1]
|
| Dihydroorotate dehydrogenase, mitochondrial |
Target Info |
Inhibitor |
[1]
|
| Steryl-sulfatase |
Target Info |
Inhibitor |
[1]
|
| Mitogen-activated protein kinase 14 |
Target Info |
Inhibitor |
[1]
|
| Phospholipase A2, membrane associated |
Target Info |
Inhibitor |
[1]
|
| mRNA of Protein tyrosine phosphatase-1B |
Target Info |
Inhibitor |
[1]
|
| Influenza A virus M2 protein |
Target Info |
Inhibitor |
[1]
|
| Nitric oxide synthase, inducible |
Target Info |
Inhibitor |
[1]
|
|
BioCyc Pathway
|
Triacylglycerol degradationLIPAS-PWY:Triacylglycerol degradation
|
|
Retinol biosynthesisPWY66-3:Cholesterol biosynthesis II (via 24,25-dihydrolanosterol)
|
|
Cholesterol biosynthesis III (via desmosterol)
|
|
Cholesterol biosynthesis I
|
|
Superpathway of cholesterol biosynthesis
|
|
Lanosterol biosynthesisPWY66-374:C20 prostanoid biosynthesisPWY66-393:Aspirin-triggered lipoxin biosynthesis
|
|
Aspirin triggered resolvin D biosynthesis
|
|
C20 prostanoid biosynthesis
|
|
Aspirin triggered resolvin E biosynthesisLIPASYN-PWY:PhospholipasesPWY-4983:Citrulline-nitric oxide cycle
|
|
KEGG Pathway
|
Glycerolipid metabolism
|
|
Metabolic pathways
|
|
Fat digestion and absorptionhsa04960:Aldosterone-regulated sodium reabsorptionhsa00561:Glycerolipid metabolism
|
|
Pancreatic secretion
|
|
Fat digestion and absorption
|
|
Vitamin digestion and absorptionhsa00100:Steroid biosynthesis
|
|
Biosynthesis of antibioticshsa00590:Arachidonic acid metabolism
|
|
Platelet activation
|
|
Serotonergic synapsehsa04744:Phototransductionhsa00590:Arachidonic acid metabolism
|
|
NF-kappa B signaling pathway
|
|
VEGF signaling pathway
|
|
TNF signaling pathway
|
|
Retrograde endocannabinoid signaling
|
|
Serotonergic synapse
|
|
Ovarian steroidogenesis
|
|
Oxytocin signaling pathway
|
|
Regulation of lipolysis in adipocytes
|
|
Leishmaniasis
|
|
Pathways in cancer
|
|
Chemical carcinogenesis
|
|
MicroRNAs in cancer
|
|
Small cell lung cancerhsa03320:PPAR signaling pathwaypfa00190:Oxidative phosphorylation
|
|
Metabolic pathwayshsa04080:Neuroactive ligand-receptor interactionhsa00240:Pyrimidine metabolism
|
|
Metabolic pathwayshsa00140:Steroid hormone biosynthesishsa04010:MAPK signaling pathway
|
|
Rap1 signaling pathway
|
|
FoxO signaling pathway
|
|
Sphingolipid signaling pathway
|
|
Adrenergic signaling in cardiomyocytes
|
|
Osteoclast differentiation
|
|
Signaling pathways regulating pluripotency of stem cells
|
|
Toll-like receptor signaling pathway
|
|
NOD-like receptor signaling pathway
|
|
RIG-I-like receptor signaling pathway
|
|
T cell receptor signaling pathway
|
|
Fc epsilon RI signaling pathway
|
|
Leukocyte transendothelial migration
|
|
Neurotrophin signaling pathway
|
|
Dopaminergic synapse
|
|
Inflammatory mediator regulation of TRP channels
|
|
GnRH signaling pathway
|
|
Progesterone-mediated oocyte maturation
|
|
Prolactin signaling pathway
|
|
Amyotrophic lateral sclerosis (ALS)
|
|
Epithelial cell signaling in Helicobacter pylori infection
|
|
Shigellosis
|
|
Salmonella infection
|
|
Pertussis
|
|
Chagas disease (American trypanosomiasis)
|
|
Toxoplasmosis
|
|
Tuberculosis
|
|
Hepatitis C
|
|
Influenza A
|
|
Epstein-Barr virus infection
