| Drug General Information |
| Drug ID |
D0G2IC
|
| Former ID |
DNC005788
|
| Drug Name |
(S)-FLURBIPROFEN
|
| Drug Type |
Small molecular drug
|
| Indication |
Discovery agent
|
Investigative |
[1]
|
|---|
| Structure |
|
Download
2D MOL
3D MOL
|
| Formula |
C15H13FO2
|
| Canonical SMILES |
CC(C1=CC(=C(C=C1)C2=CC=CC=C2)F)C(=O)O
|
| InChI |
1S/C15H13FO2/c1-10(15(17)18)12-7-8-13(14(16)9-12)11-5-3-2-4-6-11/h2-10H,1H3,(H,17,18)/t10-/m0/s1
|
| InChIKey |
SYTBZMRGLBWNTM-JTQLQIEISA-N
|
| PubChem Compound ID |
|
| Target and Pathway |
| Target(s) |
Gamma-secretase |
Target Info |
Inhibitor |
[1]
|
|---|
| Beta-secretase |
Target Info |
Inhibitor |
[1]
|
| Presenilin 2 |
Target Info |
Inhibitor |
[1]
|
| Prostaglandin G/H synthase 2 |
Target Info |
Inhibitor |
[2]
|
| Prostaglandin G/H synthase 1 |
Target Info |
Inhibitor |
[2]
|
| Presenilin 1 |
Target Info |
Inhibitor |
[1]
|
|
BioCyc Pathway
|
Aspirin-triggered lipoxin biosynthesis
|
|
Aspirin triggered resolvin D biosynthesis
|
|
C20 prostanoid biosynthesis
|
|
Aspirin triggered resolvin E biosynthesisPWY66-374:C20 prostanoid biosynthesis
|
|
KEGG Pathway
|
Notch signaling pathway
|
|
Alzheimer's diseasehsa04330:Notch signaling pathway
|
|
Neurotrophin signaling pathway
|
|
Alzheimer's diseasehsa00590:Arachidonic acid metabolism
|
|
Metabolic pathways
|
|
NF-kappa B signaling pathway
|
|
VEGF signaling pathway
|
|
TNF signaling pathway
|
|
Retrograde endocannabinoid signaling
|
|
Serotonergic synapse
|
|
Ovarian steroidogenesis
|
|
Oxytocin signaling pathway
|
|
Regulation of lipolysis in adipocytes
|
|
Leishmaniasis
|
|
Pathways in cancer
|
|
Chemical carcinogenesis
|
|
MicroRNAs in cancer
|
|
Small cell lung cancerhsa00590:Arachidonic acid metabolism
|
|
Platelet activation
|
|
Serotonergic synapsehsa04310:Wnt signaling pathway
|
|
Alzheimer's disease
|
|
NetPath Pathway
|
IL1 Signaling Pathway
|
|
TSH Signaling Pathway
|
|
IL4 Signaling Pathway
|
|
TGF_beta_Receptor Signaling Pathway
|
|
IL5 Signaling PathwayNetPath_7:TGF_beta_Receptor Signaling PathwayNetPath_3:Notch Signaling Pathway
|
|
PANTHER Pathway
|
Alzheimer disease-amyloid secretase pathway
|
|
Alzheimer disease-presenilin pathway
|
|
Notch signaling pathwayP00003:Alzheimer disease-amyloid secretase pathway
|
|
Notch signaling pathwayP00019:Endothelin signaling pathway
|
|
Inflammation mediated by chemokine and cytokine signaling pathway
|
|
Toll receptor signaling pathway
|
|
CCKR signaling map STP00031:Inflammation mediated by chemokine and cytokine signaling pathwayP00003:Alzheimer disease-amyloid secretase pathway
|
|
Notch signaling pathway
|
|
Pathway Interaction Database
|
Notch signaling pathway
|
|
Presenilin action in Notch and Wnt signaling
|
|
p75(NTR)-mediated signaling
|
|
Syndecan-3-mediated signaling eventslkb1_pathway:LKB1 signaling eventsnfat_tfpathway:Calcineurin-regulated NFAT-dependent transcription in lymphocytes
|
|
S1P1 pathway
|
|
C-MYB transcription factor network
|
|
Signaling mediated by p38-alpha and p38-beta
|
|
Calcium signaling in the CD4+ TCR pathwaynotch_pathway:Notch signaling pathway
|
|
Syndecan-3-mediated signaling events
|
|
PathWhiz Pathway
|
Arachidonic Acid MetabolismPW000044:Arachidonic Acid Metabolism
|
|
Reactome
|
Nuclear signaling by ERBB4
|
|
Regulated proteolysis of p75NTR
|
|
NRIF signals cell death from the nucleus
|
|
Activated NOTCH1 Transmits Signal to the Nucleus
|
|
Constitutive Signaling by NOTCH1 PEST Domain Mutants
|
|
Constitutive Signaling by NOTCH1 HD+PEST Domain Mutants
|
|
NOTCH2 Activation and Transmission of Signal to the Nucleus
|
|
EPH-ephrin mediated repulsion of cellsR-HSA-1251985:Nuclear signaling by ERBB4
|
|
EPH-ephrin mediated repulsion of cellsR-HSA-1474228:Degradation of the extracellular matrix
|
|
WikiPathways
|
Notch Signaling Pathway
|
|
Signaling by ERBB4
|
|
Signaling by NOTCH3
|
|
Signaling by NOTCH4
|
|
Signaling by NOTCH1
|
|
Signaling by NOTCH2
|
|
Notch Signaling Pathway
|
|
Signalling by NGFWP61:Notch Signaling Pathway
|
|
Alzheimers Disease
|
|
Signalling by NGFWP98:Prostaglandin Synthesis and Regulation
|
|
Arachidonic acid metabolism
|
|
Aryl Hydrocarbon Receptor
|
|
Quercetin and Nf-kB/ AP-1 Induced Cell Apoptosis
|
|
Spinal Cord Injury
|
|
Integrated Pancreatic Cancer Pathway
|
|
Eicosanoid Synthesis
|
|
Selenium Micronutrient NetworkWP98:Prostaglandin Synthesis and Regulation
|
|
Phase 1 - Functionalization of compounds
|
|
Selenium Micronutrient NetworkWP61:Notch Signaling Pathway
|
| References |
| REF 1 | Bioorg Med Chem Lett. 2006 Apr 15;16(8):2219-23. Epub 2006 Feb 7.The geminal dimethyl analogue of Flurbiprofen as a novel Abeta42 inhibitor and potential Alzheimer's disease modifying agent. |
|---|
| REF 2 | J Med Chem. 2005 Jun 30;48(13):4312-31.2-Arylpropionic CXC chemokine receptor 1 (CXCR1) ligands as novel noncompetitive CXCL8 inhibitors. |
|---|
