| Drug General Information |
| Drug ID |
D0N9CG
|
| Former ID |
DNC005501
|
| Drug Name |
DIADZEIN
|
| Drug Type |
Small molecular drug
|
| Indication |
Discovery agent
|
Investigative |
[1]
|
|---|
| Structure |
|
Download
2D MOL
|
| Formula |
C15H10O4
|
| Canonical SMILES |
C1=CC(=CC=C1C2=COC3=C(C2=O)C=CC(=C3)O)O
|
| InChI |
1S/C15H10O4/c16-10-3-1-9(2-4-10)13-8-19-14-7-11(17)5-6-12(14)15(13)18/h1-8,16-17H
|
| InChIKey |
ZQSIJRDFPHDXIC-UHFFFAOYSA-N
|
| PubChem Compound ID |
|
| Target and Pathway |
| Target(s) |
Estrogen receptor |
Target Info |
Inhibitor |
[1]
|
|---|
| Estrogen receptor beta |
Target Info |
Inhibitor |
[1]
|
| Aldose reductase |
Target Info |
Inhibitor |
[2]
|
|
BioCyc Pathway
|
Methylglyoxal degradation III
|
|
Acetone degradation I (to methylglyoxal)
|
|
KEGG Pathway
|
Estrogen signaling pathway
|
|
Prolactin signaling pathway
|
|
Thyroid hormone signaling pathway
|
|
Endocrine and other factor-regulated calcium reabsorption
|
|
Proteoglycans in cancerhsa04915:Estrogen signaling pathway
|
|
Prolactin signaling pathwayhsa00040:Pentose and glucuronate interconversions
|
|
Fructose and mannose metabolism
|
|
Galactose metabolism
|
|
Glycerolipid metabolism
|
|
Metabolic pathways
|
|
NetPath Pathway
|
FSH Signaling Pathway
|
|
EGFR1 Signaling Pathway
|
|
RANKL Signaling PathwayNetPath_13:IL1 Signaling Pathway
|
|
TGF_beta_Receptor Signaling Pathway
|
|
Pathway Interaction Database
|
Regulation of nuclear SMAD2/3 signaling
|
|
Signaling events mediated by HDAC Class II
|
|
Plasma membrane estrogen receptor signaling
|
|
LKB1 signaling events
|
|
Regulation of Telomerase
|
|
ATF-2 transcription factor network
|
|
AP-1 transcription factor network
|
|
FOXM1 transcription factor network
|
|
Validated nuclear estrogen receptor alpha network
|
|
Signaling mediated by p38-alpha and p38-beta
|
|
FOXA1 transcription factor networker_nongenomic_pathway:Plasma membrane estrogen receptor signaling
|
|
Validated nuclear estrogen receptor beta network
|
|
PathWhiz Pathway
|
Fructose and Mannose Degradation
|
|
Pyruvate Metabolism
|
|
Pterine Biosynthesis
|
|
Glycerolipid Metabolism
|
|
Galactose Metabolism
|
|
Reactome
|
Nuclear signaling by ERBB4
|
|
Nuclear Receptor transcription pathwayR-HSA-383280:Nuclear Receptor transcription pathway
|
|
WikiPathways
|
Estrogen signaling pathway
|
|
Nuclear Receptors Meta-Pathway
|
|
Estrogen Receptor Pathway
|
|
Signaling by ERBB4
|
|
JAK/STAT
|
|
Integrated Pancreatic Cancer Pathway
|
|
Leptin signaling pathway
|
|
miR-targeted genes in muscle cell - TarBase
|
|
Integrated Breast Cancer Pathway
|
|
Nuclear ReceptorsWP706:SIDS Susceptibility Pathways
|
|
Ovarian Infertility Genes
|
|
Nuclear ReceptorsWP702:Metapathway biotransformation
|
|
Polyol Pathway
|
|
Metabolism of steroid hormones and vitamin D
|
| References |
| REF 1 | J Nat Prod. 2002 Dec;65(12):1749-53.Isolation and structure elucidation of an isoflavone and a sesterterpenoic acid from Henriettella fascicularis. |
|---|
| REF 2 | J Med Chem. 1999 Jun 3;42(11):1881-93.1-Benzopyran-4-one antioxidants as aldose reductase inhibitors. |
|---|
