| Drug General Information |
| Drug ID |
D03ZMQ
|
| Former ID |
DNC010059
|
| Drug Name |
COUMARIN
|
| Drug Type |
Small molecular drug
|
| Indication |
Discovery agent
|
Investigative |
[1]
|
|---|
| Structure |
|
Download
2D MOL
3D MOL
|
| Formula |
C9H6O2
|
| Canonical SMILES |
CC(=C)C(C(C1=C(C=C2C(=C1)C=CC(=O)O2)OC)O)O
|
| InChI |
1S/C15H16O5/c1-8(2)14(17)15(18)10-6-9-4-5-13(16)20-11(9)7-12(10)19-3/h4-7,14-15,17-18H,1H2,2-3H3
|
| InChIKey |
PMZIJDMODGMWOR-UHFFFAOYSA-N
|
| PubChem Compound ID |
|
| Target and Pathway |
| Target(s) |
Carbonic anhydrase |
Target Info |
Inhibitor |
[1]
|
|---|
| Carbonic anhydrase IV |
Target Info |
Inhibitor |
[1]
|
| Carbonic anhydrase I |
Target Info |
Inhibitor |
[2]
|
| Carbonic anhydrase VI |
Target Info |
Inhibitor |
[1]
|
| Carbonic anhydrase IX |
Target Info |
Inhibitor |
[1]
|
| Carbonic anhydrase XIV |
Target Info |
Inhibitor |
[1]
|
| Carbonic anhydrase II |
Target Info |
Inhibitor |
[2]
|
| Carbonic anhydrase XII |
Target Info |
Inhibitor |
[1]
|
|
KEGG Pathway
|
Nitrogen metabolism
|
|
Proximal tubule bicarbonate reclamationhsa00910:Nitrogen metabolismhsa00910:Nitrogen metabolismhsa00910:Nitrogen metabolismhsa00910:Nitrogen metabolismhsa00910:Nitrogen metabolism
|
|
Proximal tubule bicarbonate reclamation
|
|
Collecting duct acid secretion
|
|
Gastric acid secretion
|
|
Pancreatic secretion
|
|
Bile secretionhsa00910:Nitrogen metabolism
|
|
NetPath Pathway
|
IL4 Signaling Pathway
|
|
EGFR1 Signaling PathwayNetPath_7:TGF_beta_Receptor Signaling Pathway
|
|
Pathway Interaction Database
|
C-MYB transcription factor networkhif1_tfpathway:HIF-1-alpha transcription factor network
|
|
PathWhiz Pathway
|
Gastric Acid Production
|
|
Reactome
|
Erythrocytes take up carbon dioxide and release oxygen
|
|
Erythrocytes take up oxygen and release carbon dioxide
|
|
Reversible hydration of carbon dioxideR-HSA-1237044:Erythrocytes take up carbon dioxide and release oxygen
|
|
Reversible hydration of carbon dioxideR-HSA-1475029:Reversible hydration of carbon dioxideR-HSA-1234158:Regulation of gene expression by Hypoxia-inducible Factor
|
|
Reversible hydration of carbon dioxideR-HSA-1475029:Reversible hydration of carbon dioxideR-HSA-1237044:Erythrocytes take up carbon dioxide and release oxygen
|
|
Reversible hydration of carbon dioxideR-HSA-1475029:Reversible hydration of carbon dioxide
|
|
WikiPathways
|
Reversible Hydration of Carbon Dioxide
|
|
Uptake of Carbon Dioxide and Release of Oxygen by Erythrocytes
|
|
Uptake of Oxygen and Release of Carbon Dioxide by ErythrocytesWP2770:Reversible Hydration of Carbon Dioxide
|
|
Uptake of Oxygen and Release of Carbon Dioxide by ErythrocytesWP2770:Reversible Hydration of Carbon DioxideWP2877:Vitamin D Receptor Pathway
|
|
Regulation of Hypoxia-inducible Factor (HIF) by OxygenWP2770:Reversible Hydration of Carbon DioxideWP2770:Reversible Hydration of Carbon Dioxide
|
|
miR-targeted genes in muscle cell - TarBase
|
|
miR-targeted genes in leukocytes - TarBase
|
|
miR-targeted genes in epithelium - TarBase
|
| References |
| REF 1 | J Med Chem. 2010 Jan 14;53(1):335-44.Deciphering the mechanism of carbonic anhydrase inhibition with coumarins and thiocoumarins. |
|---|
| REF 2 | Bioorg Med Chem Lett. 2010 Dec 15;20(24):7255-8. Epub 2010 Oct 25.7,8-disubstituted- but not 6,7-disubstituted coumarins selectively inhibit the transmembrane, tumor-associated carbonic anhydrase isoforms IX and XII over the cytosolic ones I and II in the low nanomolar/subnanomolar range. |
|---|
