| Drug General Information |
| Drug ID |
D0R8TZ
|
| Former ID |
DIB020394
|
| Drug Name |
MPEP
|
| Drug Type |
Small molecular drug
|
| Indication |
Discovery agent
|
Investigative |
[1]
|
|---|
| Structure |
|
Download
2D MOL
|
| Formula |
C14H11N
|
| InChI |
InChI=1S/C14H11N/c1-12-6-5-9-14(15-12)11-10-13-7-3-2-4-8-13/h2-9H,1H3
|
| InChIKey |
NEWKHUASLBMWRE-UHFFFAOYSA-N
|
| PubChem Compound ID |
|
| PubChem Substance ID |
6732441, 7980033, 10043728, 11111471, 11113962, 15219891, 24278557, 26752106, 36070851, 47213189, 48393935, 50032786, 50104761, 53011319, 53789543, 56310595, 57352547, 85209181, 85787598, 90340900, 91721550, 103256385, 103983721, 111614268, 124749956, 124880742, 124880743, 124880744, 125541046, 128649834, 128692244, 132558477, 134343330, 135215341, 135610598, 135650628, 137005433, 140862507, 143117037, 152159554, 152258585, 160647421, 162025940, 163782382, 172087036, 177513141, 179235816, 198960489, 203093166, 223402611
|
| Target and Pathway |
| Target(s) |
Metabotropic glutamate receptor 4 |
Target Info |
Modulator (allosteric modulator) |
[2]
|
|---|
| Metabotropic glutamate receptor 5 |
Target Info |
Modulator (allosteric modulator) |
[3]
|
|
KEGG Pathway
|
Neuroactive ligand-receptor interaction
|
|
Glutamatergic synapse
|
|
Taste transductionhsa04020:Calcium signaling pathway
|
|
Gap junction
|
|
Long-term potentiation
|
|
Retrograde endocannabinoid signaling
|
|
Huntington's disease
|
|
PANTHER Pathway
|
Heterotrimeric G-protein signaling pathway-Gi alpha and Gs alpha mediated pathway
|
|
Heterotrimeric G-protein signaling pathway-Gq alpha and Go alpha mediated pathway
|
|
Metabotropic glutamate receptor group III pathwayP00027:Heterotrimeric G-protein signaling pathway-Gq alpha and Go alpha mediated pathway
|
|
Metabotropic glutamate receptor group III pathway
|
|
Metabotropic glutamate receptor group I pathway
|
|
Endogenous cannabinoid signaling
|
|
Reactome
|
G alpha (i) signalling events
|
|
Class C/3 (Metabotropic glutamate/pheromone receptors)R-HSA-416476:G alpha (q) signalling events
|
|
Class C/3 (Metabotropic glutamate/pheromone receptors)
|
|
WikiPathways
|
GPCRs, Class C Metabotropic glutamate, pheromone
|
|
GPCR ligand binding
|
|
GPCR downstream signalingWP666:Hypothetical Network for Drug Addiction
|
|
Gastrin-CREB signalling pathway via PKC and MAPK
|
|
GPCR downstream signaling
|
| References |
| REF 1 | (http://www.guidetopharmacology.org/) Nucleic Acids Res. 2015 Oct 12. pii: gkv1037. The IUPHAR/BPS Guide to PHARMACOLOGY in 2016: towards curated quantitative interactions between 1300 protein targets and 6000 ligands. (Ligand id: 1426). |
|---|
| REF 2 | Positive allosteric modulation of the human metabotropic glutamate receptor 4 (hmGluR4) by SIB-1893 and MPEP. Br J Pharmacol. 2003 Mar;138(6):1026-30. |
|---|
| REF 3 | 2-Methyl-6-(phenylethynyl)-pyridine (MPEP), a potent, selective and systemically active mGlu5 receptor antagonist. Neuropharmacology. 1999 Oct;38(10):1493-503. |
|---|
