| Drug General Information |
| Drug ID |
D0W1XA
|
| Former ID |
DNC003580
|
| Drug Name |
NECA
|
| Drug Type |
Small molecular drug
|
| Indication |
Discovery agent
|
Investigative |
[1]
|
|---|
| Structure |
|
Download
2D MOL
|
| Formula |
C12H16N6O4
|
| InChI |
InChI=1S/C12H16N6O4/c1-2-14-11(21)8-6(19)7(20)12(22-8)18-4-17-5-9(13)15-3-16-10(5)18/h3-4,6-8,12,19-20H,2H2,1H3,(H,14,21)(H2,13,15,16)/t6-,7+,8-,12+/m0/s1
|
| InChIKey |
JADDQZYHOWSFJD-FLNNQWSLSA-N
|
| PubChem Compound ID |
|
| PubChem Substance ID |
831348, 833152, 6436257, 7889349, 7980100, 10300190, 11532956, 12012601, 14849888, 24263019, 26752231, 26752232, 36890147, 46393043, 49689293, 50104936, 53789671, 56463209, 71826089, 74667278, 90341085, 103601612, 104639154, 121360337, 124801005, 128245462, 134340785, 135061485, 135650706, 135651187, 135697884, 162169163, 162226946, 164841257, 170481837, 179350351, 224274871, 241375582, 242081484, 249617374, 252156038, 252342800, 252420421
|
| Target and Pathway |
| Target(s) |
Adenosine A3 receptor |
Target Info |
Inhibitor |
[2]
|
|---|
| Adenosine A2a receptor |
Target Info |
Inhibitor |
[3]
|
| Adenosine A2b receptor |
Target Info |
Inhibitor |
[3]
|
| Adenosine A1 receptor |
Target Info |
Inhibitor |
[3]
|
|
KEGG Pathway
|
Rap1 signaling pathway
|
|
Calcium signaling pathway
|
|
cAMP signaling pathway
|
|
Neuroactive ligand-receptor interaction
|
|
Vascular smooth muscle contraction
|
|
Parkinson's disease
|
|
Alcoholismhsa04015:Rap1 signaling pathway
|
|
Alcoholismhsa04022:cGMP-PKG signaling pathway
|
|
Sphingolipid signaling pathway
|
|
Morphine addiction
|
|
NetPath Pathway
|
TGF_beta_Receptor Signaling Pathway
|
|
TCR Signaling PathwayNetPath_11:TCR Signaling Pathway
|
|
RANKL Signaling Pathway
|
|
PANTHER Pathway
|
Heterotrimeric G-protein signaling pathway-Gi alpha and Gs alpha mediated pathway
|
|
Heterotrimeric G-protein signaling pathway-Gq alpha and Go alpha mediated pathway
|
|
Pathway Interaction Database
|
HIF-2-alpha transcription factor networkcmyb_pathway:C-MYB transcription factor network
|
|
PathWhiz Pathway
|
Intracellular Signalling Through Adenosine Receptor A2a and AdenosinePW000446:Intracellular Signalling Through Adenosine Receptor A2b and Adenosine
|
|
Reactome
|
Adenosine P1 receptors
|
|
G alpha (i) signalling eventsR-HSA-187024:NGF-independant TRKA activation
|
|
G alpha (s) signalling events
|
|
Surfactant metabolismR-HSA-417973:Adenosine P1 receptors
|
|
G alpha (i) signalling events
|
|
WikiPathways
|
Nucleotide GPCRs
|
|
GPCRs, Class A Rhodopsin-like
|
|
GPCRs, OtherWP80:Nucleotide GPCRs
|
|
Monoamine Transport
|
|
NGF signalling via TRKA from the plasma membrane
|
|
GPCR ligand binding
|
|
GPCR downstream signaling
|
|
GPCR downstream signalingWP80:Nucleotide GPCRs
|
| References |
| REF 1 | (http://www.guidetopharmacology.org/) Nucleic Acids Res. 2015 Oct 12. pii: gkv1037. The IUPHAR/BPS Guide to PHARMACOLOGY in 2016: towards curated quantitative interactions between 1300 protein targets and 6000 ligands. (Ligand id: 377). |
|---|
| REF 2 | J Med Chem. 1999 Apr 22;42(8):1384-92.5'-N-substituted carboxamidoadenosines as agonists for adenosine receptors. |
|---|
| REF 3 | J Med Chem. 1988 Jun;31(6):1179-83.Adenosine receptor agonists: synthesis and biological evaluation of 1-deaza analogues of adenosine derivatives. |
|---|
