| Drug General Information |
| Drug ID |
D06VPR
|
| Former ID |
DNC005611
|
| Drug Name |
WAY-466
|
| Drug Type |
Small molecular drug
|
| Indication |
Discovery agent
|
Investigative |
[1]
|
|---|
| Structure |
|
Download
2D MOL
3D MOL
|
| Formula |
C19H20IN3O2S
|
| Canonical SMILES |
C1CC(NC1)CC2=CNC3=C2C=C(C=C3)NS(=O)(=O)C4=CC=CC=C4I
|
| InChI |
1S/C19H20IN3O2S/c20-17-5-1-2-6-19(17)26(24,25)23-15-7-8-18-16(11-15)13(12-22-18)10-14-4-3-9-21-14/h1-2,5-8,11-12,14,21-23H,3-4,9-10H2/t14-/m1/s1
|
| InChIKey |
ZLTKHJVPOSETMR-CQSZACIVSA-N
|
| PubChem Compound ID |
|
| Target and Pathway |
| Target(s) |
5-hydroxytryptamine 1F receptor |
Target Info |
Inhibitor |
[1]
|
|---|
| 5-hydroxytryptamine 1B receptor |
Target Info |
Inhibitor |
[1]
|
| 5-hydroxytryptamine 2C receptor |
Target Info |
Inhibitor |
[1]
|
| 5-hydroxytryptamine 7 receptor |
Target Info |
Inhibitor |
[1]
|
| 5-hydroxytryptamine 1A receptor |
Target Info |
Inhibitor |
[1]
|
| 5-hydroxytryptamine 6 receptor |
Target Info |
Inhibitor |
[1]
|
| 5-hydroxytryptamine 1D receptor |
Target Info |
Inhibitor |
[1]
|
|
KEGG Pathway
|
cAMP signaling pathway
|
|
Neuroactive ligand-receptor interaction
|
|
Serotonergic synapsehsa04024:cAMP signaling pathway
|
|
Serotonergic synapsehsa04020:Calcium signaling pathway
|
|
Gap junction
|
|
Serotonergic synapse
|
|
Inflammatory mediator regulation of TRP channelshsa04014:Ras signaling pathway
|
|
Calcium signaling pathway
|
|
PANTHER Pathway
|
Heterotrimeric G-protein signaling pathway-Gi alpha and Gs alpha mediated pathway
|
|
5HT1 type receptor mediated signaling pathwayP00026:Heterotrimeric G-protein signaling pathway-Gi alpha and Gs alpha mediated pathway
|
|
5HT1 type receptor mediated signaling pathwayP04374:5HT2 type receptor mediated signaling pathwayP00026:Heterotrimeric G-protein signaling pathway-Gi alpha and Gs alpha mediated pathwayP00026:Heterotrimeric G-protein signaling pathway-Gi alpha and Gs alpha mediated pathway
|
|
5HT1 type receptor mediated signaling pathwayP00026:Heterotrimeric G-protein signaling pathway-Gi alpha and Gs alpha mediated pathwayP00026:Heterotrimeric G-protein signaling pathway-Gi alpha and Gs alpha mediated pathway
|
|
5HT1 type receptor mediated signaling pathway
|
|
PathWhiz Pathway
|
Excitatory Neural Signalling Through 5-HTR 7 and SerotoninPW000444:Excitatory Neural Signalling Through 5-HTR 6 and Serotonin
|
|
Reactome
|
Serotonin receptors
|
|
G alpha (i) signalling eventsR-HSA-390666:Serotonin receptors
|
|
G alpha (q) signalling eventsR-HSA-390666:Serotonin receptors
|
|
G alpha (s) signalling eventsR-HSA-390666:Serotonin receptors
|
|
G alpha (i) signalling events
|
|
WikiPathways
|
Serotonin HTR1 Group and FOS Pathway
|
|
Monoamine GPCRs
|
|
GPCRs, Class A Rhodopsin-like
|
|
GPCR ligand binding
|
|
GPCR downstream signaling
|
|
GPCRs, OtherWP722:Serotonin HTR1 Group and FOS Pathway
|
|
GPCR downstream signalingWP732:Serotonin Receptor 2 and ELK-SRF/GATA4 signaling
|
|
Gastrin-CREB signalling pathway via PKC and MAPK
|
|
GPCR downstream signalingWP734:Serotonin Receptor 4/6/7 and NR3C Signaling
|
|
SIDS Susceptibility Pathways
|
|
GPCR downstream signalingWP722:Serotonin HTR1 Group and FOS Pathway
|
| References |
| REF 1 | J Med Chem. 2005 Jan 27;48(2):353-6.Discovery of 5-arylsulfonamido-3-(pyrrolidin-2-ylmethyl)-1H-indole derivatives as potent, selective 5-HT6 receptor agonists and antagonists. |
|---|