|
|
Proteoglycans in cancerhsa00564:Glycerophospholipid metabolism
|
|
Ether lipid metabolism
|
|
Arachidonic acid metabolism
|
|
Linoleic acid metabolism
|
|
alpha-Linolenic acid metabolism
|
|
Ras signaling pathway
|
|
Vascular smooth muscle contraction
|
|
Fat digestion and absorptionhsa04520:Adherens junction
|
|
Insulin signaling pathwayhsa00220:Arginine biosynthesis
|
|
Arginine and proline metabolism
|
|
Calcium signaling pathway
|
|
HIF-1 signaling pathway
|
|
Peroxisome
|
|
Amoebiasis
|
|
Small cell lung cancer
|
|
NetPath Pathway
|
EGFR1 Signaling PathwayNetPath_7:TGF_beta_Receptor Signaling PathwayNetPath_13:IL1 Signaling Pathway
|
|
TSH Signaling Pathway
|
|
IL4 Signaling Pathway
|
|
TGF_beta_Receptor Signaling Pathway
|
|
IL5 Signaling PathwayNetPath_14:IL2 Signaling Pathway
|
|
TCR Signaling PathwayNetPath_17:IL5 Signaling Pathway
|
|
FSH Signaling Pathway
|
|
TCR Signaling PathwayNetPath_25:FSH Signaling PathwayNetPath_13:IL1 Signaling Pathway
|
|
IL2 Signaling Pathway
|
|
PANTHER Pathway
|
Cholesterol biosynthesisP00031:Inflammation mediated by chemokine and cytokine signaling pathwayP00028:Heterotrimeric G-protein signaling pathway-rod outer segment phototransductionP00019:Endothelin signaling pathway
|
|
Inflammation mediated by chemokine and cytokine signaling pathway
|
|
Toll receptor signaling pathway
|
|
CCKR signaling map STP00003:Alzheimer disease-amyloid secretase pathway
|
|
Angiogenesis
|
|
B cell activation
|
|
EGF receptor signaling pathway
|
|
FGF signaling pathway
|
|
Interferon-gamma signaling pathway
|
|
Oxidative stress response
|
|
Parkinson disease
|
|
TGF-beta signaling pathway
|
|
VEGF signaling pathway
|
|
Ras Pathway
|
|
p53 pathway feedback loops 2
|
|
p38 MAPK pathway
|
|
CCKR signaling map STP00012:Cadherin signaling pathway
|
|
Pathway Interaction Database
|
Visual signal transduction: Rodsnfat_tfpathway:Calcineurin-regulated NFAT-dependent transcription in lymphocytes
|
|
S1P1 pathway
|
|
C-MYB transcription factor network
|
|
Signaling mediated by p38-alpha and p38-beta
|
|
Calcium signaling in the CD4+ TCR pathwaysmad2_3nuclearpathway:Regulation of nuclear SMAD2/3 signaling
|
|
Signaling events mediated by HDAC Class II
|
|
FOXA2 and FOXA3 transcription factor networks
|
|
Glucocorticoid receptor regulatory network
|
|
Regulation of Androgen receptor activity
|
|
AP-1 transcription factor networkendothelinpathway:Endothelins
|
|
BCR signaling pathway
|
|
p73 transcription factor network
|
|
p38 MAPK signaling pathway
|
|
Atypical NF-kappaB pathway
|
|
IL4-mediated signaling events
|
|
CD40/CD40L signaling
|
|
IL12-mediated signaling events
|
|
Regulation of p38-alpha and p38-beta
|
|
CDC42 signaling events
|
|
Angiopoietin receptor Tie2-mediated signaling
|
|
FAS (CD95) signaling pathway
|
|
Thromboxane A2 receptor signaling
|
|
Role of Calcineurin-dependent NFAT signaling in lymphocytes
|
|
IL2-mediated signaling events
|
|
Rapid glucocorticoid signaling
|
|
ATF-2 transcription factor network
|
|
IL6-mediated signaling events
|
|
p38 signaling mediated by MAPKAP kinases
|
|
Retinoic acid receptors-mediated signaling
|
|
CXCR3-mediated signaling events
|
|
EPO signaling pathway
|
|
