| Drug General Information |
| Drug ID |
D0I4ME
|
| Former ID |
DNC003311
|
| Drug Name |
MMDA
|
| Drug Type |
Small molecular drug
|
| Indication |
Discovery agent
|
Investigative |
[1]
|
|---|
| Structure |
|
Download
2D MOL
3D MOL
|
| Formula |
C11H15NO3
|
| Canonical SMILES |
CC(CC1=CC2=C(C(=C1)OC)OCO2)N
|
| InChI |
1S/C11H15NO3/c1-7(12)3-8-4-9(13-2)11-10(5-8)14-6-15-11/h4-5,7H,3,6,12H2,1-2H3
|
| InChIKey |
YQYUWUKDEVZFDB-UHFFFAOYSA-N
|
| CAS Number |
CAS 13674-05-0
|
| PubChem Compound ID |
|
| PubChem Substance ID |
841184, 8168993, 11078692, 15291764, 29293041, 46506802, 50004586, 57310189, 80019684, 103357129, 104296574, 117603350, 124954060, 129835394, 134990556, 137005509, 160964709, 180370896, 227920482, 249912023
|
| Target and Pathway |
| Target(s) |
Sodium-dependent noradrenaline transporter |
Target Info |
Modulator |
[1]
|
|---|
| Synaptic vesicle amine transporter |
Target Info |
Antagonist |
[1]
|
| Amine oxidase [flavin-containing] B |
Target Info |
Antagonist |
[1]
|
| Sodium-dependent dopamine transporter |
Target Info |
Modulator |
[1]
|
| Amine oxidase [flavin-containing] A |
Target Info |
Antagonist |
[1]
|
| Sodium-dependent serotonin transporter |
Target Info |
Modulator |
[1]
|
| 5-hydroxytryptamine 2A receptor |
Target Info |
Agonist |
[1]
|
|
BioCyc Pathway
|
Superpathway of tryptophan utilization
|
|
Tryptophan degradation via tryptamine
|
|
Dopamine degradation
|
|
Putrescine degradation III
|
|
Noradrenaline and adrenaline degradationPWY66-401:Superpathway of tryptophan utilization
|
|
Noradrenaline and adrenaline degradation
|
|
Serotonin degradation
|
|
Superpathway of melatonin degradation
|
|
Melatonin degradation II
|
|
KEGG Pathway
|
Synaptic vesicle cycle
|
|
Serotonergic synapse
|
|
Dopaminergic synapse
|
|
Parkinson's disease
|
|
Cocaine addiction
|
|
Amphetamine addiction
|
|
Alcoholismhsa00260:Glycine, serine and threonine metabolism
|
|
Arginine and proline metabolism
|
|
Histidine metabolism
|
|
Tyrosine metabolism
|
|
Phenylalanine metabolism
|
|
Tryptophan metabolism
|
|
Drug metabolism - cytochrome P450
|
|
Metabolic pathways
|
|
Alcoholismhsa04728:Dopaminergic synapse
|
|
Alcoholismhsa04726:Serotonergic synapsehsa04020:Calcium signaling pathway
|
|
Neuroactive ligand-receptor interaction
|
|
Gap junction
|
|
Inflammatory mediator regulation of TRP channels
|
|
NetPath Pathway
|
IL4 Signaling PathwayNetPath_11:TCR Signaling Pathway
|
|
PANTHER Pathway
|
Adrenaline and noradrenaline biosynthesisP00001:Adrenaline and noradrenaline biosynthesis
|
|
5HT1 type receptor mediated signaling pathway
|
|
5HT2 type receptor mediated signaling pathway
|
|
5HT3 type receptor mediated signaling pathway
|
|
5HT4 type receptor mediated signaling pathway
|
|
Dopamine receptor mediated signaling pathway
|
|
Nicotine pharmacodynamics pathway
|
|
CCKR signaling map STP00001:Adrenaline and noradrenaline biosynthesis
|
|
5-Hydroxytryptamine degredation
|
|
Dopamine receptor mediated signaling pathwayP00001:Adrenaline and noradrenaline biosynthesis
|
|
Parkinson disease
|
|
Dopamine receptor mediated signaling pathwayP04373:5HT1 type receptor mediated signaling pathway
|
|
5HT4 type receptor mediated signaling pathwayP04374:5HT2 type receptor mediated signaling pathway
|
|
Pathway Interaction Database
|
Alpha-synuclein signalingalphasynuclein_pathway:Alpha-synuclein signaling
|
|
PathWhiz Pathway
|
Histidine Metabolism
|
|
Tyrosine Metabolism
|
|
Glycine and Serine Metabolism
|
|
Reactome
|
Na+/Cl- dependent neurotransmitter transportersR-HSA-181430:Norepinephrine Neurotransmitter Release Cycle
|
|
Na+/Cl- dependent neurotransmitter transportersR-HSA-442660:Na+/Cl- dependent neurotransmitter transportersR-HSA-181430:Norepinephrine Neurotransmitter Release CycleR-HSA-390666:Serotonin receptors
|
|
G alpha (q) signalling events
|
|
WikiPathways
|
Monoamine Transport
|
|
NRF2 pathway
|
|
Transport of glucose and other sugars, bile salts and organic acids, metal ions and amine compoundsWP2855:Dopaminergic Neurogenesis
|
|
Synaptic Vesicle Pathway
|
|
Neurotransmitter Release Cycle
|
|
Nicotine Activity on Dopaminergic NeuronsWP465:Tryptophan metabolism
|
|
Dopamine metabolism
|
|
Phase 1 - Functionalization of compoundsWP727:Monoamine Transport
|
|
Dopaminergic Neurogenesis
|
|
Parkinsons Disease Pathway
|
|
Transport of glucose and other sugars, bile salts and organic acids, metal ions and amine compounds
|
|
Neurotransmitter Clearance In The Synaptic CleftWP706:SIDS Susceptibility Pathways
|
|
Biogenic Amine Synthesis
|
|
Oxidative Stress
|
|
Phase 1 - Functionalization of compounds
|
|
Neurotransmitter Clearance In The Synaptic Cleft
|
|
Serotonin Transporter ActivityWP727:Monoamine Transport
|
|
SIDS Susceptibility Pathways
|
|
Serotonin Transporter ActivityWP733:Serotonin Receptor 2 and STAT3 Signaling
|
|
Serotonin Receptor 2 and ELK-SRF/GATA4 signaling
|
|
Monoamine GPCRs
|
|
GPCRs, Class A Rhodopsin-like
|
|
Gastrin-CREB signalling pathway via PKC and MAPK
|
|
GPCR ligand binding
|
|
GPCR downstream signaling
|
|
GPCRs, Other
|
| References |
| REF 1 | How many drug targets are there? Nat Rev Drug Discov. 2006 Dec;5(12):993-6. |
|---|
