| Drug General Information |
| Drug ID |
D09QEI
|
| Former ID |
DAP000048
|
| Drug Name |
Pentoxifylline
|
| Synonyms |
Agapurin; Azupentat; Dimethyloxohexylxanthine; Durapental; Hemovas; Ikomio; Oxpentifylline; PENTOXYPHYLINE;PNX; Pentoxifilina; Pentoxifyllin; Pentoxifyllinum; Pentoxil; Pentoxiphyllin; Pentoxiphylline; Pentoxiphyllium; Pentoxyfylline; Pentoxyphyllin; Pentoxyphylline; Ralofect; Rentylin; Torental; Trental;Vasofirin; Vazofirin; Agapurin Retard; BL 191; BL191; EHT 0201; EHT0201; IN1161; P 1784; Artal (TN); BL-191; EHT-0201; EHT-201; Flexital (TN); Pentox (TN); Pentoxifilina [INN-Spanish]; Pentoxifyllinum [INN-Latin]; Pentoxil (TN); Pentoxin (TN); Trental (TN); Cis-9-Octadecenoyl coenzyme A; Pentoxifylline [USAN:INN:JAN]; Pentoxifylline (JAN/USP/INN); 1,2,3,6-Tetrahydro-3,7-dimethyl-1-(5-oxohexyl)-2,6-purindion; 1-(5-Oxohexyl)-3,7-dimethylxanthine; 1-(5-Oxohexyl)theobromine; 3,7-Dihydro-3,7-dimethyl-1-(5-oxohexyl)-1H-purine-2,6-dione; 3,7-Dimethyl-1-(5-oxo-hexyl)-3,7-dihydro-purine-2,6-dione; 3,7-Dimethyl-1-(5-oxohexyl) xantine; 3,7-Dimethyl-1-(5-oxohexyl)-1H,3H-purin-2,6-dione; 3,7-Dimethyl-1-(5-oxohexyl)-3,7-dihydro-1H-purine-2,6-dione; 3,7-Dimethyl-1-(5-oxohexyl)xanthine; 3,7-Dimethyl-1-(5-oxohexyl)xantine; 3,7-dimethyl-1-(5-oxohexyl)purine-2,6-dione
|
| Drug Type |
Antibody
|
| Indication |
Intermittent claudication [ICD9: 440.21; ICD10:I73.9]
|
Approved |
[1],
[2]
|
|---|
| Therapeutic Class |
Vasodilator Agents
|
| Company |
Aventis Pharmaceuticals Inc.
|
| Structure |
|
Download
2D MOL
3D MOL
|
| Formula |
C13H18N4O3
|
| InChI |
InChI=1S/C13H18N4O3/c1-9(18)6-4-5-7-17-12(19)10-11(14-8-15(10)2)16(3)13(17)20/h8H,4-7H2,1-3H3
|
| InChIKey |
BYPFEZZEUUWMEJ-UHFFFAOYSA-N
|
| CAS Number |
CAS 6493-05-6
|
| PubChem Compound ID |
|
| PubChem Substance ID |
9628, 498489, 597360, 857899, 1916632, 3153146, 7703125, 7847567, 7889976, 8026211, 8150006, 8152909, 10321577, 10531727, 10589689, 11111613, 11111614, 11335904, 11361143, 11364338, 11366900, 11369462, 11373038, 11374032, 11377624, 11462115, 11466224, 11467344, 11484957, 11485808, 11488997, 11491635, 11492042, 11495258, 14799544, 17405494, 25623640, 26538474, 26612497, 26679957, 26719692, 26747196, 26747197, 26759331, 29223826, 46386861, 46393770, 46505940, 46511426, 47216797
|
| SuperDrug ATC ID |
C04AD03
|
| SuperDrug CAS ID |
cas=006493056
|
| Target and Pathway |
| Target(s) |
Tumor necrosis factor |
Target Info |
|
[3],
[4]
|
|---|
|
KEGG Pathway
|
MAPK signaling pathway
|
|
Cytokine-cytokine receptor interaction
|
|
NF-kappa B signaling pathway
|
|
Sphingolipid signaling pathway
|
|
mTOR signaling pathway
|
|
Apoptosis
|
|
TGF-beta signaling pathway
|
|
Osteoclast differentiation
|
|
Antigen processing and presentation
|
|
Toll-like receptor signaling pathway
|
|
NOD-like receptor signaling pathway
|
|
RIG-I-like receptor signaling pathway
|
|
Hematopoietic cell lineage
|
|
Natural killer cell mediated cytotoxicity
|
|
T cell receptor signaling pathway
|
|
Fc epsilon RI signaling pathway
|
|
TNF signaling pathway
|
|
Adipocytokine signaling pathway
|
|
Type II diabetes mellitus
|
|
Non-alcoholic fatty liver disease (NAFLD)
|
|
Type I diabetes mellitus
|
|
Alzheimer's disease
|
|
Amyotrophic lateral sclerosis (ALS)
|
|
Pertussis
|
|
Legionellosis
|
|
Leishmaniasis
|
|
Chagas disease (American trypanosomiasis)
