| Drug General Information |
| Drug ID |
D02UID
|
| Former ID |
DNC008994
|
| Drug Name |
WAY-252623
|
| Drug Type |
Small molecular drug
|
| Indication |
Atherosclerosis [ICD9: 414.0, 440; ICD10:I70]
|
Investigative |
[1]
|
|---|
| Structure |
|
Download
2D MOL
3D MOL
|
| Formula |
C21H12ClF5N2
|
| Canonical SMILES |
C1=CC2=C(N(N=C2C(=C1)C(F)(F)F)CC3=C(C=C(C=C3)F)Cl)C4=CC<br />=C(C=C4)F
|
| InChI |
1S/C21H12ClF5N2/c22-18-10-15(24)9-6-13(18)11-29-20(12-4-7-14(23)8-5-12)16-2-1-3-17(19(16)28-29)21(25,26)27/h1-10H,11H2
|
| InChIKey |
KYWWJENKIMRJBI-UHFFFAOYSA-N
|
| PubChem Compound ID |
|
| Target and Pathway |
| Target(s) |
Oxysterols receptor LXR-alpha |
Target Info |
Inhibitor |
[1]
|
|---|
| Pregnane X receptor |
Target Info |
Inhibitor |
[1]
|
| mRNA of androgen receptor |
Target Info |
Inhibitor |
[1]
|
| mRNA of glucocorticoid receptor |
Target Info |
Inhibitor |
[1]
|
| Oxysterols receptor LXR-beta |
Target Info |
Inhibitor |
[1]
|
|
KEGG Pathway
|
PPAR signaling pathway
|
|
Non-alcoholic fatty liver disease (NAFLD)
|
|
Hepatitis Chsa04114:Oocyte meiosis
|
|
Pathways in cancer
|
|
Prostate cancerhsa04080:Neuroactive ligand-receptor interaction
|
|
NetPath Pathway
|
EGFR1 Signaling Pathway
|
|
AndrogenReceptor Signaling Pathway
|
|
FSH Signaling PathwayNetPath_14:IL2 Signaling Pathway
|
|
TCR Signaling Pathway
|
|
Pathway Interaction Database
|
RXR and RAR heterodimerization with other nuclear receptorsmad2_3nuclearpathway:Regulation of nuclear SMAD2/3 signaling
|
|
Coregulation of Androgen receptor activity
|
|
Regulation of Androgen receptor activity
|
|
Nongenotropic Androgen signaling
|
|
Regulation of nuclear beta catenin signaling and target gene transcription
|
|
FOXA1 transcription factor network
|
|
Notch-mediated HES/HEY networksmad2_3nuclearpathway:Regulation of nuclear SMAD2/3 signaling
|
|
Signaling events mediated by HDAC Class II
|
|
FOXA2 and FOXA3 transcription factor networks
|
|
Glucocorticoid receptor regulatory network
|
|
AP-1 transcription factor networkrxr_vdr_pathway:RXR and RAR heterodimerization with other nuclear receptor
|
|
Reactome
|
Nuclear Receptor transcription pathway
|
|
Activated PKN1 stimulates transcription of AR (androgen receptor) regulated genes KLK2 and KLK3R-HSA-1368108:BMAL1:CLOCK,NPAS2 activates circadian gene expressionR-HSA-383280:Nuclear Receptor transcription pathway
|
|
WikiPathways
|
Nuclear Receptors in Lipid Metabolism and Toxicity
|
|
Nuclear Receptors Meta-Pathway
|
|
PPAR Alpha Pathway
|
|
Liver X Receptor Pathway
|
|
Adipogenesis
|
|
SREBF and miR33 in cholesterol and lipid homeostasis
|
|
Nuclear ReceptorsWP299:Nuclear Receptors in Lipid Metabolism and Toxicity
|
|
Pregnane X Receptor pathway
|
|
Drug Induction of Bile Acid Pathway
|
|
Nuclear ReceptorsWP706:SIDS Susceptibility Pathways
|
|
Integrated Pancreatic Cancer Pathway
|
|
Prostate Cancer
|
|
Integrated Breast Cancer Pathway
|
|
Nuclear Receptors
|
|
Androgen receptor signaling pathwayWP734:Serotonin Receptor 4/6/7 and NR3C Signaling
|
|
SIDS Susceptibility Pathways
|
|
Endoderm Differentiation
|
|
Hair Follicle Development: Cytodifferentiation (Part 3 of 3)
|
|
Circadian Clock
|
|
Nuclear ReceptorsWP1982:SREBP signalling
|
| References |
| REF 1 | J Med Chem. 2008 Nov 27;51(22):7161-8.Indazole-based liver X receptor (LXR) modulators with maintained atherosclerotic lesion reduction activity but diminished stimulation of hepatic triglyceride synthesis. |
|---|
