| Drug General Information |
| Drug ID |
D0H2WQ
|
| Former ID |
DNC005427
|
| Drug Name |
QUINPIROLE
|
| Drug Type |
Small molecular drug
|
| Indication |
Discovery agent
|
Investigative |
[1]
|
|---|
| Structure |
|
Download
2D MOL
3D MOL
|
| Formula |
C13H21N3
|
| InChI |
InChI=1S/C13H21N3/c1-2-5-16-6-3-4-10-7-12-11(8-13(10)16)9-14-15-12/h9-10,13H,2-8H2,1H3,(H,14,15)/t10-,13-/m1/s1
|
| InChIKey |
FTSUPYGMFAPCFZ-ZWNOBZJWSA-N
|
| PubChem Compound ID |
|
| PubChem Substance ID |
7979642, 8183700, 11111699, 11111700, 11112870, 11113890, 11467121, 11468241, 11486789, 14749084, 14822656, 34718542, 47217011, 47589200, 47662524, 48185202, 48185203, 48259472, 48334737, 48334738, 49699323, 50030315, 50490234, 53789374, 57313626, 84970652, 85788346, 85788801, 90341178, 90341722, 90342389, 92308913, 103543557, 103930000, 104094265, 104171332, 104305244, 118842217, 124750152, 124882692, 124882695, 131328223, 134342632, 134392947, 135013177, 135060312, 135650874, 136350737, 139699431, 140359097
|
| Target and Pathway |
| Target(s) |
D(3) dopamine receptor |
Target Info |
Inhibitor |
[2]
|
|---|
| D(2) dopamine receptor |
Target Info |
Inhibitor |
[3]
|
| D(4) dopamine receptor |
Target Info |
Inhibitor |
[4]
|
| Dopamine D1 receptor |
Target Info |
Inhibitor |
[4]
|
|
KEGG Pathway
|
Neuroactive ligand-receptor interaction
|
|
Dopaminergic synapsehsa04015:Rap1 signaling pathway
|
|
cAMP signaling pathway
|
|
Gap junction
|
|
Dopaminergic synapse
|
|
Parkinson's disease
|
|
Cocaine addiction
|
|
Alcoholismhsa04080:Neuroactive ligand-receptor interaction
|
|
Dopaminergic synapsehsa04020:Calcium signaling pathway
|
|
Amphetamine addiction
|
|
Morphine addiction
|
|
Alcoholism
|
|
PANTHER Pathway
|
Heterotrimeric G-protein signaling pathway-Gi alpha and Gs alpha mediated pathway
|
|
Heterotrimeric G-protein signaling pathway-Gq alpha and Go alpha mediated pathway
|
|
Dopamine receptor mediated signaling pathway
|
|
Nicotine pharmacodynamics pathwayP00026:Heterotrimeric G-protein signaling pathway-Gi alpha and Gs alpha mediated pathway
|
|
Nicotine pharmacodynamics pathwayP05912:Dopamine receptor mediated signaling pathway
|
|
PathWhiz Pathway
|
Dopamine Activation of Neurological Reward System
|
|
Reactome
|
Dopamine receptors
|
|
G alpha (i) signalling eventsR-HSA-390651:Dopamine receptors
|
|
G alpha (s) signalling events
|
|
WikiPathways
|
Monoamine GPCRs
|
|
GPCRs, Class A Rhodopsin-like
|
|
GPCR ligand binding
|
|
GPCR downstream signaling
|
|
Nicotine Activity on Dopaminergic Neurons
|
|
GPCRs, OtherWP666:Hypothetical Network for Drug Addiction
|
|
Genes and (Common) Pathways Underlying Drug Addiction
|
|
Nicotine Activity on Dopaminergic NeuronsWP666:Hypothetical Network for Drug Addiction
|
| References |
| REF 1 | (http://www.guidetopharmacology.org/) Nucleic Acids Res. 2015 Oct 12. pii: gkv1037. The IUPHAR/BPS Guide to PHARMACOLOGY in 2016: towards curated quantitative interactions between 1300 protein targets and 6000 ligands. (Ligand id: 2). |
|---|
| REF 2 | J Med Chem. 2009 Nov 12;52(21):6860-70.1,1'-Disubstituted ferrocenes as molecular hinges in mono- and bivalent dopamine receptor ligands. |
|---|
| REF 3 | J Med Chem. 1998 Dec 3;41(25):4933-8.N-n-Propyl-substituted 3-(dimethylphenyl)piperidines display novel discriminative properties between dopamine receptor subtypes: synthesis and receptor binding studies. |
|---|
| REF 4 | J Med Chem. 2005 Sep 8;48(18):5771-9.Pharmacophore-guided drug discovery investigations leading to bioactive 5-aminotetrahydropyrazolopyridines. Implications for the binding mode of heterocyclic dopamine D3 receptor agonists. |
|---|
