| Drug General Information |
| Drug ID |
D06ELD
|
| Former ID |
DNC007259
|
| Drug Name |
WIN_35428
|
| Drug Type |
Small molecular drug
|
| Indication |
Discovery agent
|
Investigative |
[1]
|
|---|
| Formula |
C16H20FNO2
|
| InChI |
InChI=1S/C16H20FNO2/c1-18-12-7-8-14(18)15(16(19)20-2)13(9-12)10-3-5-11(17)6-4-10/h3-6,12-15H,7-9H2,1-2H3/t12-,13+,14+,15-/m0/s1
|
| InChIKey |
QUSLQENMLDRCTO-YJNKXOJESA-N
|
| PubChem Compound ID |
|
| PubChem Substance ID |
841221, 7980893, 10233746, 15592186, 15999163, 44434591, 48256938, 49846212, 50070295, 50070955, 80857297, 99381459, 103830466, 104373526, 135061515, 136923382, 137005050, 162224472, 163409699, 163847606, 172854647, 178101325, 178101326, 184598330, 189053169, 223564571, 223739720, 227768658, 243808150, 250229889, 252498738
|
| Target and Pathway |
| Target(s) |
Sodium-dependent noradrenaline transporter |
Target Info |
Inhibitor |
[2]
|
|---|
| Sodium-dependent dopamine transporter |
Target Info |
Inhibitor |
[2]
|
| Sodium-dependent serotonin transporter |
Target Info |
Inhibitor |
[2]
|
|
KEGG Pathway
|
Dopaminergic synapse
|
|
Parkinson's disease
|
|
Cocaine addiction
|
|
Amphetamine addiction
|
|
Alcoholismhsa04726:Serotonergic synapse
|
|
NetPath Pathway
|
TCR Signaling Pathway
|
|
PANTHER Pathway
|
Adrenaline and noradrenaline biosynthesisP00001:Adrenaline and noradrenaline biosynthesis
|
|
Parkinson disease
|
|
Dopamine receptor mediated signaling pathwayP04373:5HT1 type receptor mediated signaling pathway
|
|
5HT2 type receptor mediated signaling pathway
|
|
5HT3 type receptor mediated signaling pathway
|
|
5HT4 type receptor mediated signaling pathway
|
|
Pathway Interaction Database
|
Alpha-synuclein signaling
|
|
Reactome
|
Na+/Cl- dependent neurotransmitter transportersR-HSA-442660:Na+/Cl- dependent neurotransmitter transporters
|
|
WikiPathways
|
Monoamine Transport
|
|
NRF2 pathway
|
|
Transport of glucose and other sugars, bile salts and organic acids, metal ions and amine compoundsWP727:Monoamine Transport
|
|
Dopaminergic Neurogenesis
|
|
Parkinsons Disease Pathway
|
|
Transport of glucose and other sugars, bile salts and organic acids, metal ions and amine compounds
|
|
Neurotransmitter Clearance In The Synaptic CleftWP727:Monoamine Transport
|
|
SIDS Susceptibility Pathways
|
|
Synaptic Vesicle Pathway
|
|
Serotonin Transporter Activity
|
| References |
| REF 1 | (http://www.guidetopharmacology.org/) Nucleic Acids Res. 2015 Oct 12. pii: gkv1037. The IUPHAR/BPS Guide to PHARMACOLOGY in 2016: towards curated quantitative interactions between 1300 protein targets and 6000 ligands. (Ligand id: 4606). |
|---|
| REF 2 | J Med Chem. 1996 Oct 11;39(21):4139-41.3 alpha-(4'-substituted phenyl)tropane-2 beta-carboxylic acid methyl esters: novel ligands with high affinity and selectivity at the dopamine transporter. |
|---|
