| Drug General Information |
| Drug ID |
D0EX3I
|
| Former ID |
DNC003324
|
| Drug Name |
3,4-Methylenedioxymethamphetamine
|
| Drug Type |
Small molecular drug
|
| Indication |
Discovery agent
|
Investigative |
[1]
|
|---|
| Structure |
|
Download
2D MOL
3D MOL
|
| Formula |
C11H15NO2
|
| InChI |
InChI=1S/C11H15NO2/c1-8(12-2)5-9-3-4-10-11(6-9)14-7-13-10/h3-4,6,8,12H,5,7H2,1-2H3
|
| InChIKey |
SHXWCVYOXRDMCX-UHFFFAOYSA-N
|
| CAS Number |
CAS 42542-10-9
|
| PubChem Compound ID |
|
| PubChem Substance ID |
9780, 841181, 3249434, 5656638, 7979873, 8147054, 8151203, 10522572, 11336137, 11361376, 11462348, 14748568, 24439938, 46506404, 47365284, 47810836, 47959850, 49884640, 49884641, 50113079, 50876016, 53790135, 57320955, 87245064, 103225016, 103923364, 104298224, 124893453, 125350416, 129238625, 132566090, 134346093, 135001385, 137105423, 139665247, 160964717, 162898916, 164846357, 175443907, 178101295, 179116536, 184533298, 223878256, 226428474, 241079561, 249924006
|
| Target and Pathway |
| Target(s) |
5-hydroxytryptamine 2C receptor |
Target Info |
Agonist |
[2]
|
|---|
| Synaptic vesicle amine transporter |
Target Info |
Antagonist |
[2]
|
| Sodium-dependent noradrenaline transporter |
Target Info |
Modulator |
[2]
|
| Sodium-dependent dopamine transporter |
Target Info |
Modulator |
[2]
|
| 5-hydroxytryptamine 2A receptor |
Target Info |
Agonist |
[2]
|
| 5-hydroxytryptamine 2B receptor |
Target Info |
Agonist |
[2]
|
| Sodium-dependent serotonin transporter |
Target Info |
Modulator |
[2]
|
|
KEGG Pathway
|
Calcium signaling pathway
|
|
Neuroactive ligand-receptor interaction
|
|
Gap junction
|
|
Serotonergic synapse
|
|
Inflammatory mediator regulation of TRP channelshsa04721:Synaptic vesicle cycle
|
|
Dopaminergic synapse
|
|
Parkinson's disease
|
|
Cocaine addiction
|
|
Amphetamine addiction
|
|
Alcoholismhsa04728:Dopaminergic synapse
|
|
Alcoholismhsa04020:Calcium signaling pathway
|
|
Inflammatory mediator regulation of TRP channelshsa04020:Calcium signaling pathway
|
|
Inflammatory mediator regulation of TRP channelshsa04726:Serotonergic synapse
|
|
NetPath Pathway
|
TCR Signaling Pathway
|
|
PANTHER Pathway
|
5HT2 type receptor mediated signaling pathwayP00001:Adrenaline and noradrenaline biosynthesis
|
|
5HT1 type receptor mediated signaling pathway
|
|
5HT2 type receptor mediated signaling pathway
|
|
5HT3 type receptor mediated signaling pathway
|
|
5HT4 type receptor mediated signaling pathway
|
|
Dopamine receptor mediated signaling pathway
|
|
Nicotine pharmacodynamics pathway
|
|
CCKR signaling map STP00001:Adrenaline and noradrenaline biosynthesisP00001:Adrenaline and noradrenaline biosynthesis
|
|
Parkinson disease
|
|
Dopamine receptor mediated signaling pathwayP04374:5HT2 type receptor mediated signaling pathwayP04374:5HT2 type receptor mediated signaling pathwayP04373:5HT1 type receptor mediated signaling pathway
|
|
Pathway Interaction Database
|
Alpha-synuclein signaling
|
|
Reactome
|
Serotonin receptors
|
|
G alpha (q) signalling eventsR-HSA-181430:Norepinephrine Neurotransmitter Release Cycle
|
|
Na+/Cl- dependent neurotransmitter transportersR-HSA-442660:Na+/Cl- dependent neurotransmitter transportersR-HSA-442660:Na+/Cl- dependent neurotransmitter transportersR-HSA-390666:Serotonin receptors
|
|
G alpha (q) signalling eventsR-HSA-390666:Serotonin receptors
|
|
G alpha (q) signalling events
|
|
WikiPathways
|
Serotonin Receptor 2 and ELK-SRF/GATA4 signaling
|
|
Monoamine GPCRs
|
|
GPCRs, Class A Rhodopsin-like
|
|
Gastrin-CREB signalling pathway via PKC and MAPK
|
|
GPCR ligand binding
|
|
GPCR downstream signalingWP2855:Dopaminergic Neurogenesis
|
|
Synaptic Vesicle Pathway
|
|
Neurotransmitter Release Cycle
|
|
Nicotine Activity on Dopaminergic NeuronsWP727:Monoamine Transport
|
|
NRF2 pathway
|
|
Transport of glucose and other sugars, bile salts and organic acids, metal ions and amine compoundsWP727:Monoamine Transport
|
|
Dopaminergic Neurogenesis
|
|
Parkinsons Disease Pathway
|
|
Transport of glucose and other sugars, bile salts and organic acids, metal ions and amine compounds
|
|
Neurotransmitter Clearance In The Synaptic CleftWP733:Serotonin Receptor 2 and STAT3 Signaling
|
|
SIDS Susceptibility Pathways
|
|
GPCR downstream signaling
|
|
GPCRs, OtherWP732:Serotonin Receptor 2 and ELK-SRF/GATA4 signaling
|
|
GPCR downstream signalingWP727:Monoamine Transport
|
|
Serotonin Transporter Activity
|
| References |
| REF 1 | (http://www.guidetopharmacology.org/) Nucleic Acids Res. 2015 Oct 12. pii: gkv1037. The IUPHAR/BPS Guide to PHARMACOLOGY in 2016: towards curated quantitative interactions between 1300 protein targets and 6000 ligands. (Ligand id: 4574). |
|---|
| REF 2 | The origin of <span class="caps">MDMA</span> (ecstasy) revisited: the true story reconstructed from the original documents. Addiction. 2006 Sep;101(9):1241-5. |
|---|