|
|
African trypanosomiasis
|
|
Malaria
|
|
Toxoplasmosis
|
|
Amoebiasis
|
|
Tuberculosis
|
|
Hepatitis C
|
|
Hepatitis B
|
|
Influenza A
|
|
HTLV-I infection
|
|
Herpes simplex infection
|
|
Proteoglycans in cancer
|
|
Asthma
|
|
Inflammatory bowel disease (IBD)
|
|
Systemic lupus erythematosus
|
|
Rheumatoid arthritis
|
|
Allograft rejection
|
|
Graft-versus-host disease
|
|
Hypertrophic cardiomyopathy (HCM)
|
|
Dilated cardiomyopathy
|
|
NetPath Pathway
|
TCR Signaling Pathway
|
|
IL2 Signaling Pathway
|
|
IL3 Signaling Pathway
|
|
IL4 Signaling Pathway
|
|
Leptin Signaling Pathway
|
|
RANKL Signaling Pathway
|
|
IL1 Signaling Pathway
|
|
PANTHER Pathway
|
Apoptosis signaling pathway
|
|
Wnt signaling pathway
|
|
Pathway Interaction Database
|
IL27-mediated signaling events
|
|
Canonical NF-kappaB pathway
|
|
Calcineurin-regulated NFAT-dependent transcription in lymphocytes
|
|
Angiopoietin receptor Tie2-mediated signaling
|
|
Signaling events mediated by HDAC Class I
|
|
TNF receptor signaling pathway
|
|
Ceramide signaling pathway
|
|
amb2 Integrin signaling
|
|
RXR and RAR heterodimerization with other nuclear receptor
|
|
IL23-mediated signaling events
|
|
HIV-1 Nef: Negative effector of Fas and TNF-alpha
|
|
Caspase Cascade in Apoptosis
|
|
Cellular roles of Anthrax toxin
|
|
Downstream signaling in naï
|
|
PathWhiz Pathway
|
Fc Epsilon Receptor I Signaling in Mast Cells
|
|
Reactome
|
Transcriptional regulation of white adipocyte differentiation
|
|
TNFR1-induced proapoptotic signaling
|
|
Regulation of TNFR1 signaling
|
|
TNFR1-induced NFkappaB signaling pathway
|
|
TNFR1-mediated ceramide production
|
|
TNFR2 non-canonical NF-kB pathway
|
|
TNF signaling
|
|
WikiPathways
|
Toll-like receptor signaling pathway
|
|
Monoamine Transport
|
|
SIDS Susceptibility Pathways
|
|
TGF Beta Signaling Pathway
|
|
Cytokines and Inflammatory Response
|
|
MAPK Signaling Pathway
|
|
EV release from cardiac cells and their functional effects
|
|
FAS pathway and Stress induction of HSP regulation
|
|
Apoptosis-related network due to altered Notch3 in ovarian cancer
|
|
Cardiac Hypertrophic Response
|
|
Transcriptional Regulation of White Adipocyte Differentiation
|
|
Aryl Hydrocarbon Receptor
|
|
Apoptosis
|
|
Nanoparticle triggered regulated necrosis
|
|
Amyotrophic lateral sclerosis (ALS)
|
|
Adipogenesis
|
|
Allograft Rejection
|
|
TNF alpha Signaling Pathway
|
|
TWEAK Signaling Pathway
|
|
Extrinsic Pathway for Apoptosis
|
|
Folate Metabolism
|
|
MicroRNAs in cardiomyocyte hypertrophy
|
|
Vitamin B12 Metabolism
|
|
Selenium Micronutrient Network
|
|
Regulation of toll-like receptor signaling pathway
|
|
Matrix Metalloproteinases
|
| References |
| REF 1 | New drugs in development for the treatment of endometriosis. Expert Opin Investig Drugs. 2008 Aug;17(8):1187-202. |
|---|
| REF 2 | (http://www.guidetopharmacology.org/) Nucleic Acids Res. 2015 Oct 12. pii: gkv1037. The IUPHAR/BPS Guide to PHARMACOLOGY in 2016: towards curated quantitative interactions between 1300 protein targets and 6000 ligands. (Ligand id: 7095). |
|---|
| REF 3 | Tumor necrosis factor alpha in the pathogenesis of cerebral malaria. Cell Mol Life Sci. 2003 Aug;60(8):1623-35. |
|---|
| REF 4 | Targeted therapies in myelodysplastic syndromes: ASH 2003 review. Semin Hematol. 2004 Apr;41(2 Suppl 4):13-20. |
|---|
