| Drug General Information |
| Drug ID |
D0B7CH
|
| Former ID |
DCL000929
|
| Drug Name |
Phenylbutyrate
|
| Synonyms |
Benzenebutanoic acid; Benzenebutyric acid; Phenyl butanoate; Phenyl butyrate; HDInhib_000004; Butanoic acid, phenyl ester; Butyric acid, phenyl ester; FR-2080; Gamma-Phenylbutyric acid; Omega-Phenylbutanoic acid; GAMMA-PHENYL-BUTYRIC ACID; Butyric acid, 4-phenyl-(8CI); 1-Phenylbutyric acid; 2-methyl-1-phenyl-propan-2-amine; 4-PHENYL-BUTANOIC ACID; 4-PHENYLBUTYRIC ACID; 4-Phenylbutanoic acid; 4-phenylbutans; 4-phenylbutyrate
|
| Drug Type |
Small molecular drug
|
| Indication |
Urea cycle disorders [ICD9: 270.6; ICD10:E72.2]
|
Phase 2 |
[1],
[2]
|
|---|
| Company |
Scandinavian
|
| Structure |
|
Download
2D MOL
3D MOL
|
| Formula |
C10H12O2
|
| InChI |
InChI=1S/C10H12O2/c11-10(12)8-4-7-9-5-2-1-3-6-9/h1-3,5-6H,4,7-8H2,(H,11,12)
|
| InChIKey |
OBKXEAXTFZPCHS-UHFFFAOYSA-N
|
| CAS Number |
CAS 90315-82-5
|
| PubChem Compound ID |
|
| PubChem Substance ID |
67217, 855904, 3134204, 5292415, 7886648, 8152932, 10511345, 11342085, 11362268, 11364225, 11366787, 11369349, 11371804, 11373523, 11377511, 11406848, 11424503, 11485491, 11487670, 11489614, 11490598, 11491907, 11495145, 15321781, 24898272, 26679333, 29199328, 29223859, 46393851, 46506332, 47216579, 47440033, 48334266, 48438876, 49831441, 50064557, 50100827, 50835531, 56311000, 56311078, 56422199, 57288416, 57288448, 57322443, 85173139, 85789498, 85789605, 87574802, 87691612, 88519576
|
| SuperDrug ATC ID |
R05DB09
|
| SuperDrug CAS ID |
cas=000468611
|
| Target and Pathway |
| Target(s) |
Sodium channel |
Target Info |
Blocker |
[1]
|
|---|
| Gamma-aminobutyric acid receptor |
Target Info |
Agonist |
[1]
|
| Histone deacetylase 1 |
Target Info |
Inhibitor |
[1]
|
|
KEGG Pathway
|
Dopaminergic synapsehsa04110:Cell cycle
|
|
Notch signaling pathway
|
|
Thyroid hormone signaling pathway
|
|
Huntington's disease
|
|
Amphetamine addiction
|
|
Alcoholism
|
|
Epstein-Barr virus infection
|
|
Pathways in cancer
|
|
Transcriptional misregulation in cancer
|
|
Viral carcinogenesis
|
|
MicroRNAs in cancer
|
|
Chronic myeloid leukemia
|
|
NetPath Pathway
|
TCR Signaling Pathway
|
|
PANTHER Pathway
|
Wnt signaling pathway
|
|
p53 pathway
|
|
Pathway Interaction Database
|
Regulation of nuclear SMAD2/3 signaling
|
|
Notch signaling pathway
|
|
E2F transcription factor network
|
|
Presenilin action in Notch and Wnt signaling
|
|
Signaling events mediated by HDAC Class I
|
|
Regulation of Telomerase
|
|
Glucocorticoid receptor regulatory network
|
|
Sumoylation by RanBP2 regulates transcriptional repression
|
|
Regulation of Androgen receptor activity
|
|
IL3-mediated signaling events
|
|
Validated nuclear estrogen receptor alpha network
|
|
Retinoic acid receptors-mediated signaling
|
|
Hedgehog signaling events mediated by Gli proteins
|
|
Regulation of nuclear beta catenin signaling and target gene transcription
|
|
Validated targets of C-MYC transcriptional repression
|
|
Regulation of retinoblastoma protein
|
|
Notch-mediated HES/HEY network
|
|
Reactome
|
Interaction between L1 and AnkyrinsR-HSA-1538133:G0 and Early G1
|
|
p75NTR negatively regulates cell cycle via SC1
|
|
Formation of the beta-catenin:TCF transactivating complex
|
|
NOTCH1 Intracellular Domain Regulates Transcription
|
|
SMAD2/SMAD3:SMAD4 heterotrimer regulates transcription
|
|
Constitutive Signaling by NOTCH1 PEST Domain Mutants
|
|
Constitutive Signaling by NOTCH1 HD+PEST Domain Mutants
|
|
HDACs deacetylate histones
|
|
Deactivation of the beta-catenin transactivating complex
|
|
NoRC negatively regulates rRNA expression
|
|
RNA Polymerase I Transcription Initiation
|
|
Factors involved in megakaryocyte development and platelet production
|
|
WikiPathways
|
SIDS Susceptibility Pathways
|
|
Notch Signaling Pathway
|
|
TGF beta Signaling Pathway
|
|
IL-6 signaling pathway
|
|
Apoptosis-related network due to altered Notch3 in ovarian cancer
|
|
Transcriptional activity of SMAD2/SMAD3:SMAD4 heterotrimer
|
|
Notch Signaling Pathway
|
|
Retinoblastoma (RB) in Cancer
|
|
Neural Crest Differentiation
|
|
TWEAK Signaling Pathway
|
|
Integrated Breast Cancer Pathway
|
|
Signalling by NGF
|
|
RNA Polymerase I, RNA Polymerase III, and Mitochondrial Transcription
|
|
Mitotic G1-G1/S phases
|
|
Factors involved in megakaryocyte development and platelet production
|
|
Cell Cycle
|
|
Androgen receptor signaling pathway
|
| References |
| REF 1 | Emerging disease-modifying therapies for the treatment of motor neuron disease/amyotropic lateral sclerosis. Expert Opin Emerg Drugs. 2007 May;12(2):229-52. |
|---|
| REF 2 | (http://www.guidetopharmacology.org/) Nucleic Acids Res. 2015 Oct 12. pii: gkv1037. The IUPHAR/BPS Guide to PHARMACOLOGY in 2016: towards curated quantitative interactions between 1300 protein targets and 6000 ligands. (Ligand id: 8480). |
|---|
