| Drug General Information |
| Drug ID |
D0B7GU
|
| Former ID |
DNC003299
|
| Drug Name |
Dihydromorphine
|
| Drug Type |
Small molecular drug
|
| Indication |
Discovery agent
|
Investigative |
[1]
|
|---|
| Structure |
|
Download
2D MOL
3D MOL
|
| Formula |
C17H21NO3
|
| InChI |
InChI=1S/C17H21NO3/c1-18-7-6-17-10-3-5-13(20)16(17)21-15-12(19)4-2-9(14(15)17)8-11(10)18/h2,4,10-11,13,16,19-20H,3,5-8H2,1H3/t10-,11+,13-,16-,17-/m0/s1
|
| InChIKey |
IJVCSMSMFSCRME-KBQPJGBKSA-N
|
| CAS Number |
CAS 509-60-4
|
| PubChem Compound ID |
|
| PubChem Substance ID |
13946, 11653640, 15096631, 39383772, 46506587, 49992800, 57361919, 78298828, 103556978, 128178362, 134977597, 135650183, 137248653, 144206439, 160964809, 198978460, 223439543, 225145639, 226414220, 241108168
|
| Target and Pathway |
| Target(s) |
Mu-type opioid receptor |
Target Info |
Agonist |
[2]
|
|---|
| Kappa-type opioid receptor |
Target Info |
Agonist |
[2]
|
| Corticotropin-lipotropin |
Target Info |
Agonist |
[2]
|
| Delta-type opioid receptor |
Target Info |
Agonist |
[2]
|
|
KEGG Pathway
|
Neuroactive ligand-receptor interaction
|
|
Estrogen signaling pathway
|
|
Morphine addictionhsa04080:Neuroactive ligand-receptor interactionhsa04916:Melanogenesis
|
|
Adipocytokine signaling pathwayhsa04022:cGMP-PKG signaling pathway
|
|
Sphingolipid signaling pathway
|
|
NetPath Pathway
|
TCR Signaling PathwayNetPath_2:AndrogenReceptor Signaling Pathway
|
|
PANTHER Pathway
|
Heterotrimeric G-protein signaling pathway-Gi alpha and Gs alpha mediated pathway
|
|
Heterotrimeric G-protein signaling pathway-Gq alpha and Go alpha mediated pathway
|
|
Enkephalin releaseP00026:Heterotrimeric G-protein signaling pathway-Gi alpha and Gs alpha mediated pathway
|
|
Opioid prodynorphin pathwayP04380:Cortocotropin releasing factor receptor signaling pathway
|
|
Opioid proopiomelanocortin pathwayP00026:Heterotrimeric G-protein signaling pathway-Gi alpha and Gs alpha mediated pathway
|
|
Enkephalin release
|
|
Opioid proenkephalin pathway
|
|
Opioid proopiomelanocortin pathway
|
|
Pathway Interaction Database
|
IL4-mediated signaling eventsreg_gr_pathway:Glucocorticoid receptor regulatory network
|
|
Syndecan-3-mediated signaling events
|
|
PathWhiz Pathway
|
Corticotropin Activation of Cortisol Production
|
|
Reactome
|
Peptide ligand-binding receptors
|
|
G alpha (i) signalling eventsR-HSA-375276:Peptide ligand-binding receptors
|
|
G alpha (i) signalling eventsR-HSA-193048:Androgen biosynthesis
|
|
Glucocorticoid biosynthesis
|
|
Endogenous sterols
|
|
G alpha (s) signalling events
|
|
G alpha (i) signalling events
|
|
WikiPathways
|
TCR Signaling Pathway
|
|
GPCRs, Class A Rhodopsin-like
|
|
Peptide GPCRs
|
|
Opioid Signalling
|
|
GPCR ligand binding
|
|
GPCR downstream signalingWP455:GPCRs, Class A Rhodopsin-like
|
|
GPCR downstream signalingWP2749:Metabolism of steroid hormones and vitamin D
|
|
Metabolism of amino acids and derivatives
|
|
Peptide hormone biosynthesis
|
|
Corticotropin-releasing hormone
|
|
Phase 1 - Functionalization of compounds
|
|
GPCR downstream signaling
|
| References |
| REF 1 | (http://www.guidetopharmacology.org/) Nucleic Acids Res. 2015 Oct 12. pii: gkv1037. The IUPHAR/BPS Guide to PHARMACOLOGY in 2016: towards curated quantitative interactions between 1300 protein targets and 6000 ligands. (Ligand id: 1616). |
|---|
| REF 2 | Opiate receptor binding properties of morphine-, dihydromorphine-, and codeine 6-O-sulfate ester congeners. Bioorg Med Chem Lett. 2006 Aug 15;16(16):4291-5. Epub 2006 Jun 13. |
|---|
