| Drug General Information |
| Drug ID |
D0Q5PL
|
| Former ID |
DNC005383
|
| Drug Name |
INDOPROFEN
|
| Drug Type |
Small molecular drug
|
| Indication |
Gout [ICD9: 274.00274.1274.8274.9; ICD10:M10]
|
Withdrawn from market |
[1]
|
|---|
| Structure |
|
Download
2D MOL
3D MOL
|
| Formula |
C17H15NO3
|
| Canonical SMILES |
CC(C1=CC=C(C=C1)N2CC3=CC=CC=C3C2=O)C(=O)O
|
| InChI |
1S/C17H15NO3/c1-11(17(20)21)12-6-8-14(9-7-12)18-10-13-4-2-3-5-15(13)16(18)19/h2-9,11H,10H2,1H3,(H,20,21)
|
| InChIKey |
RJMIEHBSYVWVIN-UHFFFAOYSA-N
|
| CAS Number |
CAS 31842-01-0
|
| PubChem Compound ID |
|
| SuperDrug ATC ID |
M01AE10
|
| Target and Pathway |
| Target(s) |
Fatty acid-binding protein, liver |
Target Info |
Inhibitor |
[2]
|
|---|
| High affinity interleukin-8 receptor B |
Target Info |
Inhibitor |
[3]
|
| High affinity interleukin-8 receptor A |
Target Info |
Inhibitor |
[3]
|
| Prostaglandin G/H synthase 2 |
Target Info |
Inhibitor |
[3]
|
| Prostaglandin G/H synthase 1 |
Target Info |
Inhibitor |
[3]
|
|
BioCyc Pathway
|
Aspirin-triggered lipoxin biosynthesis
|
|
Aspirin triggered resolvin D biosynthesis
|
|
C20 prostanoid biosynthesis
|
|
Aspirin triggered resolvin E biosynthesisPWY66-374:C20 prostanoid biosynthesis
|
|
KEGG Pathway
|
PPAR signaling pathway
|
|
Fat digestion and absorptionhsa04060:Cytokine-cytokine receptor interaction
|
|
Chemokine signaling pathway
|
|
Endocytosis
|
|
Epithelial cell signaling in Helicobacter pylori infectionhsa04060:Cytokine-cytokine receptor interaction
|
|
Epithelial cell signaling in Helicobacter pylori infectionhsa00590:Arachidonic acid metabolism
|
|
Metabolic pathways
|
|
NF-kappa B signaling pathway
|
|
VEGF signaling pathway
|
|
TNF signaling pathway
|
|
Retrograde endocannabinoid signaling
|
|
Serotonergic synapse
|
|
Ovarian steroidogenesis
|
|
Oxytocin signaling pathway
|
|
Regulation of lipolysis in adipocytes
|
|
Leishmaniasis
|
|
Pathways in cancer
|
|
Chemical carcinogenesis
|
|
MicroRNAs in cancer
|
|
Small cell lung cancerhsa00590:Arachidonic acid metabolism
|
|
Platelet activation
|
|
NetPath Pathway
|
TNFalpha Signaling PathwayNetPath_14:IL2 Signaling PathwayNetPath_13:IL1 Signaling Pathway
|
|
TSH Signaling Pathway
|
|
IL4 Signaling Pathway
|
|
TGF_beta_Receptor Signaling Pathway
|
|
IL5 Signaling PathwayNetPath_7:TGF_beta_Receptor Signaling Pathway
|
|
PANTHER Pathway
|
Inflammation mediated by chemokine and cytokine signaling pathway
|
|
Interleukin signaling pathwayP00031:Inflammation mediated by chemokine and cytokine signaling pathway
|
|
Interleukin signaling pathwayP00019:Endothelin signaling pathway
|
|
Toll receptor signaling pathway
|
|
CCKR signaling map STP00031:Inflammation mediated by chemokine and cytokine signaling pathway
|
|
Pathway Interaction Database
|
IL8- and CXCR2-mediated signaling eventsil8cxcr1_pathway:IL8- and CXCR1-mediated signaling eventsnfat_tfpathway:Calcineurin-regulated NFAT-dependent transcription in lymphocytes
|
|
S1P1 pathway
|
|
C-MYB transcription factor network
|
|
Signaling mediated by p38-alpha and p38-beta
|
|
Calcium signaling in the CD4+ TCR pathway
|
|
PathWhiz Pathway
|
Arachidonic Acid MetabolismPW000044:Arachidonic Acid Metabolism
|
|
Reactome
|
Hormone-sensitive lipase (HSL)-mediated triacylglycerol hydrolysis
|
|
PPARA activates gene expression
|
|
Regulation of lipid metabolism by Peroxisome proliferator-activated receptor alpha (PPARalpha)R-HSA-380108:Chemokine receptors bind chemokines
|
|
G alpha (i) signalling eventsR-HSA-380108:Chemokine receptors bind chemokines
|
|
G alpha (i) signalling events
|
|
WikiPathways
|
Nuclear Receptors Meta-Pathway
|
|
PPAR Alpha Pathway
|
|
Selenium Metabolism and Selenoproteins
|
|
Regulation of Lipid Metabolism by Peroxisome proliferator-activated receptor alpha (PPARalpha)WP455:GPCRs, Class A Rhodopsin-like
|
|
Peptide GPCRs
|
|
GPCR ligand binding
|
|
GPCR downstream signaling
|
|
GPCRs, OtherWP455:GPCRs, Class A Rhodopsin-like
|
|
Differentiation Pathway
|
|
GPCRs, OtherWP98:Prostaglandin Synthesis and Regulation
|
|
Arachidonic acid metabolism
|
|
Aryl Hydrocarbon Receptor
|
|
Quercetin and Nf-kB/ AP-1 Induced Cell Apoptosis
|
|
Spinal Cord Injury
|
|
Integrated Pancreatic Cancer Pathway
|
|
Eicosanoid Synthesis
|
|
Selenium Micronutrient NetworkWP98:Prostaglandin Synthesis and Regulation
|
|
Phase 1 - Functionalization of compounds
|
|
Selenium Micronutrient Network
|
| References |
| REF 1 | Drugs@FDA. U.S. Food and Drug Administration. U.S. Department of Health & Human Services. 2015 |
|---|
| REF 2 | J Med Chem. 2008 Jul 10;51(13):3755-64. Epub 2008 Jun 6.Characterization of the drug binding specificity of rat liver fatty acid binding protein. |
|---|
| REF 3 | J Med Chem. 2005 Jun 30;48(13):4312-31.2-Arylpropionic CXC chemokine receptor 1 (CXCR1) ligands as novel noncompetitive CXCL8 inhibitors. |
|---|
