| Drug General Information |
| Drug ID |
D0I9LU
|
| Former ID |
DIB018876
|
| Drug Name |
arecaidine propargyl ester
|
| Drug Type |
Small molecular drug
|
| Indication |
Discovery agent
|
Investigative |
[1]
|
|---|
| Structure |
|
Download
2D MOL
|
| Formula |
C10H13NO2
|
| InChI |
InChI=1S/C10H13NO2/c1-3-7-13-10(12)9-5-4-6-11(2)8-9/h1,5H,4,6-8H2,2H3
|
| InChIKey |
SPHRJZBOFYIKMC-UHFFFAOYSA-N
|
| PubChem Compound ID |
|
| PubChem Substance ID |
4652566, 8151507, 11110678, 15066891, 26755653, 29221404, 47959966, 50110952, 51142691, 85208955, 85788597, 90340877, 103122115, 103363737, 104299982, 117575717, 124749478, 124879028, 124879029, 135649955, 136230474, 162510755, 238184172, 250020095
|
| Target and Pathway |
| Target(s) |
Muscarinic acetylcholine receptor M3 |
Target Info |
Agonist |
[2]
|
|---|
| Muscarinic receptor |
Target Info |
Agonist |
[2]
|
|
KEGG Pathway
|
Calcium signaling pathway
|
|
Neuroactive ligand-receptor interaction
|
|
Cholinergic synapse
|
|
Regulation of actin cytoskeleton
|
|
Insulin secretion
|
|
Salivary secretion
|
|
Gastric acid secretion
|
|
Pancreatic secretionhsa04020:Calcium signaling pathway
|
|
cAMP signaling pathway
|
|
PI3K-Akt signaling pathway
|
|
PANTHER Pathway
|
Alzheimer disease-amyloid secretase pathway
|
|
Heterotrimeric G-protein signaling pathway-Gq alpha and Go alpha mediated pathway
|
|
Muscarinic acetylcholine receptor 1 and 3 signaling pathway
|
|
PathWhiz Pathway
|
Gastric Acid ProductionPW000564:Muscle/Heart Contraction
|
|
Reactome
|
Muscarinic acetylcholine receptors
|
|
Acetylcholine regulates insulin secretion
|
|
G alpha (q) signalling eventsR-HSA-390648:Muscarinic acetylcholine receptors
|
|
G alpha (q) signalling events
|
|
WikiPathways
|
Monoamine GPCRs
|
|
Calcium Regulation in the Cardiac Cell
|
|
Regulation of Actin Cytoskeleton
|
|
GPCRs, Class A Rhodopsin-like
|
|
Gastrin-CREB signalling pathway via PKC and MAPK
|
|
Integration of energy metabolism
|
|
GPCR ligand binding
|
|
GPCR downstream signaling
|
|
GPCRs, OtherWP58:Monoamine GPCRs
|
|
Secretion of Hydrochloric Acid in Parietal Cells
|
| References |
| REF 1 | (http://www.guidetopharmacology.org/) Nucleic Acids Res. 2015 Oct 12. pii: gkv1037. The IUPHAR/BPS Guide to PHARMACOLOGY in 2016: towards curated quantitative interactions between 1300 protein targets and 6000 ligands. (Ligand id: 295). |
|---|
| REF 2 | Positive cooperativity of acetylcholine and other agonists with allosteric ligands on muscarinic acetylcholine receptors. Mol Pharmacol. 1997 Jul;52(1):172-9. |
|---|
