| Drug General Information |
| Drug ID |
D0U7GK
|
| Former ID |
DAP000865
|
| Drug Name |
Thalidomide
|
| Synonyms |
Algosediv; Asmadion; Asmaval; Bonbrain; Bonbrrin; Calmore; Calmorex; Contergan; Corronarobetin; Distaval; Distaxal; Distoval; Ectiluran; Enterosediv; Gastrinide; Glupan; Glutanon; Grippex; Hippuzon; Imidene; Isomin; Kedavon; Kevadon; Neaufatin; Neosedyn; Neosydyn; Nerosedyn; Neufatin; Neurodyn; Neurosedin; Neurosedym; Neurosedyn; Nevrodyn; Nibrol; Noctosediv; Noxodyn; Pangul; Pantosediv; Polygripan; Profarmil; Psycholiquid; Psychotablets; Quetimid; Quietoplex; Sandormin; Sedalis; Sedimide; Sedin; Sedisperil; Sedoval; Shinnibrol; Sleepan; Slipro; Softenil; Softenon; Synovir; Talargan; Talidomida; Talidomide; Talimol; Talismol; Talizer; Telagan; Telargan; Telargean; Tensival; Thaled; Thalidomidum; Thalin; Thalinette; Thalomid; Thalomide; Theophilcholine; Valgis; Valgraine; Yodomin; Celgene Brand of Thalidomide; Talidomide [DCIT]; Thalidomide Celgene; Thalidomide Pharmion; Asidon 3; ENMD 0995; IN1061; K 17; Thalidomine USP26; Alpha-Phthalimidoglutarimide; E-217; Imida-lab; Imidan (peyta); K-17; N-Phthalimidoglutamic acid imide; N-Phthaloylglutamimide; N-Phthalylglutamic acid imide; Poly-Giron; Predni-Sediv; Pro-Bam M; Pro-ban M; Sedalis sedi-lab; Shin-naito S; THALIDOMIDE (AIDS INITIATIVE); Talidomida [INN-Spanish]; Thaled (TN); Thalidomide (soluble form); Thalidomidum [INN-Latin]; Thalomid (TM); Thalomid (TN); Thalomid, Thalidomide; Alpha-N-Phthalylglutaramide; Thalidomide [USAN:INN:BAN]; Alpha-(N-Phthalimido)glutarimide; N-Phthalyl-glutaminsaeure-imid; N-Phthalyl-glutaminsaeure-imid [German]; Thalidomide (+ and-); Thalidomide (JAN/USP/INN); N-(2,6-Dioxo-3-piperidyl)phthalimide; (+)-Thalidomide; (+-)-Thalidomide; (+/-)-THALIDOMIDE; (inverted question mark)-Thalidomide; 2,6-Dioxo-3-phthalimidopiperidine; 3-Phthalimidoglutarimide
|
| Drug Type |
Small molecular drug
|
| Indication |
Multiple myeloma [ICD9: 203; ICD10:C90]
|
Approved |
[1],
[2]
|
|---|
| Therapeutic Class |
Immunosuppressive Agents
|
| Structure |
|
Download
2D MOL
3D MOL
|
| Formula |
C13H10N2O4
|
| InChI |
InChI=1S/C13H10N2O4/c16-10-6-5-9(11(17)14-10)15-12(18)7-3-1-2-4-8(7)13(15)19/h1-4,9H,5-6H2,(H,14,16,17)
|
| InChIKey |
UEJJHQNACJXSKW-UHFFFAOYSA-N
|
| CAS Number |
CAS 50-35-1
|
| PubChem Compound ID |
|
| PubChem Substance ID |
10112, 111716, 398060, 398061, 482479, 596356, 5642997, 7847819, 7980770, 8150004, 8153340, 10321467, 10524356, 11120267, 11120755, 11121243, 11121763, 11122243, 11335226, 11360465, 11362910, 11364734, 11365472, 11367296, 11368034, 11369858, 11371011, 11371012, 11372649, 11372899, 11373635, 11374612, 11375458, 11376196, 11378022, 11428259, 11450681, 11461437, 11466220, 11467340, 11484629, 11485800, 11488523, 11491530, 11492901, 11532929, 12013404, 14798889, 17405778, 22391552
|
| SuperDrug ATC ID |
L04AX02
|
| SuperDrug CAS ID |
cas=000050351
|
| Target and Pathway |
| Target(s) |
Tumor necrosis factor |
Target Info |
Inhibitor |
[3]
|
|---|
|
KEGG Pathway
|
MAPK signaling pathway
|
|
Cytokine-cytokine receptor interaction
|
|
NF-kappa B signaling pathway
|
|
Sphingolipid signaling pathway
|
|
mTOR signaling pathway
|
|
Apoptosis
|
|
TGF-beta signaling pathway
|
|
Osteoclast differentiation
|
|
Antigen processing and presentation
|
|
Toll-like receptor signaling pathway
|
|
NOD-like receptor signaling pathway
|
|
RIG-I-like receptor signaling pathway
|
|
Hematopoietic cell lineage
|
|
Natural killer cell mediated cytotoxicity
|
|
T cell receptor signaling pathway
|
|
Fc epsilon RI signaling pathway
|
|
TNF signaling pathway
|
|
