| Drug General Information |
| Drug ID |
D08JKK
|
| Former ID |
DIB016032
|
| Drug Name |
RWJ-63556
|
| Indication |
Arthritis [ICD9: 710-719; ICD10:M00-M25]
|
Terminated |
[1]
|
|---|
| Company |
RW Johnson Pharmaceutical Research Institute
|
| Structure |
|
Download
2D MOL
3D MOL
|
| Canonical SMILES |
S(=O)(=O)(Nc1sc(cc1)Oc1ccc(F)cc1)C
|
| CAS Number |
CAS 190967-35-2
|
| Target and Pathway |
| Target(s) |
Arachidonate 5-lipoxygenase |
Target Info |
Modulator |
[1]
|
|---|
| Prostaglandin G/H synthase 2 |
Target Info |
Modulator |
[1]
|
|
BioCyc Pathway
|
Aspirin-triggered lipoxin biosynthesis
|
|
Resolvin D biosynthesis
|
|
Leukotriene biosynthesis
|
|
Lipoxin biosynthesis
|
|
Aspirin triggered resolvin D biosynthesis
|
|
Aspirin triggered resolvin E biosynthesisPWY66-393:Aspirin-triggered lipoxin biosynthesis
|
|
C20 prostanoid biosynthesis
|
|
Aspirin triggered resolvin E biosynthesis
|
|
KEGG Pathway
|
Arachidonic acid metabolism
|
|
Metabolic pathways
|
|
Serotonergic synapse
|
|
Ovarian steroidogenesis
|
|
Toxoplasmosishsa00590:Arachidonic acid metabolism
|
|
NF-kappa B signaling pathway
|
|
VEGF signaling pathway
|
|
TNF signaling pathway
|
|
Retrograde endocannabinoid signaling
|
|
Oxytocin signaling pathway
|
|
Regulation of lipolysis in adipocytes
|
|
Leishmaniasis
|
|
Pathways in cancer
|
|
Chemical carcinogenesis
|
|
MicroRNAs in cancer
|
|
Small cell lung cancer
|
|
NetPath Pathway
|
IL4 Signaling PathwayNetPath_13:IL1 Signaling Pathway
|
|
TSH Signaling Pathway
|
|
IL4 Signaling Pathway
|
|
TGF_beta_Receptor Signaling Pathway
|
|
IL5 Signaling Pathway
|
|
PANTHER Pathway
|
Endothelin signaling pathway
|
|
Inflammation mediated by chemokine and cytokine signaling pathway
|
|
Toll receptor signaling pathway
|
|
CCKR signaling map ST
|
|
Pathway Interaction Database
|
Calcineurin-regulated NFAT-dependent transcription in lymphocytes
|
|
S1P1 pathway
|
|
C-MYB transcription factor network
|
|
Signaling mediated by p38-alpha and p38-beta
|
|
Calcium signaling in the CD4+ TCR pathway
|
|
PathWhiz Pathway
|
Arachidonic Acid MetabolismPW000044:Arachidonic Acid Metabolism
|
|
WikiPathways
|
Vitamin D Receptor Pathway
|
|
Arachidonic acid metabolism
|
|
Eicosanoid Synthesis
|
|
Selenium Micronutrient NetworkWP98:Prostaglandin Synthesis and Regulation
|
|
Aryl Hydrocarbon Receptor
|
|
Quercetin and Nf-kB/ AP-1 Induced Cell Apoptosis
|
|
Spinal Cord Injury
|
|
Integrated Pancreatic Cancer Pathway
|
|
Selenium Micronutrient Network
|
| References |
| REF 1 | Evaluation of the antiinflammatory activity of a dual cyclooxygenase-2 selective/5-lipoxygenase inhibitor, RWJ 63556, in a canine model of inflammation. J Pharmacol Exp Ther. 1997 Aug;282(2):1094-101. |
|---|
