| Drug General Information |
| Drug ID |
D00RNA
|
| Former ID |
DNC008112
|
| Drug Name |
N-hydroxy-3-(2-oxo-2H-chromen-3-yl)propanamide
|
| Drug Type |
Small molecular drug
|
| Indication |
Discovery agent
|
Investigative |
[1]
|
|---|
| Structure |
|
Download
2D MOL
3D MOL
|
| Formula |
C12H11NO4
|
| Canonical SMILES |
C1=CC=C2C(=C1)C=C(C(=O)O2)CCC(=O)NO
|
| InChI |
1S/C12H11NO4/c14-11(13-16)6-5-9-7-8-3-1-2-4-10(8)17-12(9)15/h1-4,7,16H,5-6H2,(H,13,14)
|
| InChIKey |
HJRCGMHZQDXQAO-UHFFFAOYSA-N
|
| PubChem Compound ID |
|
| Target and Pathway |
| Target(s) |
72 kDa type IV collagenase |
Target Info |
Inhibitor |
[1]
|
|---|
| MMP-9 |
Target Info |
Inhibitor |
[1]
|
| ADAM 17 |
Target Info |
Inhibitor |
[1]
|
|
KEGG Pathway
|
Leukocyte transendothelial migration
|
|
GnRH signaling pathway
|
|
Estrogen signaling pathway
|
|
Pathways in cancer
|
|
Proteoglycans in cancer
|
|
Bladder cancerhsa04668:TNF signaling pathway
|
|
Hepatitis B
|
|
Transcriptional misregulation in cancer
|
|
MicroRNAs in cancer
|
|
Bladder cancerhsa04330:Notch signaling pathway
|
|
Alzheimer's disease
|
|
Epithelial cell signaling in Helicobacter pylori infection
|
|
NetPath Pathway
|
Leptin Signaling Pathway
|
|
TCR Signaling Pathway
|
|
ID Signaling PathwayNetPath_5:ID Signaling Pathway
|
|
TWEAK Signaling Pathway
|
|
TNFalpha Signaling Pathway
|
|
PANTHER Pathway
|
Alzheimer disease-presenilin pathwayP00004:Alzheimer disease-presenilin pathway
|
|
Plasminogen activating cascade
|
|
CCKR signaling map STP00003:Alzheimer disease-amyloid secretase pathway
|
|
Alzheimer disease-presenilin pathway
|
|
Notch signaling pathway
|
|
Pathway Interaction Database
|
LPA receptor mediated events
|
|
Plasma membrane estrogen receptor signaling
|
|
Osteopontin-mediated events
|
|
Validated transcriptional targets of AP1 family members Fra1 and Fra2
|
|
Angiopoietin receptor Tie2-mediated signaling
|
|
Direct p53 effectors
|
|
amb2 Integrin signaling
|
|
ATF-2 transcription factor network
|
|
FOXM1 transcription factor network
|
|
Regulation of nuclear beta catenin signaling and target gene transcription
|
|
Syndecan-2-mediated signaling eventslysophospholipid_pathway:LPA receptor mediated events
|
|
Validated targets of C-MYC transcriptional activation
|
|
CXCR4-mediated signaling events
|
|
Syndecan-4-mediated signaling events
|
|
AP-1 transcription factor network
|
|
Urokinase-type plasminogen activator (uPA) and uPAR-mediated signaling
|
|
Syndecan-1-mediated signaling events
|
|
FGF signaling pathwayerbb4_pathway:ErbB4 signaling events
|
|
TNF receptor signaling pathway
|
|
p75(NTR)-mediated signaling
|
|
Reactome
|
Collagen degradation
|
|
Degradation of the extracellular matrix
|
|
Activation of Matrix Metalloproteinases
|
|
Regulation of Insulin-like Growth Factor (IGF) transport and uptake by Insulin-like Growth Factor Binding Proteins (IGFBPs)
|
|
EPH-ephrin mediated repulsion of cellsR-HSA-1442490:Collagen degradation
|
|
Assembly of collagen fibrils and other multimeric structures
|
|
EPH-ephrin mediated repulsion of cellsR-HSA-1251985:Nuclear signaling by ERBB4
|
|
Regulated proteolysis of p75NTR
|
|
Activated NOTCH1 Transmits Signal to the Nucleus
|
|
Constitutive Signaling by NOTCH1 PEST Domain Mutants
|
|
Constitutive Signaling by NOTCH1 t(7
|
|
M1580_K2555) Translocation Mutant
|
|
Constitutive Signaling by NOTCH1 HD Domain Mutants
|
|
Constitutive Signaling by NOTCH1 HD+PEST Domain Mutants
|
|
TNF signaling
|
|
Growth hormone receptor signaling
|
|
WikiPathways
|
Activation of Matrix Metalloproteinases
|
|
AGE/RAGE pathway
|
|
Matrix MetalloproteinasesWP474:Endochondral Ossification
|
|
IL1 and megakaryotyces in obesity
|
|
Mammary gland development pathway - Involution (Stage 4 of 4)
|
|
Degradation of collagen
|
|
Spinal Cord Injury
|
|
TWEAK Signaling Pathway
|
|
Angiogenesis
|
|
Osteopontin Signaling
|
|
Matrix MetalloproteinasesWP61:Notch Signaling Pathway
|
|
Copper homeostasis
|
|
Notch Signaling Pathway
|
|
Growth hormone receptor signaling
|
|
BDNF signaling pathway
|
|
Alzheimers Disease
|
|
Signalling by NGF
|
|
Extrinsic Pathway for Apoptosis
|
| References |
| REF 1 | Bioorg Med Chem. 2008 Jan 1;16(1):530-5. Epub 2007 Sep 14.Chromen-based TNF-alpha converting enzyme (TACE) inhibitors: design, synthesis, and biological evaluation. |
|---|