Adipocytokine signaling pathway
|
|
Type II diabetes mellitus
|
|
Non-alcoholic fatty liver disease (NAFLD)
|
|
Type I diabetes mellitus
|
|
Alzheimer's disease
|
|
Amyotrophic lateral sclerosis (ALS)
|
|
Pertussis
|
|
Legionellosis
|
|
Leishmaniasis
|
|
Chagas disease (American trypanosomiasis)
|
|
African trypanosomiasis
|
|
Malaria
|
|
Toxoplasmosis
|
|
Amoebiasis
|
|
Tuberculosis
|
|
Hepatitis C
|
|
Hepatitis B
|
|
Influenza A
|
|
HTLV-I infection
|
|
Herpes simplex infection
|
|
Proteoglycans in cancer
|
|
Asthma
|
|
Inflammatory bowel disease (IBD)
|
|
Systemic lupus erythematosus
|
|
Rheumatoid arthritis
|
|
Allograft rejection
|
|
Graft-versus-host disease
|
|
Hypertrophic cardiomyopathy (HCM)
|
|
Dilated cardiomyopathy
|
|
NetPath Pathway
|
TCR Signaling Pathway
|
|
IL2 Signaling Pathway
|
|
IL3 Signaling Pathway
|
|
IL4 Signaling Pathway
|
|
Leptin Signaling Pathway
|
|
RANKL Signaling Pathway
|
|
IL1 Signaling Pathway
|
|
PANTHER Pathway
|
Apoptosis signaling pathway
|
|
Wnt signaling pathway
|
|
Pathway Interaction Database
|
IL27-mediated signaling events
|
|
Canonical NF-kappaB pathway
|
|
Calcineurin-regulated NFAT-dependent transcription in lymphocytes
|
|
Angiopoietin receptor Tie2-mediated signaling
|
|
Signaling events mediated by HDAC Class I
|
|
TNF receptor signaling pathway
|
|
Ceramide signaling pathway
|
|
amb2 Integrin signaling
|
|
RXR and RAR heterodimerization with other nuclear receptor
|
|
IL23-mediated signaling events
|
|
HIV-1 Nef: Negative effector of Fas and TNF-alpha
|
|
Caspase Cascade in Apoptosis
|
|
Cellular roles of Anthrax toxin
|
|
Downstream signaling in naï
|
|
PathWhiz Pathway
|
Fc Epsilon Receptor I Signaling in Mast Cells
|
|
Reactome
|
Transcriptional regulation of white adipocyte differentiation
|
|
TNFR1-induced proapoptotic signaling
|
|
Regulation of TNFR1 signaling
|
|
TNFR1-induced NFkappaB signaling pathway
|
|
TNFR1-mediated ceramide production
|
|
TNFR2 non-canonical NF-kB pathway
|
|
TNF signaling
|
|
WikiPathways
|
Toll-like receptor signaling pathway
|
|
Monoamine Transport
|
|
SIDS Susceptibility Pathways
|
|
TGF Beta Signaling Pathway
|
|
Cytokines and Inflammatory Response
|
|
MAPK Signaling Pathway
|
|
EV release from cardiac cells and their functional effects
|
|
FAS pathway and Stress induction of HSP regulation
|
|
Apoptosis-related network due to altered Notch3 in ovarian cancer
|
|
Cardiac Hypertrophic Response
|
|
Transcriptional Regulation of White Adipocyte Differentiation
|
|
Aryl Hydrocarbon Receptor
|
|
Apoptosis
|
|
Nanoparticle triggered regulated necrosis
|
|
Amyotrophic lateral sclerosis (ALS)
|
|
Adipogenesis
|
|
Allograft Rejection
|
|
TNF alpha Signaling Pathway
|
|
TWEAK Signaling Pathway
|
|
Extrinsic Pathway for Apoptosis
|
|
Folate Metabolism
|
|
MicroRNAs in cardiomyocyte hypertrophy
|
|
Vitamin B12 Metabolism
|
|
Selenium Micronutrient Network
|
|
Regulation of toll-like receptor signaling pathway
|
|
Matrix Metalloproteinases
|
| References |
| REF 1 | Thalidomide in multiple myeloma--clinical trials and aspects of drug metabolism and toxicity. Expert Opin Drug Metab Toxicol. 2008 Jul;4(7):973-85. |
|---|
| REF 2 | (http://www.guidetopharmacology.org/) Nucleic Acids Res. 2015 Oct 12. pii: gkv1037. The IUPHAR/BPS Guide to PHARMACOLOGY in 2016: towards curated quantitative interactions between 1300 protein targets and 6000 ligands. (Ligand id: 7327). |
|---|
| REF 3 | Efficacy of different thalidomide regimens for patients with multiple myeloma and its relationship with TNF-alpha level. Zhongguo Shi Yan Xue Ye Xue Za Zhi. 2008 Dec;16(6):1312-5. |
|---|