Signaling events mediated by VEGFR1 and VEGFR2
|
|
p53 pathway
|
|
S1P2 pathway
|
|
Trk receptor signaling mediated by the MAPK pathway
|
|
VEGFR3 signaling in lymphatic endothelium
|
|
FGF signaling pathway
|
|
RAC1 signaling pathway
|
|
Regulation of retinoblastoma proteinglypican_1pathway:Glypican 1 networkinsulin_pathway:Insulin Pathway
|
|
Signaling events mediated by Hepatocyte Growth Factor Receptor (c-Met)
|
|
Signaling events mediated by PTP1B
|
|
Calcineurin-regulated NFAT-dependent transcription in lymphocytes
|
|
Signaling events mediated by TCPTP
|
|
IGF1 pathway
|
|
EGF receptor (ErbB1) signaling pathway
|
|
Posttranslational regulation of adherens junction stability and dissassembly
|
|
PDGFR-beta signaling pathway
|
|
N-cadherin signaling eventsil12_2pathway:IL12-mediated signaling events
|
|
Alpha9 beta1 integrin signaling events
|
|
IL23-mediated signaling events
|
|
HIF-1-alpha transcription factor network
|
|
PathWhiz Pathway
|
Kidney FunctionPW000050:Steroid BiosynthesisPW000044:Arachidonic Acid MetabolismPW000044:Arachidonic Acid MetabolismPW000160:Pyrimidine MetabolismPW000045:Androgen and Estrogen MetabolismPW000453:Fc Epsilon Receptor I Signaling in Mast Cells
|
|
Reactome
|
Retinoid metabolism and transportR-HSA-191273:Cholesterol biosynthesis
|
|
Activation of gene expression by SREBF (SREBP)R-HSA-2453902:The canonical retinoid cycle in rods (twilight vision)
|
|
Inactivation, recovery and regulation of the phototransduction cascade
|
|
G alpha (i) signalling eventsR-HSA-174800:Chylomicron-mediated lipid transport
|
|
PPARA activates gene expression
|
|
Retinoid metabolism and transportR-HSA-1368108:BMAL1:CLOCK,NPAS2 activates circadian gene expressionR-HSA-500753:Pyrimidine biosynthesisR-HSA-1660662:Glycosphingolipid metabolismR-HSA-168638:NOD1/2 Signaling Pathway
|
|
p38MAPK events
|
|
ERK/MAPK targets
|
|
Activation of PPARGC1A (PGC-1alpha) by phosphorylation
|
|
Oxidative Stress Induced Senescence
|
|
CDO in myogenesis
|
|
DSCAM interactions
|
|
ADP signalling through P2Y purinoceptor 1
|
|
Platelet sensitization by LDL
|
|
VEGFA-VEGFR2 Pathway
|
|
activated TAK1 mediates p38 MAPK activation
|
|
Activation of the AP-1 family of transcription factors
|
|
KSRP (KHSRP) binds and destabilizes mRNAR-HSA-1482788:Acyl chain remodelling of PC
|
|
Acyl chain remodelling of PE
|
|
Acyl chain remodelling of PIR-HSA-354192:Integrin alphaIIb beta3 signaling
|
|
Regulation of IFNG signaling
|
|
Regulation of IFNA signaling
|
|
Growth hormone receptor signalingR-HSA-1222556:ROS production in response to bacteria
|
|
Nitric oxide stimulates guanylate cyclase
|
|
WikiPathways
|
Triacylglyceride Synthesis
|
|
Fatty Acid Beta OxidationWP554:ACE Inhibitor PathwayWP2776:Visual phototransduction
|
|
Lipid digestion, mobilization, and transportWP2706:Activation of Gene Expression by SREBP (SREBF)
|
|
SREBP signalling
|
|
Cholesterol Biosynthesis
|
|
Cholesterol biosynthesisWP98:Prostaglandin Synthesis and Regulation
|
|
Arachidonic acid metabolism
|
|
Phase 1 - Functionalization of compounds
|
|
Eicosanoid Synthesis
|
|
Selenium Micronutrient NetworkWP455:GPCRs, Class A Rhodopsin-like
|
|
Visual phototransduction
|
|
