| Drug General Information |
| Drug ID |
D0ZB3X
|
| Former ID |
DNC012444
|
| Drug Name |
RX-821002
|
| Drug Type |
Small molecular drug
|
| Indication |
Discovery agent
|
Investigative |
[1]
|
|---|
| Structure |
|
Download
2D MOL
|
| Formula |
C12H14N2O3
|
| InChI |
InChI=1S/C12H14N2O3/c1-15-12(11-13-6-7-14-11)8-16-9-4-2-3-5-10(9)17-12/h2-5H,6-8H2,1H3,(H,13,14)
|
| InChIKey |
HQGWKNGAKBPTBX-UHFFFAOYSA-N
|
| PubChem Compound ID |
|
| PubChem Substance ID |
840954, 842020, 7536812, 7980550, 10234596, 11364712, 11367274, 11369836, 11378000, 11495622, 14749421, 44436992, 47572603, 48168573, 48393132, 49979496, 50104814, 57338437, 76822660, 85209706, 85788141, 90341601, 103169829, 103930440, 104380489, 124750201, 124881351, 128097672, 134224937, 134349649, 135066174, 135650954, 135651200, 136905176, 140884806, 141391967, 152253110, 162169298, 179236103, 228600997
|
| Target and Pathway |
| Target(s) |
Alpha-2C adrenergic receptor |
Target Info |
Inhibitor |
[2]
|
|---|
| Alpha-1A adrenergic receptor |
Target Info |
Inhibitor |
[2]
|
| Alpha-1B adrenergic receptor |
Target Info |
Inhibitor |
[2]
|
| Alpha-2A adrenergic receptor |
Target Info |
Inhibitor |
[2]
|
| Alpha-2B adrenergic receptor |
Target Info |
Inhibitor |
[2]
|
| Alpha-1D adrenergic receptor |
Target Info |
Inhibitor |
[2]
|
|
KEGG Pathway
|
cGMP-PKG signaling pathway
|
|
Neuroactive ligand-receptor interactionhsa04020:Calcium signaling pathway
|
|
Neuroactive ligand-receptor interaction
|
|
AMPK signaling pathway
|
|
Adrenergic signaling in cardiomyocytes
|
|
Vascular smooth muscle contraction
|
|
Salivary secretionhsa04020:Calcium signaling pathway
|
|
Salivary secretionhsa04022:cGMP-PKG signaling pathway
|
|
Neuroactive ligand-receptor interactionhsa04022:cGMP-PKG signaling pathway
|
|
Salivary secretion
|
|
NetPath Pathway
|
IL2 Signaling PathwayNetPath_14:IL2 Signaling Pathway
|
|
PANTHER Pathway
|
Alpha adrenergic receptor signaling pathway
|
|
Heterotrimeric G-protein signaling pathway-Gi alpha and Gs alpha mediated pathwayP00002:Alpha adrenergic receptor signaling pathwayP00002:Alpha adrenergic receptor signaling pathwayP00002:Alpha adrenergic receptor signaling pathwayP00002:Alpha adrenergic receptor signaling pathway
|
|
Heterotrimeric G-protein signaling pathway-Gi alpha and Gs alpha mediated pathway
|
|
Pathway Interaction Database
|
LPA receptor mediated events
|
|
Reactome
|
Adrenoceptors
|
|
Adrenaline signalling through Alpha-2 adrenergic receptor
|
|
Adrenaline,noradrenaline inhibits insulin secretion
|
|
G alpha (i) signalling events
|
|
G alpha (z) signalling events
|
|
Surfactant metabolismR-HSA-390696:Adrenoceptors
|
|
G alpha (q) signalling events
|
|
G alpha (12/13) signalling eventsR-HSA-390696:Adrenoceptors
|
|
G alpha (z) signalling eventsR-HSA-390696:Adrenoceptors
|
|
G alpha (12/13) signalling events
|
|
WikiPathways
|
Monoamine GPCRs
|
|
GPCRs, Class A Rhodopsin-like
|
|
Platelet Aggregation (Plug Formation)
|
|
Integration of energy metabolism
|
|
GPCR ligand binding
|
|
GPCR downstream signalingWP58:Monoamine GPCRs
|
|
Calcium Regulation in the Cardiac Cell
|
|
Gastrin-CREB signalling pathway via PKC and MAPK
|
|
Endothelin Pathways
|
|
GPCR downstream signaling
|
|
AMPK SignalingWP58:Monoamine GPCRs
|
|
Vitamin D Receptor Pathway
|
|
GPCRs, Other
|
| References |
| REF 1 | (http://www.guidetopharmacology.org/) Nucleic Acids Res. 2015 Oct 12. pii: gkv1037. The IUPHAR/BPS Guide to PHARMACOLOGY in 2016: towards curated quantitative interactions between 1300 protein targets and 6000 ligands. (Ligand id: 526). |
|---|
| REF 2 | J Med Chem. 1986 Oct;29(10):2000-3.Alpha-adrenoreceptor reagents. 4. Resolution of some potent selective prejunctional alpha 2-adrenoreceptor antagonists. |
|---|
