| Drug General Information |
| Drug ID |
D0P3KA
|
| Former ID |
DNC003775
|
| Drug Name |
TEBUFELONE
|
| Drug Type |
Small molecular drug
|
| Indication |
Pain [ICD9: 338, 356.0, 356.8,780; ICD10:G64, G90.0, R52, G89]
|
Discontinued in Phase 2 |
[1]
|
|---|
| Structure |
|
Download
2D MOL
3D MOL
|
| Formula |
C20H28O2
|
| Canonical SMILES |
CC(C)(C)C1=CC(=CC(=C1O)C(C)(C)C)C(=O)CCCC#C
|
| InChI |
1S/C20H28O2/c1-8-9-10-11-17(21)14-12-15(19(2,3)4)18(22)16(13-14)20(5,6)7/h1,12-13,22H,9-11H2,2-7H3
|
| InChIKey |
ZHXUEUKVDMWSKV-UHFFFAOYSA-N
|
| PubChem Compound ID |
|
| Target and Pathway |
| Target(s) |
Prostaglandin G/H synthase 1 |
Target Info |
Inhibitor |
[2]
|
|---|
| Prostaglandin G/H synthase 2 |
Target Info |
Inhibitor |
[2]
|
| Arachidonate 5-lipoxygenase |
Target Info |
Inhibitor |
[2]
|
| mRNA of human 5-lipoxygenase |
Target Info |
Inhibitor |
[3]
|
|
BioCyc Pathway
|
C20 prostanoid biosynthesisPWY66-393:Aspirin-triggered lipoxin biosynthesis
|
|
Aspirin triggered resolvin D biosynthesis
|
|
C20 prostanoid biosynthesis
|
|
Aspirin triggered resolvin E biosynthesisPWY66-393:Aspirin-triggered lipoxin biosynthesis
|
|
Resolvin D biosynthesis
|
|
Leukotriene biosynthesis
|
|
Lipoxin biosynthesis
|
|
Aspirin triggered resolvin E biosynthesis
|
|
KEGG Pathway
|
Arachidonic acid metabolism
|
|
Metabolic pathways
|
|
Platelet activation
|
|
Serotonergic synapsehsa00590:Arachidonic acid metabolism
|
|
NF-kappa B signaling pathway
|
|
VEGF signaling pathway
|
|
TNF signaling pathway
|
|
Retrograde endocannabinoid signaling
|
|
Serotonergic synapse
|
|
Ovarian steroidogenesis
|
|
Oxytocin signaling pathway
|
|
Regulation of lipolysis in adipocytes
|
|
Leishmaniasis
|
|
Pathways in cancer
|
|
Chemical carcinogenesis
|
|
MicroRNAs in cancer
|
|
Small cell lung cancerhsa00590:Arachidonic acid metabolism
|
|
Toxoplasmosishsa00590:Arachidonic acid metabolism
|
|
Toxoplasmosis
|
|
NetPath Pathway
|
TGF_beta_Receptor Signaling PathwayNetPath_13:IL1 Signaling Pathway
|
|
TSH Signaling Pathway
|
|
IL4 Signaling Pathway
|
|
TGF_beta_Receptor Signaling Pathway
|
|
IL5 Signaling PathwayNetPath_16:IL4 Signaling PathwayNetPath_16:IL4 Signaling Pathway
|
|
PANTHER Pathway
|
Inflammation mediated by chemokine and cytokine signaling pathwayP00019:Endothelin signaling pathway
|
|
Inflammation mediated by chemokine and cytokine signaling pathway
|
|
Toll receptor signaling pathway
|
|
CCKR signaling map ST
|
|
Pathway Interaction Database
|
Calcineurin-regulated NFAT-dependent transcription in lymphocytes
|
|
S1P1 pathway
|
|
C-MYB transcription factor network
|
|
Signaling mediated by p38-alpha and p38-beta
|
|
Calcium signaling in the CD4+ TCR pathway
|
|
PathWhiz Pathway
|
Arachidonic Acid MetabolismPW000044:Arachidonic Acid MetabolismPW000044:Arachidonic Acid MetabolismPW000044:Arachidonic Acid Metabolism
|
|
WikiPathways
|
Prostaglandin Synthesis and Regulation
|
|
Arachidonic acid metabolism
|
|
Phase 1 - Functionalization of compounds
|
|
Eicosanoid Synthesis
|
|
Selenium Micronutrient NetworkWP98:Prostaglandin Synthesis and Regulation
|
|
Aryl Hydrocarbon Receptor
|
|
Quercetin and Nf-kB/ AP-1 Induced Cell Apoptosis
|
|
Spinal Cord Injury
|
|
Integrated Pancreatic Cancer Pathway
|
|
Selenium Micronutrient NetworkWP2877:Vitamin D Receptor Pathway
|
|
Selenium Micronutrient NetworkWP2650:Arachidonic acid metabolism
|
|
Selenium Micronutrient Network
|
| References |
| REF 1 | Trusted, scientifically sound profiles of drug programs, clinical trials, safety reports, and company deals, written by scientists. Springer. 2015. Adis Insight (drug id 800002346) |
|---|
| REF 2 | J Med Chem. 1998 Mar 26;41(7):1124-37.New cyclooxygenase-2/5-lipoxygenase inhibitors. 2. 7-tert-butyl-2,3-dihydro-3,3-dimethylbenzofuran derivatives as gastrointestinal safe antiinflammatory and analgesic agents: variations of the dihydrobenzofuran ring. |
|---|
| REF 3 | J Med Chem. 1998 Aug 27;41(18):3515-29.New cyclooxygenase-2/5-lipoxygenase inhibitors. 3. 7-tert-butyl-2, 3-dihydro-3,3-dimethylbenzofuran derivatives as gastrointestinal safe antiinflammatory and analgesic agents: variations at the 5 position. |
|---|
