| Drug General Information |
| Drug ID |
D0R7WU
|
| Former ID |
DNC012502
|
| Drug Name |
ACECLIDINE
|
| Drug Type |
Small molecular drug
|
| Indication |
Glaucoma [ICD9: 365; ICD10:H40-H42]
|
Approved |
[1],
[2]
|
|---|
| Structure |
|
Download
2D MOL
3D MOL
|
| Formula |
C9H16NO2+
|
| InChI |
InChI=1S/C9H15NO2/c1-7(11)12-9-6-10-4-2-8(9)3-5-10/h8-9H,2-6H2,1H3/p+1/t9-/m0/s1
|
| InChIKey |
WRJPSSPFHGNBMG-VIFPVBQESA-O
|
| CAS Number |
CAS 827-61-2
|
| PubChem Compound ID |
|
| PubChem Substance ID |
|
| SuperDrug ATC ID |
S01EB08
|
| Target and Pathway |
| Target(s) |
Muscarinic acetylcholine receptor M5 |
Target Info |
Inhibitor |
[3]
|
|---|
| Muscarinic acetylcholine receptor M4 |
Target Info |
Inhibitor |
[3]
|
| Muscarinic acetylcholine receptor M3 |
Target Info |
Inhibitor |
[3]
|
| Muscarinic acetylcholine receptor M1 |
Target Info |
Inhibitor |
[3]
|
| Muscarinic acetylcholine receptor M2 |
Target Info |
Inhibitor |
[3]
|
|
KEGG Pathway
|
Calcium signaling pathway
|
|
Neuroactive ligand-receptor interaction
|
|
Cholinergic synapse
|
|
Regulation of actin cytoskeletonhsa04080:Neuroactive ligand-receptor interaction
|
|
Regulation of actin cytoskeletonhsa04020:Calcium signaling pathway
|
|
Regulation of actin cytoskeleton
|
|
Insulin secretion
|
|
Salivary secretion
|
|
Gastric acid secretion
|
|
Pancreatic secretionhsa04020:Calcium signaling pathway
|
|
cAMP signaling pathway
|
|
PI3K-Akt signaling pathway
|
|
PANTHER Pathway
|
Alzheimer disease-amyloid secretase pathway
|
|
Heterotrimeric G-protein signaling pathway-Gq alpha and Go alpha mediated pathwayP00003:Alzheimer disease-amyloid secretase pathway
|
|
Heterotrimeric G-protein signaling pathway-Gi alpha and Gs alpha mediated pathway
|
|
Heterotrimeric G-protein signaling pathway-Gq alpha and Go alpha mediated pathway
|
|
Muscarinic acetylcholine receptor 2 and 4 signaling pathwayP00003:Alzheimer disease-amyloid secretase pathway
|
|
Muscarinic acetylcholine receptor 1 and 3 signaling pathwayP00003:Alzheimer disease-amyloid secretase pathway
|
|
Muscarinic acetylcholine receptor 2 and 4 signaling pathway
|
|
PathWhiz Pathway
|
Gastric Acid ProductionPW000564:Muscle/Heart Contraction
|
|
Reactome
|
Muscarinic acetylcholine receptors
|
|
G alpha (q) signalling eventsR-HSA-390648:Muscarinic acetylcholine receptors
|
|
G alpha (i) signalling eventsR-HSA-390648:Muscarinic acetylcholine receptors
|
|
Acetylcholine regulates insulin secretion
|
|
G alpha (i) signalling events
|
|
WikiPathways
|
Monoamine GPCRs
|
|
Calcium Regulation in the Cardiac Cell
|
|
Regulation of Actin Cytoskeleton
|
|
GPCRs, Class A Rhodopsin-like
|
|
Gastrin-CREB signalling pathway via PKC and MAPK
|
|
GPCR ligand binding
|
|
GPCR downstream signalingWP58:Monoamine GPCRs
|
|
Integration of energy metabolism
|
|
GPCR downstream signaling
|
|
GPCRs, OtherWP58:Monoamine GPCRs
|
|
Secretion of Hydrochloric Acid in Parietal Cells
|
|
GPCR downstream signalingWP706:SIDS Susceptibility Pathways
|
|
GPCRs, Other
|
| References |
| REF 1 | (http://www.guidetopharmacology.org/) Nucleic Acids Res. 2015 Oct 12. pii: gkv1037. The IUPHAR/BPS Guide to PHARMACOLOGY in 2016: towards curated quantitative interactions between 1300 protein targets and 6000 ligands. (Ligand id: 288). |
|---|
| REF 2 | Drugs@FDA. U.S. Food and Drug Administration. U.S. Department of Health & Human Services. 2015 |
|---|
| REF 3 | J Med Chem. 1993 Apr 2;36(7):842-7.Design, synthesis, and neurochemical evaluation of 5-(3-alkyl-1,2,4- oxadiazol-5-yl)-1,4,5,6-tetrahydropyrimidines as M1 muscarinic receptor agonists. |
|---|
