| Drug General Information |
| Drug ID |
D0P8PK
|
| Former ID |
DNC005586
|
| Drug Name |
6-(3-Hydroxy-phenyl)-naphthalen-2-ol
|
| Synonyms |
6-(3-hydroxyphenyl)-2-naphthol; 6-(3-hydroxyphenyl)naphthalen-2-ol
|
| Indication |
Discovery agent
|
Investigative |
[1]
|
|---|
| Structure |
|
Download
2D MOL
3D MOL
|
| Canonical SMILES |
C1=CC(=CC(=C1)O)C2=CC3=C(C=C2)C=C(C=C3)O
|
| InChI |
1S/C16H12O2/c17-15-3-1-2-11(9-15)12-4-5-14-10-16(18)7-6-13(14)8-12/h1-10,17-18H
|
| InChIKey |
VHWBXEUHUQDHDH-UHFFFAOYSA-N
|
| Target and Pathway |
| Target(s) |
Estrogen receptor |
Target Info |
Inhibitor |
[2]
|
|---|
| Cytochrome P450 3A4 |
Target Info |
Inhibitor |
[3]
|
| Estradiol 17 beta-dehydrogenase 1 |
Target Info |
Inhibitor |
[4]
|
| Tyrosine oxidase |
Target Info |
Inhibitor |
[1]
|
| Estrogen receptor beta |
Target Info |
Inhibitor |
[2]
|
|
BioCyc Pathway
|
Superpathway of steroid hormone biosynthesis
|
|
Estradiol biosynthesis IPWY-6133:(S)-reticuline biosynthesis
|
|
Eumelanin biosynthesis
|
|
L-dopachrome biosynthesis
|
|
KEGG Pathway
|
Estrogen signaling pathway
|
|
Prolactin signaling pathway
|
|
Thyroid hormone signaling pathway
|
|
Endocrine and other factor-regulated calcium reabsorption
|
|
Proteoglycans in cancerhsa00140:Steroid hormone biosynthesis
|
|
Linoleic acid metabolism
|
|
Retinol metabolism
|
|
Metabolism of xenobiotics by cytochrome P450
|
|
Drug metabolism - cytochrome P450
|
|
Drug metabolism - other enzymes
|
|
Metabolic pathways
|
|
Bile secretion
|
|
Chemical carcinogenesishsa00140:Steroid hormone biosynthesis
|
|
Ovarian steroidogenesishsa00350:Tyrosine metabolism
|
|
Riboflavin metabolism
|
|
Melanogenesishsa04915:Estrogen signaling pathway
|
|
NetPath Pathway
|
FSH Signaling Pathway
|
|
EGFR1 Signaling Pathway
|
|
RANKL Signaling PathwayNetPath_25:FSH Signaling Pathway
|
|
PANTHER Pathway
|
Androgen/estrogene/progesterone biosynthesis
|
|
Pathway Interaction Database
|
Regulation of nuclear SMAD2/3 signaling
|
|
Signaling events mediated by HDAC Class II
|
|
Plasma membrane estrogen receptor signaling
|
|
LKB1 signaling events
|
|
Regulation of Telomerase
|
|
ATF-2 transcription factor network
|
|
AP-1 transcription factor network
|
|
FOXM1 transcription factor network
|
|
Validated nuclear estrogen receptor alpha network
|
|
Signaling mediated by p38-alpha and p38-beta
|
|
FOXA1 transcription factor networker_nongenomic_pathway:Plasma membrane estrogen receptor signaling
|
|
Validated nuclear estrogen receptor beta network
|
|
PathWhiz Pathway
|
Caffeine Metabolism
|
|
Retinol MetabolismPW000045:Androgen and Estrogen MetabolismPW000035:Riboflavin Metabolism
|
|
Tyrosine Metabolism
|
|
Reactome
|
Nuclear signaling by ERBB4
|
|
Nuclear Receptor transcription pathwayR-HSA-211981:Xenobiotics
|
|
Aflatoxin activation and detoxificationR-HSA-2453902:The canonical retinoid cycle in rods (twilight vision)R-HSA-383280:Nuclear Receptor transcription pathway
|
|
WikiPathways
|
Estrogen signaling pathway
|
|
Nuclear Receptors Meta-Pathway
|
|
Estrogen Receptor Pathway
|
|
Signaling by ERBB4
|
|
JAK/STAT
|
|
Integrated Pancreatic Cancer Pathway
|
|
Leptin signaling pathway
|
|
miR-targeted genes in muscle cell - TarBase
|
|
Integrated Breast Cancer Pathway
|
|
Nuclear ReceptorsWP702:Metapathway biotransformation
|
|
Aflatoxin B1 metabolism
|
|
Estrogen metabolism
|
|
Benzo(a)pyrene metabolism
|
|
Tamoxifen metabolism
|
|
Tryptophan metabolism
|
|
Oxidation by Cytochrome P450
|
|
Nuclear Receptors in Lipid Metabolism and Toxicity
|
|
Farnesoid X Receptor Pathway
|
|
Vitamin D Receptor Pathway
|
|
Felbamate Metabolism
|
|
Lidocaine metabolism
|
|
Nifedipine Activity
|
|
Colchicine Metabolic Pathway
|
|
Irinotecan Pathway
|
|
Drug Induction of Bile Acid Pathway
|
|
Fatty Acid Omega Oxidation
|
|
Codeine and Morphine MetabolismWP496:Steroid Biosynthesis
|
|
Metabolism of steroid hormones and vitamin D
|
|
Prostate CancerWP2436:Dopamine metabolismWP706:SIDS Susceptibility Pathways
|
|
Ovarian Infertility Genes
|
|
Nuclear Receptors
|
| References |
| REF 1 | Bioorg Med Chem Lett. 2007 Jan 15;17(2):461-4. Epub 2006 Oct 12.Syntheses of hydroxy substituted 2-phenyl-naphthalenes as inhibitors of tyrosinase. |
|---|
| REF 2 | J Med Chem. 2005 Jun 16;48(12):3953-79.ERbeta ligands. 3. Exploiting two binding orientations of the 2-phenylnaphthalene scaffold to achieve ERbeta selectivity. |
|---|
| REF 3 | J Med Chem. 2008 Apr 10;51(7):2158-69. Epub 2008 Mar 7.Design, synthesis, and biological evaluation of (hydroxyphenyl)naphthalene and -quinoline derivatives: potent and selective nonsteroidal inhibitors of 17beta-hydroxysteroid dehydrogenase type 1 (17beta-HSD1) for the treatment of estrogen-dependent diseases. |
|---|
| REF 4 | J Med Chem. 2008 Aug 14;51(15):4685-98. Epub 2008 Jul 17.Substituted 6-phenyl-2-naphthols. Potent and selective nonsteroidal inhibitors of 17beta-hydroxysteroid dehydrogenase type 1 (17beta-HSD1): design, synthesis, biological evaluation, and pharmacokinetics. |
|---|
