| Drug General Information |
| Drug ID |
D0QQ7N
|
| Former ID |
DIB011069
|
| Drug Name |
TH-9229
|
| Synonyms |
Protectazem
|
| Indication |
Reperfusion injury [ICD10:I00-I99]
|
Terminated |
[1]
|
|---|
| Company |
Theratechnologies Inc
|
| Structure |
|
Download
2D MOL
3D MOL
|
| Canonical SMILES |
C1(=O)N(c2c(S[C@@H]([C@@H]1O)c1ccc(cc1)OC)cccc2)CCNC
|
| CAS Number |
CAS 86408-40-4
|
| Target and Pathway |
| Target(s) |
Voltage-dependent P/Q-type calcium channel alpha-1A subunit |
Target Info |
Modulator |
[2]
|
|---|
| Voltage-dependent L-type calcium channel alpha-1D subunit |
Target Info |
Modulator |
[2]
|
| Voltage-dependent L-type calcium channel subunit alpha-1C |
Target Info |
Modulator |
[2]
|
| Voltage-dependent R-type calcium channel alpha-1E subunit |
Target Info |
Modulator |
[2]
|
| Voltage-dependent N-type calcium channel |
Target Info |
Modulator |
[2]
|
|
KEGG Pathway
|
MAPK signaling pathway
|
|
Calcium signaling pathway
|
|
Synaptic vesicle cycle
|
|
Retrograde endocannabinoid signaling
|
|
Glutamatergic synapse
|
|
Cholinergic synapse
|
|
Serotonergic synapse
|
|
GABAergic synapse
|
|
Dopaminergic synapse
|
|
Long-term depression
|
|
Taste transduction
|
|
Type II diabetes mellitus
|
|
Morphine addiction
|
|
Nicotine addictionhsa04010:MAPK signaling pathway
|
|
cGMP-PKG signaling pathway
|
|
cAMP signaling pathway
|
|
Cardiac muscle contraction
|
|
Adrenergic signaling in cardiomyocytes
|
|
Vascular smooth muscle contraction
|
|
Circadian entrainment
|
|
Insulin secretion
|
|
GnRH signaling pathway
|
|
Oxytocin signaling pathway
|
|
Carbohydrate digestion and absorption
|
|
Alzheimer's disease
|
|
Amphetamine addiction
|
|
Hypertrophic cardiomyopathy (HCM)
|
|
Arrhythmogenic right ventricular cardiomyopathy (ARVC)
|
|
Dilated cardiomyopathyhsa04010:MAPK signaling pathway
|
|
Long-term potentiation
|
|
Type II diabetes mellitushsa04010:MAPK signaling pathway
|
|
Nicotine addiction
|
|
NetPath Pathway
|
IL2 Signaling Pathway
|
|
PANTHER Pathway
|
Heterotrimeric G-protein signaling pathway-Gq alpha and Go alpha mediated pathway
|
|
Ionotropic glutamate receptor pathway
|
|
Metabotropic glutamate receptor group III pathway
|
|
Metabotropic glutamate receptor group II pathway
|
|
Thyrotropin-releasing hormone receptor signaling pathway
|
|
Endogenous cannabinoid signaling
|
|
GABA-B receptor II signalingP00003:Alzheimer disease-amyloid secretase pathway
|
|
Nicotinic acetylcholine receptor signaling pathway
|
|
5HT2 type receptor mediated signaling pathway
|
|
Beta1 adrenergic receptor signaling pathway
|
|
Beta2 adrenergic receptor signaling pathway
|
|
Oxytocin receptor mediated signaling pathwayP00003:Alzheimer disease-amyloid secretase pathway
|
|
Oxytocin receptor mediated signaling pathway
|
|
Nicotine pharmacodynamics pathwayP00027:Heterotrimeric G-protein signaling pathway-Gq alpha and Go alpha mediated pathway
|
|
Thyrotropin-releasing hormone receptor signaling pathwayP00027:Heterotrimeric G-protein signaling pathway-Gq alpha and Go alpha mediated pathway
|
|
GABA-B receptor II signaling
|
|
PathWhiz Pathway
|
Pancreas FunctionPW000564:Muscle/Heart Contraction
|
|
Reactome
|
Depolarization of the Presynaptic Terminal Triggers the Opening of Calcium Channels
|
|
Regulation of insulin secretionR-HSA-400042:Adrenaline,noradrenaline inhibits insulin secretion
|
|
NCAM1 interactions
|
|
Regulation of insulin secretionR-HSA-112308:Depolarization of the Presynaptic Terminal Triggers the Opening of Calcium Channels
|
|
WikiPathways
|
Calcium Regulation in the Cardiac Cell
|
|
Synaptic Vesicle Pathway
|
|
Integration of energy metabolism
|
|
Type II diabetes mellitusWP536:Calcium Regulation in the Cardiac Cell
|
|
Arrhythmogenic Right Ventricular Cardiomyopathy
|
|
Alzheimers Disease
|
|
NCAM signaling for neurite out-growth
|
|
Integration of energy metabolismWP536:Calcium Regulation in the Cardiac Cell
|
|
Nicotine Activity on Chromaffin CellsWP536:Calcium Regulation in the Cardiac Cell
|
| References |
| REF 1 | Trusted, scientifically sound profiles of drug programs, clinical trials, safety reports, and company deals, written by scientists. Springer. 2015. Adis Insight (drug id 800008159) |
|---|
| REF 2 | Trusted, scientifically sound profiles of drug programs, clinical trials, safety reports, and company deals, written by scientists. Springer. 2015. Adis Insight (drug id 800008159) |
|---|
