| Drug General Information |
| Drug ID |
D0B0OY
|
| Former ID |
DNC000990
|
| Drug Name |
Naphthoquinone analogs
|
| Drug Type |
Small molecular drug
|
| Indication |
Discovery agent
|
Investigative |
[1]
|
|---|
| Structure |
|
Download
2D MOL
3D MOL
|
| Formula |
C15H22N2O3
|
| Canonical SMILES |
CCCCOC1=C(C=CC(=C1)CC2CNC(=O)N2)OC
|
| InChI |
1S/C15H22N2O3/c1-3-4-7-20-14-9-11(5-6-13(14)19-2)8-12-10-16-15(18)17-12/h5-6,9,12H,3-4,7-8,10H2,1-2H3,(H2,16,17,18)
|
| InChIKey |
PDMUULPVBYQBBK-UHFFFAOYSA-N
|
| CAS Number |
CAS 29925-17-5
|
| PubChem Compound ID |
|
| PubChem Substance ID |
5146344, 7980528, 8153130, 11121423, 11121903, 11362492, 11364754, 11365054, 11367316, 11367616, 11369878, 11370255, 11370256, 11373070, 11373217, 11375778, 11378043, 11491641, 11495654, 14824380, 17404767, 24278195, 26613194, 26747110, 26751709, 26759463, 29224155, 46500386, 47216899, 47662431, 47810881, 48185112, 48259380, 48259381, 48478658, 50067170, 50070586, 50071197, 50104396, 50104397, 50104398, 50104399, 53777310, 53789843, 53800559, 57322600, 80110624, 85084418, 85230941, 85787734
|
| Target and Pathway |
| Target(s) |
M-phase inducer phosphatase 1 |
Target Info |
Inhibitor |
[1]
|
|---|
|
KEGG Pathway
|
Cell cycle
|
|
Progesterone-mediated oocyte maturation
|
|
MicroRNAs in cancer
|
|
NetPath Pathway
|
IL4 Signaling Pathway
|
|
TGF_beta_Receptor Signaling Pathway
|
|
Pathway Interaction Database
|
E2F transcription factor network
|
|
ATR signaling pathway
|
|
Validated targets of C-MYC transcriptional activation
|
|
ATM pathway
|
|
Reactome
|
E2F mediated regulation of DNA replication
|
|
G0 and Early G1
|
|
Polo-like kinase mediated events
|
|
Cyclin B2 mediated events
|
|
Activation of ATR in response to replication stress
|
|
Cyclin E associated events during G1/S transition
|
|
G1/S-Specific Transcription
|
|
Cyclin A/B1 associated events during G2/M transition
|
|
Ubiquitin Mediated Degradation of Phosphorylated Cdc25A
|
|
Cyclin A:Cdk2-associated events at S phase entry
|
|
WikiPathways
|
DNA Damage Response
|
|
G1 to S cell cycle control
|
|
S Phase
|
|
ATM Signaling Pathway
|
|
Retinoblastoma (RB) in Cancer
|
|
Prostate Cancer
|
|
Integrated Breast Cancer Pathway
|
|
Integrated Cancer pathway
|
|
Mitotic G1-G1/S phases
|
|
Cell Cycle
|
|
Cell Cycle Checkpoints
|
|
miRNAs involved in DNA damage response
|
|
miRNA Regulation of DNA Damage Response
|
| References |
| REF 1 | Role of the Cdc25A phosphatase in human breast cancer. J Clin Invest. 2000 Sep;106(6):753-61. |
|---|
