| Drug General Information |
| Drug ID |
D08CJK
|
| Former ID |
DNC011705
|
| Drug Name |
TRYPTAMINE
|
| Drug Type |
Small molecular drug
|
| Indication |
Discovery agent
|
Phase 3 |
[1],
[2]
|
|---|
| Structure |
|
Download
2D MOL
3D MOL
|
| Formula |
C10H12N2
|
| InChI |
InChI=1S/C10H12N2/c11-6-5-8-7-12-10-4-2-1-3-9(8)10/h1-4,7,12H,5-6,11H2
|
| InChIKey |
APJYDQYYACXCRM-UHFFFAOYSA-N
|
| PubChem Compound ID |
|
| PubChem Substance ID |
3688, 627609, 841457, 3137852, 7709293, 8144910, 8150070, 8151004, 10529894, 11109978, 11109979, 11109980, 11109984, 11110664, 11336037, 11361276, 11362807, 11365369, 11367931, 11373000, 11374597, 11376093, 11462248, 11484681, 11488689, 11491705, 11492665, 11493847, 11532548, 11537824, 14719299, 14891690, 16964790, 24439500, 24851608, 26612546, 26679319, 26716180, 26737137, 26748861, 26748862, 26753741, 37457994, 47365250, 47440318, 47959807, 48035188, 48185049, 49748640, 49748641
|
| Target and Pathway |
| Target(s) |
Amine oxidase [flavin-containing] B |
Target Info |
Inhibitor |
[3]
|
|---|
| 5-hydroxytryptamine 2A receptor |
Target Info |
Inhibitor |
[4]
|
| Amine oxidase [flavin-containing] A |
Target Info |
Inhibitor |
[3]
|
|
BioCyc Pathway
|
Superpathway of tryptophan utilization
|
|
Tryptophan degradation via tryptamine
|
|
Dopamine degradation
|
|
Putrescine degradation III
|
|
Noradrenaline and adrenaline degradationPWY66-401:Superpathway of tryptophan utilization
|
|
Noradrenaline and adrenaline degradation
|
|
Serotonin degradation
|
|
Superpathway of melatonin degradation
|
|
Melatonin degradation II
|
|
KEGG Pathway
|
Glycine, serine and threonine metabolism
|
|
Arginine and proline metabolism
|
|
Histidine metabolism
|
|
Tyrosine metabolism
|
|
Phenylalanine metabolism
|
|
Tryptophan metabolism
|
|
Drug metabolism - cytochrome P450
|
|
Metabolic pathways
|
|
Serotonergic synapse
|
|
Dopaminergic synapse
|
|
Cocaine addiction
|
|
Amphetamine addiction
|
|
Alcoholismhsa04020:Calcium signaling pathway
|
|
Neuroactive ligand-receptor interaction
|
|
Gap junction
|
|
Inflammatory mediator regulation of TRP channelshsa00260:Glycine, serine and threonine metabolism
|
|
Alcoholism
|
|
NetPath Pathway
|
IL4 Signaling Pathway
|
|
PANTHER Pathway
|
Adrenaline and noradrenaline biosynthesis
|
|
5-Hydroxytryptamine degredation
|
|
Dopamine receptor mediated signaling pathwayP04374:5HT2 type receptor mediated signaling pathwayP00001:Adrenaline and noradrenaline biosynthesis
|
|
Dopamine receptor mediated signaling pathway
|
|
Pathway Interaction Database
|
Alpha-synuclein signaling
|
|
PathWhiz Pathway
|
Histidine Metabolism
|
|
Tyrosine Metabolism
|
|
Glycine and Serine Metabolism
|
|
Reactome
|
Serotonin receptors
|
|
G alpha (q) signalling eventsR-HSA-181430:Norepinephrine Neurotransmitter Release Cycle
|
|
WikiPathways
|
Tryptophan metabolism
|
|
Dopamine metabolism
|
|
Phase 1 - Functionalization of compoundsWP733:Serotonin Receptor 2 and STAT3 Signaling
|
|
Serotonin Receptor 2 and ELK-SRF/GATA4 signaling
|
|
SIDS Susceptibility Pathways
|
|
Monoamine GPCRs
|
|
GPCRs, Class A Rhodopsin-like
|
|
Gastrin-CREB signalling pathway via PKC and MAPK
|
|
GPCR ligand binding
|
|
GPCR downstream signaling
|
|
GPCRs, OtherWP706:SIDS Susceptibility Pathways
|
|
Biogenic Amine Synthesis
|
|
Oxidative Stress
|
|
Phase 1 - Functionalization of compounds
|
|
Neurotransmitter Release Cycle
|
|
Neurotransmitter Clearance In The Synaptic Cleft
|
|
Serotonin Transporter Activity
|
| References |
| REF 1 | ClinicalTrials.gov (NCT00227136) Effect of Oral 5-HTP Intake on Urinary 5-HIAA Excretion. U.S. National Institutes of Health. |
|---|
| REF 2 | (http://www.guidetopharmacology.org/) Nucleic Acids Res. 2015 Oct 12. pii: gkv1037. The IUPHAR/BPS Guide to PHARMACOLOGY in 2016: towards curated quantitative interactions between 1300 protein targets and 6000 ligands. (Ligand id: 125). |
|---|
| REF 3 | Bioorg Med Chem Lett. 2004 Feb 23;14(4):999-1002.Binding of beta-carbolines at imidazoline I2 receptors: a structure-affinity investigation. |
|---|
| REF 4 | J Med Chem. 1987 Jan;30(1):1-12.Central serotonin receptors as targets for drug research. |
|---|
