| Drug General Information |
| Drug ID |
D08BCF
|
| Former ID |
DNC003554
|
| Drug Name |
QUIPAZINE
|
| Drug Type |
Small molecular drug
|
| Indication |
Discovery agent
|
Investigative |
[1]
|
|---|
| Structure |
|
Download
2D MOL
3D MOL
|
| Formula |
C13H15N3
|
| InChI |
InChI=1S/C13H15N3/c1-2-4-12-11(3-1)5-6-13(15-12)16-9-7-14-8-10-16/h1-6,14H,7-10H2
|
| InChIKey |
XRXDAJYKGWNHTQ-UHFFFAOYSA-N
|
| CAS Number |
CAS 4774-24-7
|
| PubChem Compound ID |
|
| PubChem Substance ID |
3944551, 5198891, 8153084, 11111709, 11111710, 11113608, 11336086, 11361325, 11364627, 11367189, 11369751, 11373066, 11374956, 11377913, 11462297, 11466645, 11467765, 11484959, 11486509, 11488998, 11491639, 11493073, 11495547, 15195795, 26751806, 29224083, 47291201, 47365258, 47365259, 47365260, 47440334, 47662348, 48110510, 48110511, 48185060, 48259305, 49698965, 50043052, 50104499, 50760391, 56242155, 57322565, 81053885, 81100224, 85209659, 85788303, 85789362, 85789752, 87363377, 99300411
|
| Target and Pathway |
| Target(s) |
5-hydroxytryptamine 1D receptor |
Target Info |
Inhibitor |
[2]
|
|---|
| 5-hydroxy-tryptamine 3B receptor |
Target Info |
Inhibitor |
[3]
|
| Sodium-dependent serotonin transporter |
Target Info |
Inhibitor |
[4]
|
| 5-hydroxytryptamine 2A receptor |
Target Info |
Inhibitor |
[5]
|
| 5-hydroxytryptamine 1A receptor |
Target Info |
Inhibitor |
[5]
|
| 5-hydroxytryptamine 6 receptor |
Target Info |
Inhibitor |
[6]
|
| 5-hydroxytryptamine receptor 3A |
Target Info |
Inhibitor |
[5]
|
|
KEGG Pathway
|
cAMP signaling pathway
|
|
Neuroactive ligand-receptor interaction
|
|
Serotonergic synapsehsa04726:Serotonergic synapsehsa04726:Serotonergic synapsehsa04020:Calcium signaling pathway
|
|
Gap junction
|
|
Serotonergic synapse
|
|
Inflammatory mediator regulation of TRP channelshsa04024:cAMP signaling pathway
|
|
Serotonergic synapsehsa04020:Calcium signaling pathway
|
|
Serotonergic synapsehsa04726:Serotonergic synapse
|
|
NetPath Pathway
|
TCR Signaling PathwayNetPath_14:IL2 Signaling Pathway
|
|
PANTHER Pathway
|
Heterotrimeric G-protein signaling pathway-Gi alpha and Gs alpha mediated pathway
|
|
5HT1 type receptor mediated signaling pathwayP04375:5HT3 type receptor mediated signaling pathwayP04373:5HT1 type receptor mediated signaling pathway
|
|
5HT2 type receptor mediated signaling pathway
|
|
5HT3 type receptor mediated signaling pathway
|
|
5HT4 type receptor mediated signaling pathwayP04374:5HT2 type receptor mediated signaling pathwayP00026:Heterotrimeric G-protein signaling pathway-Gi alpha and Gs alpha mediated pathway
|
|
5HT1 type receptor mediated signaling pathwayP00026:Heterotrimeric G-protein signaling pathway-Gi alpha and Gs alpha mediated pathwayP04375:5HT3 type receptor mediated signaling pathway
|
|
PathWhiz Pathway
|
Excitatory Neural Signalling Through 5-HTR 6 and Serotonin
|
|
Reactome
|
Serotonin receptors
|
|
G alpha (i) signalling eventsR-HSA-975298:Ligand-gated ion channel transportR-HSA-390666:Serotonin receptors
|
|
G alpha (q) signalling eventsR-HSA-390666:Serotonin receptors
|
|
G alpha (i) signalling eventsR-HSA-390666:Serotonin receptors
|
|
G alpha (s) signalling eventsR-HSA-975298:Ligand-gated ion channel transport
|
|
WikiPathways
|
Serotonin HTR1 Group and FOS Pathway
|
|
Monoamine GPCRs
|
|
GPCRs, Class A Rhodopsin-like
|
|
GPCR ligand binding
|
|
GPCR downstream signalingWP2670:Iron uptake and transportWP727:Monoamine Transport
|
|
SIDS Susceptibility Pathways
|
|
NRF2 pathway
|
|
Synaptic Vesicle Pathway
|
|
Serotonin Transporter ActivityWP733:Serotonin Receptor 2 and STAT3 Signaling
|
|
Serotonin Receptor 2 and ELK-SRF/GATA4 signaling
|
|
Gastrin-CREB signalling pathway via PKC and MAPK
|
|
GPCR downstream signaling
|
|
GPCRs, OtherWP722:Serotonin HTR1 Group and FOS Pathway
|
|
GPCR downstream signalingWP734:Serotonin Receptor 4/6/7 and NR3C Signaling
|
|
GPCR downstream signalingWP706:SIDS Susceptibility Pathways
|
|
Iron uptake and transport
|
| References |
| REF 1 | (http://www.guidetopharmacology.org/) Nucleic Acids Res. 2015 Oct 12. pii: gkv1037. The IUPHAR/BPS Guide to PHARMACOLOGY in 2016: towards curated quantitative interactions between 1300 protein targets and 6000 ligands. (Ligand id: 173). |
|---|
| REF 2 | J Med Chem. 1986 Nov;29(11):2375-80.5-HT1 and 5-HT2 binding characteristics of some quipazine analogues. |
|---|
| REF 3 | J Med Chem. 1999 May 6;42(9):1556-75.Novel potent and selective central 5-HT3 receptor ligands provided with different intrinsic efficacy. 2. Molecular basis of the intrinsic efficacy of arylpiperazine derivatives at the central 5-HT3 receptors. |
|---|
| REF 4 | Bioorg Med Chem Lett. 2000 Jul 17;10(14):1559-62.Syntheses and binding affinities of 6-nitroquipazine analogues for serotonin transporter. Part 1. |
|---|
| REF 5 | J Med Chem. 2009 Nov 12;52(21):6946-50.Novel, potent, and selective quinoxaline-based 5-HT(3) receptor ligands. 1. Further structure-activity relationships and pharmacological characterization. |
|---|
| REF 6 | J Med Chem. 2003 Jul 3;46(14):2795-812.Higher-end serotonin receptors: 5-HT(5), 5-HT(6), and 5-HT(7). |
|---|
