| Drug General Information |
| Drug ID |
D06UUK
|
| Former ID |
DNC002459
|
| Drug Name |
Gamma-Carboxy-Glutamic Acid
|
| Drug Type |
Small molecular drug
|
| Indication |
Discovery agent
|
Investigative |
[1]
|
|---|
| Structure |
|
Download
2D MOL
3D MOL
|
| Formula |
C6H9NO6
|
| Canonical SMILES |
C(C(C(=O)O)C(=O)O)C(C(=O)O)N
|
| InChI |
1S/C6H9NO6/c7-3(6(12)13)1-2(4(8)9)5(10)11/h2-3H,1,7H2,(H,8,9)(H,10,11)(H,12,13)/t3-/m0/s1
|
| InChIKey |
UHBYWPGGCSDKFX-VKHMYHEASA-N
|
| PubChem Compound ID |
|
| PubChem Substance ID |
10233524, 24892669, 44434258, 46505246, 49758860, 50242417, 91691039, 103216326, 103821964, 103969303, 104372528, 117542828, 119502975, 121269864, 129367461, 135060893, 137129398, 160966927, 162549768, 179685286, 184531848, 198974326, 224952515, 226424522, 241094032, 252499985
|
| Target and Pathway |
| Target(s) |
Coagulation factor IIa |
Target Info |
Inhibitor |
[1]
|
|---|
| Coagulation factor IX |
Target Info |
Inhibitor |
[1]
|
| Coagulation factor Xa |
Target Info |
Inhibitor |
[1]
|
|
KEGG Pathway
|
Neuroactive ligand-receptor interaction
|
|
Complement and coagulation cascades
|
|
Regulation of actin cytoskeletonhsa04610:Complement and coagulation cascadeshsa04610:Complement and coagulation cascades
|
|
NetPath Pathway
|
TCR Signaling Pathway
|
|
PANTHER Pathway
|
Blood coagulationP00011:Blood coagulationP00011:Blood coagulation
|
|
Pathway Interaction Database
|
Thrombin/protease-activated receptor (PAR) pathway
|
|
Angiopoietin receptor Tie2-mediated signaling
|
|
FOXA2 and FOXA3 transcription factor networks
|
|
PAR4-mediated thrombin signaling events
|
|
Syndecan-4-mediated signaling events
|
|
PAR1-mediated thrombin signaling eventsintegrin2_pathway:Beta2 integrin cell surface interactions
|
|
PathWhiz Pathway
|
Vitamin K Metabolism
|
|
CoagulationPW000562:CoagulationPW000562:Coagulation
|
|
Reactome
|
Intrinsic Pathway of Fibrin Clot Formation
|
|
Common Pathway of Fibrin Clot Formation
|
|
Gamma-carboxylation of protein precursors
|
|
Transport of gamma-carboxylated protein precursors from the endoplasmic reticulum to the Golgi apparatus
|
|
Removal of aminoterminal propeptides from gamma-carboxylated proteins
|
|
Cell surface interactions at the vascular wall
|
|
Peptide ligand-binding receptors
|
|
Regulation of Insulin-like Growth Factor (IGF) transport and uptake by Insulin-like Growth Factor Binding Proteins (IGFBPs)
|
|
G alpha (q) signalling events
|
|
Thrombin signalling through proteinase activated receptors (PARs)R-HSA-140834:Extrinsic Pathway of Fibrin Clot Formation
|
|
Removal of aminoterminal propeptides from gamma-carboxylated proteinsR-HSA-140834:Extrinsic Pathway of Fibrin Clot Formation
|
|
WikiPathways
|
Complement and Coagulation Cascades
|
|
Regulation of Actin Cytoskeleton
|
|
IL1 and megakaryotyces in obesity
|
|
Regulation of Insulin-like Growth Factor (IGF) Transport and Uptake by Insulin-like Growth Factor Binding Proteins (IGFBPs)
|
|
PTM: gamma carboxylation, hypusine formation and arylsulfatase activation
|
|
Blood Clotting Cascade
|
|
Gastrin-CREB signalling pathway via PKC and MAPK
|
|
Thrombin signalling through proteinase activated receptors (PARs)
|
|
Platelet Aggregation (Plug Formation)
|
|
GPCR ligand binding
|
|
GPCR downstream signaling
|
|
Formation of Fibrin Clot (Clotting Cascade)
|
|
Cell surface interactions at the vascular wall
|
|
Folate Metabolism
|
|
Vitamin B12 Metabolism
|
|
Selenium Micronutrient NetworkWP558:Complement and Coagulation Cascades
|
|
Formation of Fibrin Clot (Clotting Cascade)WP558:Complement and Coagulation Cascades
|
|
Human Complement System
|
| References |
| REF 1 | How many drug targets are there? Nat Rev Drug Discov. 2006 Dec;5(12):993-6. |
|---|