Regulation of Microtubule Cytoskeleton
|
|
Integrated Breast Cancer Pathway
|
|
Integrin-mediated Cell AdhesionWP98:Prostaglandin Synthesis and Regulation
|
|
Aryl Hydrocarbon Receptor
|
|
Quercetin and Nf-kB/ AP-1 Induced Cell Apoptosis
|
|
Spinal Cord Injury
|
|
Integrated Pancreatic Cancer Pathway
|
|
Selenium Micronutrient NetworkWP558:Complement and Coagulation Cascades
|
|
Statin Pathway
|
|
Nuclear Receptors Meta-Pathway
|
|
PPAR Alpha Pathway
|
|
Regulation of Lipid Metabolism by Peroxisome proliferator-activated receptor alpha (PPARalpha)
|
|
Lipid digestion, mobilization, and transportWP734:Serotonin Receptor 4/6/7 and NR3C Signaling
|
|
SIDS Susceptibility Pathways
|
|
Endoderm Differentiation
|
|
Hair Follicle Development: Cytodifferentiation (Part 3 of 3)
|
|
Adipogenesis
|
|
Circadian Clock
|
|
Nuclear ReceptorsWP1851:Metabolism of nucleotidesWP697:Estrogen metabolism
|
|
Vitamin D Receptor Pathway
|
|
Sphingolipid metabolismWP75:Toll-like receptor signaling pathway
|
|
Monoamine Transport
|
|
Serotonin HTR1 Group and FOS Pathway
|
|
TCR Signaling Pathway
|
|
Senescence and Autophagy in Cancer
|
|
Interferon type I signaling pathways
|
|
Insulin Signaling
|
|
EGF/EGFR Signaling Pathway
|
|
MAPK Cascade
|
|
Oxidative Stress
|
|
p38 MAPK Signaling Pathway
|
|
IL-4 Signaling Pathway
|
|
MAPK Signaling Pathway
|
|
TGF beta Signaling Pathway
|
|
Kit receptor signaling pathway
|
|
Cardiac Hypertrophic Response
|
|
MAP kinase activation in TLR cascade
|
|
Regulation of mRNA Stability by Proteins that Bind AU-rich Elements
|
|
Nanoparticle-mediated activation of receptor signaling
|
|
Structural Pathway of Interleukin 1 (IL-1)
|
|
JAK/STAT
|
|
Amyotrophic lateral sclerosis (ALS)
|
|
Alpha 6 Beta 4 signaling pathway
|
|
Cardiac Progenitor Differentiation
|
|
BDNF signaling pathway
|
|
Oncostatin M Signaling Pathway
|
|
Parkinsons Disease Pathway
|
|
Corticotropin-releasing hormone
|
|
AGE/RAGE pathway
|
|
B Cell Receptor Signaling Pathway
|
|
Prostate Cancer
|
|
TSLP Signaling Pathway
|
|
TWEAK Signaling Pathway
|
|
FSH signaling pathway
|
|
Leptin signaling pathway
|
|
RANKL/RANK Signaling Pathway
|
|
miR-targeted genes in muscle cell - TarBase
|
|
miR-targeted genes in lymphocytes - TarBase
|
|
miR-targeted genes in leukocytes - TarBase
|
|
miR-targeted genes in epithelium - TarBase
|
|
IL-1 signaling pathway
|
|
Signal amplification
|
|
Platelet homeostasis
|
|
NGF signalling via TRKA from the plasma membrane
|
|
Myogenesis
|
|
DSCAM interactions
|
|
MicroRNAs in cardiomyocyte hypertrophy
|
|
Angiogenesis
|
|
Physiological and Pathological Hypertrophy of the Heart
|
|
Regulation of toll-like receptor signaling pathwayWP2795:Cardiac Hypertrophic Response
|
|
Glycerophospholipid biosynthesis
|
|
Glycerophospholipid Biosynthetic Pathway
|
|
MicroRNAs in cardiomyocyte hypertrophyWP481:Insulin Signaling
|
|
Growth hormone receptor signaling
|
|
Interferon gamma signaling
|
|
Interferon alpha/beta signaling
|
|
Integrin alphaIIb beta3 signalingWP2683:Influenza Life CycleWP619:Type II interferon signaling (IFNG)
|
|
Effects of Nitric Oxide
|
| References |
| REF 1 | How many drug targets are there? Nat Rev Drug Discov. 2006 Dec;5(12):993-6. |
|---|
