| Drug General Information |
| Drug ID |
D0Y9TL
|
| Former ID |
DNC008144
|
| Drug Name |
5-chloro-3,4-dihydroquinazolin-2-amine
|
| Drug Type |
Small molecular drug
|
| Indication |
Discovery agent
|
Investigative |
[1]
|
|---|
| Structure |
|
Download
2D MOL
3D MOL
|
| Formula |
C8H8ClN3
|
| Canonical SMILES |
C1C2=C(C=CC=C2Cl)NC(=N1)N
|
| InChI |
1S/C8H8ClN3/c9-6-2-1-3-7-5(6)4-11-8(10)12-7/h1-3H,4H2,(H3,10,11,12)
|
| InChIKey |
UDUQYNVUNNDSEJ-UHFFFAOYSA-N
|
| PubChem Compound ID |
|
| Target and Pathway |
| Target(s) |
5-hydroxytryptamine 7 receptor |
Target Info |
Inhibitor |
[1]
|
|---|
| 5-hydroxytryptamine 1A receptor |
Target Info |
Inhibitor |
[1]
|
| 5-hydroxytryptamine 2A receptor |
Target Info |
Inhibitor |
[1]
|
| 5-hydroxytryptamine receptor 3A |
Target Info |
Inhibitor |
[1]
|
| 5-hydroxytryptamine 1D receptor |
Target Info |
Inhibitor |
[1]
|
| 5-hydroxytryptamine 5A receptor |
Target Info |
Inhibitor |
[1]
|
| 5-hydroxytryptamine 2C receptor |
Target Info |
Inhibitor |
[1]
|
|
KEGG Pathway
|
Ras signaling pathway
|
|
Calcium signaling pathway
|
|
Neuroactive ligand-receptor interaction
|
|
Serotonergic synapsehsa04024:cAMP signaling pathway
|
|
Serotonergic synapsehsa04020:Calcium signaling pathway
|
|
Gap junction
|
|
Serotonergic synapse
|
|
Inflammatory mediator regulation of TRP channelshsa04726:Serotonergic synapsehsa04024:cAMP signaling pathway
|
|
Inflammatory mediator regulation of TRP channels
|
|
NetPath Pathway
|
IL2 Signaling Pathway
|
|
PANTHER Pathway
|
Heterotrimeric G-protein signaling pathway-Gi alpha and Gs alpha mediated pathwayP00026:Heterotrimeric G-protein signaling pathway-Gi alpha and Gs alpha mediated pathway
|
|
5HT1 type receptor mediated signaling pathwayP04374:5HT2 type receptor mediated signaling pathwayP04375:5HT3 type receptor mediated signaling pathwayP00026:Heterotrimeric G-protein signaling pathway-Gi alpha and Gs alpha mediated pathway
|
|
5HT1 type receptor mediated signaling pathwayP00026:Heterotrimeric G-protein signaling pathway-Gi alpha and Gs alpha mediated pathwayP04374:5HT2 type receptor mediated signaling pathway
|
|
PathWhiz Pathway
|
Excitatory Neural Signalling Through 5-HTR 7 and Serotonin
|
|
Reactome
|
Serotonin receptors
|
|
G alpha (s) signalling eventsR-HSA-390666:Serotonin receptors
|
|
G alpha (i) signalling eventsR-HSA-390666:Serotonin receptors
|
|
G alpha (q) signalling eventsR-HSA-975298:Ligand-gated ion channel transportR-HSA-390666:Serotonin receptors
|
|
G alpha (q) signalling events
|
|
WikiPathways
|
Serotonin Receptor 4/6/7 and NR3C Signaling
|
|
Monoamine GPCRs
|
|
GPCRs, Class A Rhodopsin-like
|
|
GPCR ligand binding
|
|
GPCR downstream signaling
|
|
GPCRs, OtherWP722:Serotonin HTR1 Group and FOS Pathway
|
|
SIDS Susceptibility Pathways
|
|
GPCR downstream signalingWP733:Serotonin Receptor 2 and STAT3 Signaling
|
|
Serotonin Receptor 2 and ELK-SRF/GATA4 signaling
|
|
Gastrin-CREB signalling pathway via PKC and MAPK
|
|
GPCRs, OtherWP706:SIDS Susceptibility Pathways
|
|
Iron uptake and transportWP722:Serotonin HTR1 Group and FOS Pathway
|
|
GPCR downstream signalingWP58:Monoamine GPCRs
|
|
GPCR downstream signalingWP732:Serotonin Receptor 2 and ELK-SRF/GATA4 signaling
|
| References |
| REF 1 | Bioorg Med Chem Lett. 2008 Jan 1;18(1):256-61. Epub 2007 Oct 30.Cyclic guanidines as dual 5-HT5A/5-HT7 receptor ligands: structure-activity relationship elucidation. |
|---|
