| Drug General Information |
| Drug ID |
D09CKI
|
| Former ID |
DNC003964
|
| Drug Name |
CORYNANTHEINE
|
| Drug Type |
Small molecular drug
|
| Indication |
Discovery agent
|
Investigative |
[1]
|
|---|
| Structure |
|
Download
2D MOL
3D MOL
|
| Formula |
C22H26N2O3
|
| Canonical SMILES |
COC=C(C1CC2C3=C(CCN2CC1C=C)C4=CC=CC=C4N3)C(=O)OC
|
| InChI |
1S/C22H26N2O3/c1-4-14-12-24-10-9-16-15-7-5-6-8-19(15)23-21(16)20(24)11-17(14)18(13-26-2)22(25)27-3/h4-8,13-14,17,20,23H,1,9-12H2,2-3H3/b18-13-/t14-,17-,20-/m0/s1
|
| InChIKey |
TZUGIFAYWNNSAO-CPHCKLLXSA-N
|
| PubChem Compound ID |
|
| Target and Pathway |
| Target(s) |
Alpha-1D adrenergic receptor |
Target Info |
Inhibitor |
[2]
|
|---|
| Alpha-1A adrenergic receptor |
Target Info |
Inhibitor |
[1]
|
| Voltage-dependent L-type calcium channel subunit alpha-1C |
Target Info |
Inhibitor |
[2]
|
| Alpha-1B adrenergic receptor |
Target Info |
Inhibitor |
[2]
|
|
KEGG Pathway
|
Calcium signaling pathway
|
|
cGMP-PKG signaling pathway
|
|
Neuroactive ligand-receptor interaction
|
|
Adrenergic signaling in cardiomyocytes
|
|
Vascular smooth muscle contraction
|
|
Salivary secretionhsa04020:Calcium signaling pathway
|
|
AMPK signaling pathway
|
|
Salivary secretionhsa04010:MAPK signaling pathway
|
|
cAMP signaling pathway
|
|
Cardiac muscle contraction
|
|
Circadian entrainment
|
|
Long-term potentiation
|
|
Retrograde endocannabinoid signaling
|
|
Glutamatergic synapse
|
|
Cholinergic synapse
|
|
Serotonergic synapse
|
|
GABAergic synapse
|
|
Dopaminergic synapse
|
|
Insulin secretion
|
|
GnRH signaling pathway
|
|
Oxytocin signaling pathway
|
|
Type II diabetes mellitus
|
|
Alzheimer's disease
|
|
Amphetamine addiction
|
|
Hypertrophic cardiomyopathy (HCM)
|
|
Arrhythmogenic right ventricular cardiomyopathy (ARVC)
|
|
Dilated cardiomyopathyhsa04020:Calcium signaling pathway
|
|
Salivary secretion
|
|
NetPath Pathway
|
IL2 Signaling PathwayNetPath_14:IL2 Signaling PathwayNetPath_14:IL2 Signaling Pathway
|
|
PANTHER Pathway
|
Alpha adrenergic receptor signaling pathwayP00003:Alzheimer disease-amyloid secretase pathway
|
|
Nicotinic acetylcholine receptor signaling pathway
|
|
5HT2 type receptor mediated signaling pathway
|
|
Beta1 adrenergic receptor signaling pathway
|
|
Beta2 adrenergic receptor signaling pathway
|
|
Oxytocin receptor mediated signaling pathway
|
|
Nicotine pharmacodynamics pathwayP00002:Alpha adrenergic receptor signaling pathway
|
|
Pathway Interaction Database
|
LPA receptor mediated events
|
|
PathWhiz Pathway
|
Muscle/Heart Contraction
|
|
Reactome
|
Adrenoceptors
|
|
G alpha (q) signalling events
|
|
G alpha (12/13) signalling eventsR-HSA-390696:Adrenoceptors
|
|
G alpha (12/13) signalling eventsR-HSA-400042:Adrenaline,noradrenaline inhibits insulin secretion
|
|
NCAM1 interactions
|
|
Regulation of insulin secretionR-HSA-390696:Adrenoceptors
|
|
G alpha (12/13) signalling events
|
|
WikiPathways
|
Monoamine GPCRs
|
|
Calcium Regulation in the Cardiac Cell
|
|
GPCRs, Class A Rhodopsin-like
|
|
Gastrin-CREB signalling pathway via PKC and MAPK
|
|
GPCR ligand binding
|
|
GPCR downstream signaling
|
|
GPCRs, OtherWP58:Monoamine GPCRs
|
|
Endothelin Pathways
|
|
AMPK SignalingWP536:Calcium Regulation in the Cardiac Cell
|
|
Arrhythmogenic Right Ventricular Cardiomyopathy
|
|
Alzheimers Disease
|
|
NCAM signaling for neurite out-growth
|
|
Integration of energy metabolism
|
|
Nicotine Activity on Chromaffin CellsWP58:Monoamine GPCRs
|
|
Vitamin D Receptor Pathway
|
|
AMPK Signaling
|
| References |
| REF 1 | Bioorg Med Chem Lett. 2005 Feb 1;15(3):657-64.Pharmacophore identification of alpha(1A)-adrenoceptor antagonists. |
|---|
| REF 2 | J Med Chem. 1995 Sep 15;38(19):3681-716.Alpha- and beta-adrenoceptors: from the gene to the clinic. 2. Structure-activity relationships and therapeutic applications. |
|---|
