| Drug General Information |
| Drug ID |
D0N2KU
|
| Former ID |
DNC009881
|
| Drug Name |
PF-3409409
|
| Drug Type |
Small molecular drug
|
| Indication |
Attention deficit hyperactivity disorder [ICD9: 314; ICD10:F90]
|
Investigative |
[1]
|
|---|
| Structure |
|
Download
2D MOL
3D MOL
|
| Formula |
C17H21F3N2O
|
| Canonical SMILES |
C1CC(C1)CN(C2CCNC2)C(=O)C3=CC=CC=C3C(F)(F)F
|
| InChI |
1S/C17H21F3N2O/c18-17(19,20)15-7-2-1-6-14(15)16(23)22(11-12-4-3-5-12)13-8-9-21-10-13/h1-2,6-7,12-13,21H,3-5,8-11H2/t13-/m0/s1
|
| InChIKey |
SWADTMSKMJUFBO-ZDUSSCGKSA-N
|
| PubChem Compound ID |
|
| Target and Pathway |
| Target(s) |
Sodium-dependent noradrenaline transporter |
Target Info |
Inhibitor |
[1]
|
|---|
| Muscarinic acetylcholine receptor M5 |
Target Info |
Inhibitor |
[1]
|
| Sodium-dependent dopamine transporter |
Target Info |
Inhibitor |
[1]
|
| Sodium-dependent serotonin transporter |
Target Info |
Inhibitor |
[1]
|
| Muscarinic acetylcholine receptor M4 |
Target Info |
Inhibitor |
[1]
|
|
KEGG Pathway
|
Calcium signaling pathway
|
|
Neuroactive ligand-receptor interaction
|
|
Cholinergic synapse
|
|
Regulation of actin cytoskeletonhsa04728:Dopaminergic synapse
|
|
Parkinson's disease
|
|
Cocaine addiction
|
|
Amphetamine addiction
|
|
Alcoholismhsa04726:Serotonergic synapsehsa04080:Neuroactive ligand-receptor interaction
|
|
Regulation of actin cytoskeleton
|
|
NetPath Pathway
|
TCR Signaling Pathway
|
|
PANTHER Pathway
|
Adrenaline and noradrenaline biosynthesisP00003:Alzheimer disease-amyloid secretase pathway
|
|
Heterotrimeric G-protein signaling pathway-Gq alpha and Go alpha mediated pathwayP00001:Adrenaline and noradrenaline biosynthesis
|
|
Parkinson disease
|
|
Dopamine receptor mediated signaling pathwayP04373:5HT1 type receptor mediated signaling pathway
|
|
5HT2 type receptor mediated signaling pathway
|
|
5HT3 type receptor mediated signaling pathway
|
|
5HT4 type receptor mediated signaling pathwayP00003:Alzheimer disease-amyloid secretase pathway
|
|
Heterotrimeric G-protein signaling pathway-Gi alpha and Gs alpha mediated pathway
|
|
Heterotrimeric G-protein signaling pathway-Gq alpha and Go alpha mediated pathway
|
|
Muscarinic acetylcholine receptor 2 and 4 signaling pathway
|
|
Pathway Interaction Database
|
Alpha-synuclein signaling
|
|
Reactome
|
Na+/Cl- dependent neurotransmitter transportersR-HSA-390648:Muscarinic acetylcholine receptors
|
|
G alpha (q) signalling eventsR-HSA-442660:Na+/Cl- dependent neurotransmitter transportersR-HSA-390648:Muscarinic acetylcholine receptors
|
|
G alpha (i) signalling events
|
|
WikiPathways
|
Monoamine Transport
|
|
NRF2 pathway
|
|
Transport of glucose and other sugars, bile salts and organic acids, metal ions and amine compoundsWP58:Monoamine GPCRs
|
|
Calcium Regulation in the Cardiac Cell
|
|
Regulation of Actin Cytoskeleton
|
|
GPCRs, Class A Rhodopsin-like
|
|
Gastrin-CREB signalling pathway via PKC and MAPK
|
|
GPCR ligand binding
|
|
GPCR downstream signalingWP727:Monoamine Transport
|
|
Dopaminergic Neurogenesis
|
|
Parkinsons Disease Pathway
|
|
Transport of glucose and other sugars, bile salts and organic acids, metal ions and amine compounds
|
|
Neurotransmitter Clearance In The Synaptic CleftWP727:Monoamine Transport
|
|
SIDS Susceptibility Pathways
|
|
Synaptic Vesicle Pathway
|
|
Serotonin Transporter ActivityWP58:Monoamine GPCRs
|
|
GPCR downstream signaling
|
| References |
| REF 1 | Bioorg Med Chem Lett. 2009 Aug 15;19(16):4579-83. Epub 2009 Jul 2.Design, synthesis and evaluation of N-[(3S)-pyrrolidin-3-yl]benzamides as selective noradrenaline reuptake inhibitors: CNS penetration in a more polar template. |
|---|
