| Drug General Information |
| Drug ID |
D00QCP
|
| Former ID |
DNC010974
|
| Drug Name |
(2S,3S)-2-Phenyl-3,5,5-trimethylmorpholin-2-ol
|
| Drug Type |
Small molecular drug
|
| Indication |
Discovery agent
|
Investigative |
[1]
|
|---|
| Structure |
|
Download
2D MOL
3D MOL
|
| Formula |
C13H19NO2
|
| Canonical SMILES |
CC1C(OCC(N1)(C)C)(C2=CC=CC=C2)O
|
| InChI |
1S/C13H19NO2/c1-10-13(15,11-7-5-4-6-8-11)16-9-12(2,3)14-10/h4-8,10,14-15H,9H2,1-3H3/t10-,13+/m0/s1
|
| InChIKey |
NGHJSSNVKXEBAB-GXFFZTMASA-N
|
| PubChem Compound ID |
|
| Target and Pathway |
| Target(s) |
Neuronal acetylcholine receptor protein, alpha-4 chain |
Target Info |
Inhibitor |
[1]
|
|---|
| Sodium-dependent dopamine transporter |
Target Info |
Inhibitor |
[1]
|
| Sodium-dependent noradrenaline transporter |
Target Info |
Inhibitor |
[1]
|
| Neuronal acetylcholine receptor protein, beta-4 chain |
Target Info |
Inhibitor |
[1]
|
| Neuronal acetylcholine receptor protein, beta-2 chain |
Target Info |
Inhibitor |
[1]
|
|
KEGG Pathway
|
Neuroactive ligand-receptor interaction
|
|
Cholinergic synapse
|
|
Nicotine addictionhsa04728:Dopaminergic synapse
|
|
Parkinson's disease
|
|
Cocaine addiction
|
|
Amphetamine addiction
|
|
Alcoholismhsa04080:Neuroactive ligand-receptor interaction
|
|
Cholinergic synapsehsa04080:Neuroactive ligand-receptor interaction
|
|
Nicotine addiction
|
|
PANTHER Pathway
|
Nicotinic acetylcholine receptor signaling pathway
|
|
Nicotine pharmacodynamics pathwayP00001:Adrenaline and noradrenaline biosynthesis
|
|
Parkinson disease
|
|
Dopamine receptor mediated signaling pathwayP00001:Adrenaline and noradrenaline biosynthesisP00044:Nicotinic acetylcholine receptor signaling pathway
|
|
Nicotine pharmacodynamics pathwayP00044:Nicotinic acetylcholine receptor signaling pathway
|
|
Nicotine pharmacodynamics pathway
|
|
Pathway Interaction Database
|
Alpha-synuclein signaling
|
|
Reactome
|
Highly sodium permeable acetylcholine nicotinic receptors
|
|
Highly calcium permeable postsynaptic nicotinic acetylcholine receptors
|
|
Highly calcium permeable nicotinic acetylcholine receptorsR-HSA-442660:Na+/Cl- dependent neurotransmitter transportersR-HSA-442660:Na+/Cl- dependent neurotransmitter transportersR-HSA-629587:Highly sodium permeable acetylcholine nicotinic receptors
|
|
Highly calcium permeable nicotinic acetylcholine receptorsR-HSA-629587:Highly sodium permeable acetylcholine nicotinic receptors
|
|
Highly calcium permeable nicotinic acetylcholine receptors
|
|
WikiPathways
|
SIDS Susceptibility Pathways
|
|
Neurotransmitter Receptor Binding And Downstream Transmission In The Postsynaptic Cell
|
|
Nicotine Activity on Dopaminergic NeuronsWP727:Monoamine Transport
|
|
NRF2 pathway
|
|
Dopaminergic Neurogenesis
|
|
Parkinsons Disease Pathway
|
|
Transport of glucose and other sugars, bile salts and organic acids, metal ions and amine compounds
|
|
Neurotransmitter Clearance In The Synaptic CleftWP727:Monoamine Transport
|
|
Transport of glucose and other sugars, bile salts and organic acids, metal ions and amine compoundsWP706:SIDS Susceptibility Pathways
|
|
Nicotine Activity on Chromaffin CellsWP706:SIDS Susceptibility Pathways
|
|
Nicotine Activity on Dopaminergic Neurons
|
| References |
| REF 1 | J Med Chem. 2010 Jun 24;53(12):4731-48.Synthesis and characterization of in vitro and in vivo profiles of hydroxybupropion analogues: aids to smoking cessation. |
|---|
