| Drug General Information |
| Drug ID |
D08XQI
|
| Former ID |
DNC010373
|
| Drug Name |
PARAOXON
|
| Drug Type |
Small molecular drug
|
| Indication |
Discovery agent
|
Investigative |
[1]
|
|---|
| Structure |
|
Download
2D MOL
3D MOL
|
| Formula |
C10H14NO6P
|
| Canonical SMILES |
CCOP(=O)(OCC)OC1=CC=C(C=C1)[N+](=O)[O-]
|
| InChI |
1S/C10H14NO6P/c1-3-15-18(14,16-4-2)17-10-7-5-9(6-8-10)11(12)13/h5-8H,3-4H2,1-2H3
|
| InChIKey |
WYMSBXTXOHUIGT-UHFFFAOYSA-N
|
| CAS Number |
CAS 311-45-5
|
| PubChem Compound ID |
|
| SuperDrug ATC ID |
S01EB10
|
| Target and Pathway |
| Target(s) |
Carbonic anhydrase |
Target Info |
Inhibitor |
[2]
|
|---|
| Fatty-acid amide hydrolase |
Target Info |
Inhibitor |
[3]
|
| Carbonic anhydrase I |
Target Info |
Inhibitor |
[2]
|
| Cannabinoid receptor 1 |
Target Info |
Inhibitor |
[1]
|
| Acetylcholinesterase |
Target Info |
Inhibitor |
[3]
|
| Carbonic anhydrase II |
Target Info |
Inhibitor |
[2]
|
|
BioCyc Pathway
|
Anandamide degradation
|
|
KEGG Pathway
|
Retrograde endocannabinoid signalinghsa00910:Nitrogen metabolismhsa04015:Rap1 signaling pathway
|
|
Neuroactive ligand-receptor interaction
|
|
Retrograde endocannabinoid signalinghsa00564:Glycerophospholipid metabolism
|
|
Cholinergic synapsehsa00910:Nitrogen metabolism
|
|
Proximal tubule bicarbonate reclamation
|
|
Collecting duct acid secretion
|
|
Gastric acid secretion
|
|
Pancreatic secretion
|
|
Bile secretion
|
|
NetPath Pathway
|
IL4 Signaling Pathway
|
|
EGFR1 Signaling Pathway
|
|
PANTHER Pathway
|
Anandamide degradationP05730:Endogenous cannabinoid signalingP00042:Muscarinic acetylcholine receptor 1 and 3 signaling pathway
|
|
Muscarinic acetylcholine receptor 2 and 4 signaling pathway
|
|
Nicotinic acetylcholine receptor signaling pathway
|
|
Pathway Interaction Database
|
C-MYB transcription factor networkncadherinpathway:N-cadherin signaling eventsatf2_pathway:ATF-2 transcription factor network
|
|
PathWhiz Pathway
|
Gastric Acid ProductionPW000048:Phospholipid Biosynthesis
|
|
Reactome
|
Erythrocytes take up carbon dioxide and release oxygen
|
|
Erythrocytes take up oxygen and release carbon dioxide
|
|
Reversible hydration of carbon dioxideR-HSA-373076:Class A/1 (Rhodopsin-like receptors)
|
|
G alpha (i) signalling eventsR-HSA-1237044:Erythrocytes take up carbon dioxide and release oxygen
|
|
Reversible hydration of carbon dioxide
|
|
WikiPathways
|
Reversible Hydration of Carbon Dioxide
|
|
Uptake of Carbon Dioxide and Release of Oxygen by Erythrocytes
|
|
Uptake of Oxygen and Release of Carbon Dioxide by ErythrocytesWP455:GPCRs, Class A Rhodopsin-like
|
|
Small Ligand GPCRs
|
|
BDNF signaling pathway
|
|
GPCR ligand binding
|
|
GPCR downstream signaling
|
|
GPCRs, OtherWP727:Monoamine Transport
|
|
Biogenic Amine Synthesis
|
|
Acetylcholine Synthesis
|
|
Integrated Pancreatic Cancer PathwayWP2770:Reversible Hydration of Carbon Dioxide
|
|
Uptake of Oxygen and Release of Carbon Dioxide by Erythrocytes
|
| References |
| REF 1 | Bioorg Med Chem Lett. 2008 Nov 15;18(22):5875-8. Epub 2008 Aug 6.Monoacylglycerol lipase regulates 2-arachidonoylglycerol action and arachidonic acid levels. |
|---|
| REF 2 | Bioorg Med Chem Lett. 2010 Nov 1;20(21):6208-12. Epub 2010 Aug 26.Paraoxon, 4-nitrophenyl phosphate and acetate are substrates of |A- but not of |A-, |?- and |?-carbonic anhydrases. |
|---|
| REF 3 | Nat Chem Biol. 2008 Jun;4(6):373-8. Epub 2008 Apr 27.Activation of the endocannabinoid system by organophosphorus nerve agents. |
|---|
