| Drug General Information |
| Drug ID |
D06WUE
|
| Former ID |
DNC010972
|
| Drug Name |
2,5-dichloro-N-p-tolylthiophene-3-sulfonamide
|
| Drug Type |
Small molecular drug
|
| Indication |
Discovery agent
|
Investigative |
[1]
|
|---|
| Structure |
|
Download
2D MOL
3D MOL
|
| Formula |
C11H9Cl2NO2S2
|
| Canonical SMILES |
CC1=CC=C(C=C1)NS(=O)(=O)C2=C(SC(=C2)Cl)Cl
|
| InChI |
1S/C11H9Cl2NO2S2/c1-7-2-4-8(5-3-7)14-18(15,16)9-6-10(12)17-11(9)13/h2-6,14H,1H3
|
| InChIKey |
OQWXAWNHXDPWGS-UHFFFAOYSA-N
|
| PubChem Compound ID |
|
| Target and Pathway |
| Target(s) |
Cyclin-A2 |
Target Info |
Inhibitor |
[1]
|
|---|
| Cell division protein kinase 7 |
Target Info |
Inhibitor |
[1]
|
| Cyclin-dependent protein kinase Pfmrk |
Target Info |
Inhibitor |
[1]
|
|
KEGG Pathway
|
DNA replication
|
|
Base excision repair
|
|
Nucleotide excision repair
|
|
Mismatch repair
|
|
Cell cycle
|
|
Hepatitis B
|
|
HTLV-I infectionhsa03022:Basal transcription factors
|
|
NetPath Pathway
|
TCR Signaling Pathway
|
|
RANKL Signaling Pathway
|
|
Pathway Interaction Database
|
Retinoic acid receptors-mediated signaling
|
|
PathWhiz Pathway
|
Nucleotide Excision Repair
|
|
Reactome
|
E2F mediated regulation of DNA replication
|
|
G0 and Early G1
|
|
Cdc20:Phospho-APC/C mediated degradation of Cyclin A
|
|
Regulation of APC/C activators between G1/S and early anaphase
|
|
SCF(Skp2)-mediated degradation of p27/p21
|
|
Senescence-Associated Secretory Phenotype (SASP)
|
|
Mismatch repair (MMR) directed by MSH2:MSH6 (MutSalpha)
|
|
Mismatch repair (MMR) directed by MSH2:MSH3 (MutSbeta)
|
|
HDR through Homologous Recombination (HRR)
|
|
Processing of DNA double-strand break ends
|
|
Dual Incision in GG-NER
|
|
Dual incision in TC-NER
|
|
Gap-filling DNA repair synthesis and ligation in TC-NER
|
|
G2 Phase
|
|
Orc1 removal from chromatin
|
|
G1/S-Specific Transcription
|
|
Cyclin A/B1 associated events during G2/M transition
|
|
Cyclin A:Cdk2-associated events at S phase entryR-HSA-427413:NoRC negatively regulates rRNA expression
|
|
Formation of TC-NER Pre-Incision Complex
|
|
Cyclin E associated events during G1/S transition
|
|
Cyclin D associated events in G1
|
|
Cyclin A:Cdk2-associated events at S phase entry
|
|
RNA Polymerase I Transcription Initiation
|
|
WikiPathways
|
Senescence and Autophagy in Cancer
|
|
Mismatch repair
|
|
DNA Replication
|
|
G1 to S cell cycle control
|
|
EGF/EGFR Signaling Pathway
|
|
S Phase
|
|
Nifedipine Activity
|
|
Primary Focal Segmental Glomerulosclerosis FSGS
|
|
Retinoblastoma (RB) in Cancer
|
|
Integrated Pancreatic Cancer Pathway
|
|
Nucleotide Excision Repair
|
|
Telomere Maintenance
|
|
Synthesis of DNA
|
|
Mitotic G1-G1/S phases
|
|
Cell Cycle
|
|
Base Excision RepairWP45:G1 to S cell cycle control
|
|
Eukaryotic Transcription Initiation
|
|
Cardiac Hypertrophic Response
|
|
HIV Life Cycle
|
|
Integrated Breast Cancer Pathway
|
|
RNA Polymerase II Transcription
|
|
RNA Polymerase I, RNA Polymerase III, and Mitochondrial Transcription
|
|
mRNA Capping
|
|
Mitotic G2-G2/M phases
|
|
MicroRNAs in cardiomyocyte hypertrophy
|
| References |
| REF 1 | Activity of substituted thiophene sulfonamides against malarial and mammalian cyclin dependent protein kinases, Bioorg. Med. Chem. Lett. 20(13):3863-3867 (2010). |
|---|
