| Drug General Information |
| Drug ID |
D0S6DK
|
| Former ID |
DIB018104
|
| Drug Name |
(S)-4C3HPG
|
| Drug Type |
Small molecular drug
|
| Indication |
Discovery agent
|
Investigative |
[1]
|
|---|
| Structure |
|
Download
2D MOL
|
| Formula |
C9H9NO5
|
| InChI |
InChI=1S/C9H9NO5/c10-7(9(14)15)4-1-2-5(8(12)13)6(11)3-4/h1-3,7,11H,10H2,(H,12,13)(H,14,15)/t7-/m0/s1
|
| InChIKey |
GXZSAQLJWLCLOX-ZETCQYMHSA-N
|
| PubChem Compound ID |
|
| PubChem Substance ID |
7980670, 11056519, 11113443, 14797706, 26751674, 39341129, 47954499, 48029690, 57359490, 79345267, 91746228, 103216985, 103950265, 114156145, 135650425, 162225419, 163127056, 237693730, 241181613, 241376307
|
| Target and Pathway |
| Target(s) |
Metabotropicglutamate receptor 1 |
Target Info |
Antagonist |
[2]
|
|---|
| Metabotropic glutamate receptor 5 |
Target Info |
Antagonist |
[2]
|
| Metabotropic glutamate receptor 2 |
Target Info |
Agonist |
[3]
|
|
KEGG Pathway
|
Calcium signaling pathway
|
|
FoxO signaling pathway
|
|
Neuroactive ligand-receptor interaction
|
|
Gap junction
|
|
Long-term potentiation
|
|
Retrograde endocannabinoid signaling
|
|
Glutamatergic synapse
|
|
Long-term depression
|
|
Estrogen signaling pathwayhsa04020:Calcium signaling pathway
|
|
Huntington's diseasehsa04080:Neuroactive ligand-receptor interaction
|
|
Cocaine addiction
|
|
PANTHER Pathway
|
Heterotrimeric G-protein signaling pathway-Gq alpha and Go alpha mediated pathway
|
|
Metabotropic glutamate receptor group III pathway
|
|
Metabotropic glutamate receptor group I pathway
|
|
Endogenous cannabinoid signalingP00027:Heterotrimeric G-protein signaling pathway-Gq alpha and Go alpha mediated pathway
|
|
Endogenous cannabinoid signalingP00026:Heterotrimeric G-protein signaling pathway-Gi alpha and Gs alpha mediated pathway
|
|
Ionotropic glutamate receptor pathway
|
|
Metabotropic glutamate receptor group II pathway
|
|
Reactome
|
G alpha (q) signalling events
|
|
Class C/3 (Metabotropic glutamate/pheromone receptors)R-HSA-416476:G alpha (q) signalling events
|
|
Class C/3 (Metabotropic glutamate/pheromone receptors)R-HSA-418594:G alpha (i) signalling events
|
|
Class C/3 (Metabotropic glutamate/pheromone receptors)
|
|
WikiPathways
|
Hypothetical Network for Drug Addiction
|
|
GPCRs, Class C Metabotropic glutamate, pheromone
|
|
Gastrin-CREB signalling pathway via PKC and MAPK
|
|
GPCR ligand binding
|
|
GPCR downstream signaling
|
|
GPCRs, OtherWP666:Hypothetical Network for Drug Addiction
|
|
GPCR downstream signalingWP501:GPCRs, Class C Metabotropic glutamate, pheromone
|
| References |
| REF 1 | (http://www.guidetopharmacology.org/) Nucleic Acids Res. 2015 Oct 12. pii: gkv1037. The IUPHAR/BPS Guide to PHARMACOLOGY in 2016: towards curated quantitative interactions between 1300 protein targets and 6000 ligands. (Ligand id: 1374). |
|---|
| REF 2 | Characterization of [(3)H]Quisqualate binding to recombinant rat metabotropic glutamate 1a and 5a receptors and to rat and human brain sections. J Neurochem. 2000 Dec;75(6):2590-601. |
|---|
| REF 3 | Characterization of [3H]-(2S,2'R,3'R)-2-(2',3'-dicarboxy-cyclopropyl)glycine ([3H]-DCG IV) binding to metabotropic mGlu2 receptor-transfected cell membranes. Br J Pharmacol. 1998 Feb;123(3):497-504. |
|---|
