| Drug General Information |
| Drug ID |
D01WJZ
|
| Former ID |
DNC012338
|
| Drug Name |
MAZAPERTINE
|
| Drug Type |
Small molecular drug
|
| Indication |
Discovery agent
|
Discontinued in Phase 2 |
[1]
|
|---|
| Structure |
|
Download
2D MOL
3D MOL
|
| Formula |
C26H35N3O2
|
| Canonical SMILES |
CC(C)OC1=CC=CC=C1N2CCN(CC2)CC3=CC=CC(=C3)C(=O)N4CCCCC4
|
| InChI |
1S/C26H35N3O2/c1-21(2)31-25-12-5-4-11-24(25)28-17-15-27(16-18-28)20-22-9-8-10-23(19-22)26(30)29-13-6-3-7-14-29/h4-5,8-12,19,21H,3,6-7,13-18,20H2,1-2H3
|
| InChIKey |
ZKZFPRUSWCYSGT-UHFFFAOYSA-N
|
| PubChem Compound ID |
|
| Target and Pathway |
| Target(s) |
Alpha-1D adrenergic receptor |
Target Info |
Inhibitor |
[2]
|
|---|
| 5-hydroxytryptamine 1A receptor |
Target Info |
Inhibitor |
[2]
|
| 5-hydroxytryptamine 2A receptor |
Target Info |
Inhibitor |
[2]
|
| Alpha-2B adrenergic receptor |
Target Info |
Inhibitor |
[2]
|
| D(2) dopamine receptor |
Target Info |
Inhibitor |
[2]
|
| Alpha-2A adrenergic receptor |
Target Info |
Inhibitor |
[2]
|
| Alpha-1B adrenergic receptor |
Target Info |
Inhibitor |
[2]
|
| D(3) dopamine receptor |
Target Info |
Inhibitor |
[2]
|
| Alpha-1A adrenergic receptor |
Target Info |
Inhibitor |
[2]
|
| Alpha-2C adrenergic receptor |
Target Info |
Inhibitor |
[2]
|
|
KEGG Pathway
|
Calcium signaling pathway
|
|
cGMP-PKG signaling pathway
|
|
Neuroactive ligand-receptor interaction
|
|
Adrenergic signaling in cardiomyocytes
|
|
Vascular smooth muscle contraction
|
|
Salivary secretionhsa04024:cAMP signaling pathway
|
|
Serotonergic synapsehsa04020:Calcium signaling pathway
|
|
Gap junction
|
|
Serotonergic synapse
|
|
Inflammatory mediator regulation of TRP channelshsa04022:cGMP-PKG signaling pathway
|
|
Neuroactive ligand-receptor interactionhsa04015:Rap1 signaling pathway
|
|
cAMP signaling pathway
|
|
Dopaminergic synapse
|
|
Parkinson's disease
|
|
Cocaine addiction
|
|
Alcoholismhsa04022:cGMP-PKG signaling pathway
|
|
Neuroactive ligand-receptor interactionhsa04020:Calcium signaling pathway
|
|
Salivary secretionhsa04080:Neuroactive ligand-receptor interaction
|
|
Dopaminergic synapsehsa04020:Calcium signaling pathway
|
|
AMPK signaling pathway
|
|
Salivary secretionhsa04022:cGMP-PKG signaling pathway
|
|
NetPath Pathway
|
IL2 Signaling PathwayNetPath_14:IL2 Signaling Pathway
|
|
PANTHER Pathway
|
Heterotrimeric G-protein signaling pathway-Gi alpha and Gs alpha mediated pathway
|
|
5HT1 type receptor mediated signaling pathwayP04374:5HT2 type receptor mediated signaling pathwayP00002:Alpha adrenergic receptor signaling pathway
|
|
Heterotrimeric G-protein signaling pathway-Gi alpha and Gs alpha mediated pathwayP00026:Heterotrimeric G-protein signaling pathway-Gi alpha and Gs alpha mediated pathway
|
|
Heterotrimeric G-protein signaling pathway-Gq alpha and Go alpha mediated pathway
|
|
Dopamine receptor mediated signaling pathway
|
|
Nicotine pharmacodynamics pathwayP00002:Alpha adrenergic receptor signaling pathwayP00002:Alpha adrenergic receptor signaling pathwayP00002:Alpha adrenergic receptor signaling pathwayP00002:Alpha adrenergic receptor signaling pathway
|
|
Pathway Interaction Database
|
LPA receptor mediated events
|
|
Reactome
|
Adrenoceptors
|
|
G alpha (q) signalling events
|
|
G alpha (12/13) signalling eventsR-HSA-390666:Serotonin receptors
|
|
G alpha (i) signalling eventsR-HSA-390666:Serotonin receptors
|
|
G alpha (q) signalling eventsR-HSA-390696:Adrenoceptors
|
|
Adrenaline signalling through Alpha-2 adrenergic receptor
|
|
G alpha (i) signalling events
|
|
G alpha (z) signalling eventsR-HSA-390651:Dopamine receptors
|
|
G alpha (i) signalling eventsR-HSA-390696:Adrenoceptors
|
|
Adrenaline,noradrenaline inhibits insulin secretion
|
|
G alpha (z) signalling events
|
|
Surfactant metabolismR-HSA-390696:Adrenoceptors
|
|
G alpha (12/13) signalling eventsR-HSA-390651:Dopamine receptors
|
|
G alpha (12/13) signalling eventsR-HSA-390696:Adrenoceptors
|
|
Surfactant metabolism
|
|
WikiPathways
|
Monoamine GPCRs
|
|
Calcium Regulation in the Cardiac Cell
|
|
GPCRs, Class A Rhodopsin-like
|
|
Gastrin-CREB signalling pathway via PKC and MAPK
|
|
GPCR ligand binding
|
|
GPCR downstream signaling
|
|
GPCRs, OtherWP722:Serotonin HTR1 Group and FOS Pathway
|
|
SIDS Susceptibility Pathways
|
|
GPCR downstream signalingWP733:Serotonin Receptor 2 and STAT3 Signaling
|
|
Serotonin Receptor 2 and ELK-SRF/GATA4 signaling
|
|
GPCRs, OtherWP58:Monoamine GPCRs
|
|
Platelet Aggregation (Plug Formation)
|
|
GPCR downstream signalingWP666:Hypothetical Network for Drug Addiction
|
|
Genes and (Common) Pathways Underlying Drug Addiction
|
|
Nicotine Activity on Dopaminergic NeuronsWP58:Monoamine GPCRs
|
|
Integration of energy metabolism
|
|
GPCR downstream signalingWP58:Monoamine GPCRs
|
|
Vitamin D Receptor Pathway
|
|
AMPK SignalingWP58:Monoamine GPCRs
|
|
Nicotine Activity on Dopaminergic Neurons
|
|
Endothelin Pathways
|
| References |
| REF 1 | Trusted, scientifically sound profiles of drug programs, clinical trials, safety reports, and company deals, written by scientists. Springer. 2015. Adis Insight (drug id 800002662) |
|---|
| REF 2 | J Med Chem. 1994 Apr 15;37(8):1060-2.A new arylpiperazine antipsychotic with high D2/D3/5-HT1A/alpha 1A-adrenergic affinity and a low potential for extrapyramidal effects. |
|---|
