| Drug General Information |
| Drug ID |
D05ETN
|
| Former ID |
DNC010941
|
| Drug Name |
4-(2-Methyl-8-quinolinoxy)-3-pyridinesulfonamide
|
| Drug Type |
Small molecular drug
|
| Indication |
Discovery agent
|
Investigative |
[1]
|
|---|
| Structure |
|
Download
2D MOL
3D MOL
|
| Formula |
C15H13N3O3S
|
| Canonical SMILES |
CC1=NC2=C(C=CC=C2OC3=C(C=NC=C3)S(=O)(=O)N)C=C1
|
| InChI |
1S/C15H13N3O3S/c1-10-5-6-11-3-2-4-13(15(11)18-10)21-12-7-8-17-9-14(12)22(16,19)20/h2-9H,1H3,(H2,16,19,20)
|
| InChIKey |
LNNGPAKWWNABIA-UHFFFAOYSA-N
|
| PubChem Compound ID |
|
| Target and Pathway |
| Target(s) |
Carbonic anhydrase I |
Target Info |
Inhibitor |
[1]
|
|---|
| Carbonic anhydrase XII |
Target Info |
Inhibitor |
[1]
|
| Carbonic anhydrase II |
Target Info |
Inhibitor |
[1]
|
| Carbonic anhydrase XIV |
Target Info |
Inhibitor |
[1]
|
| Carbonic anhydrase IX |
Target Info |
Inhibitor |
[1]
|
|
KEGG Pathway
|
Nitrogen metabolismhsa00910:Nitrogen metabolismhsa00910:Nitrogen metabolism
|
|
Proximal tubule bicarbonate reclamation
|
|
Collecting duct acid secretion
|
|
Gastric acid secretion
|
|
Pancreatic secretion
|
|
Bile secretionhsa00910:Nitrogen metabolismhsa00910:Nitrogen metabolism
|
|
NetPath Pathway
|
TGF_beta_Receptor Signaling PathwayNetPath_16:IL4 Signaling Pathway
|
|
EGFR1 Signaling Pathway
|
|
Pathway Interaction Database
|
C-MYB transcription factor networkhif1_tfpathway:HIF-1-alpha transcription factor network
|
|
PathWhiz Pathway
|
Gastric Acid Production
|
|
Reactome
|
Erythrocytes take up carbon dioxide and release oxygen
|
|
Erythrocytes take up oxygen and release carbon dioxide
|
|
Reversible hydration of carbon dioxideR-HSA-1475029:Reversible hydration of carbon dioxideR-HSA-1237044:Erythrocytes take up carbon dioxide and release oxygen
|
|
Reversible hydration of carbon dioxideR-HSA-1475029:Reversible hydration of carbon dioxideR-HSA-1234158:Regulation of gene expression by Hypoxia-inducible Factor
|
|
Reversible hydration of carbon dioxide
|
|
WikiPathways
|
Reversible Hydration of Carbon Dioxide
|
|
Uptake of Carbon Dioxide and Release of Oxygen by Erythrocytes
|
|
Uptake of Oxygen and Release of Carbon Dioxide by ErythrocytesWP2770:Reversible Hydration of Carbon Dioxide
|
|
miR-targeted genes in muscle cell - TarBase
|
|
miR-targeted genes in leukocytes - TarBase
|
|
miR-targeted genes in epithelium - TarBaseWP2770:Reversible Hydration of Carbon Dioxide
|
|
Uptake of Oxygen and Release of Carbon Dioxide by ErythrocytesWP2770:Reversible Hydration of Carbon DioxideWP2877:Vitamin D Receptor Pathway
|
|
Regulation of Hypoxia-inducible Factor (HIF) by Oxygen
|
| References |
| REF 1 | Eur J Med Chem. 2010 Jun;45(6):2396-404. Epub 2010 Feb 12.Carbonic anhydrase inhibitors: synthesis and inhibition of the human cytosolic isozymes I and II and transmembrane isozymes IX, XII (cancer-associated) and XIV with 4-substituted 3-pyridinesulfonamides. |
|---|
