| Drug General Information |
| Drug ID |
D02XPB
|
| Former ID |
DNC004926
|
| Drug Name |
4-(4-Benzyloxy-3-methoxy-benzylamino)-benzamidine
|
| Drug Type |
Small molecular drug
|
| Indication |
Discovery agent
|
Investigative |
[1]
|
|---|
| Structure |
|
Download
2D MOL
3D MOL
|
| Formula |
C22H23N3O2
|
| Canonical SMILES |
COC1=C(C=CC(=C1)CNC2=CC=C(C=C2)C(=N)N)OCC3=CC=CC=C3
|
| InChI |
1S/C22H23N3O2/c1-26-21-13-17(14-25-19-10-8-18(9-11-19)22(23)24)7-12-20(21)27-15-16-5-3-2-4-6-16/h2-13,25H,14-15H2,1H3,(H3,23,24)
|
| InChIKey |
YPLDWUAEABIXKN-UHFFFAOYSA-N
|
| PubChem Compound ID |
|
| Target and Pathway |
| Target(s) |
Trypsin |
Target Info |
Inhibitor |
[1]
|
|---|
| Coagulation factor IIa |
Target Info |
Inhibitor |
[1]
|
| Coagulation factor Xa |
Target Info |
Inhibitor |
[1]
|
| Coagulation factor VII |
Target Info |
Inhibitor |
[1]
|
|
KEGG Pathway
|
Neuroactive ligand-receptor interaction
|
|
Pancreatic secretion
|
|
Protein digestion and absorption
|
|
Influenza Ahsa04080:Neuroactive ligand-receptor interaction
|
|
Complement and coagulation cascades
|
|
Regulation of actin cytoskeletonhsa04610:Complement and coagulation cascadeshsa04610:Complement and coagulation cascades
|
|
NetPath Pathway
|
TCR Signaling Pathway
|
|
PANTHER Pathway
|
Blood coagulationP00011:Blood coagulationP00005:Angiogenesis
|
|
Blood coagulation
|
|
Pathway Interaction Database
|
Thrombin/protease-activated receptor (PAR) pathway
|
|
Angiopoietin receptor Tie2-mediated signaling
|
|
FOXA2 and FOXA3 transcription factor networks
|
|
PAR4-mediated thrombin signaling events
|
|
Syndecan-4-mediated signaling events
|
|
PAR1-mediated thrombin signaling eventsintegrin2_pathway:Beta2 integrin cell surface interactions
|
|
PathWhiz Pathway
|
Vitamin K Metabolism
|
|
CoagulationPW000562:CoagulationPW000562:Coagulation
|
|
Reactome
|
Activation of Matrix Metalloproteinases
|
|
Cobalamin (Cbl, vitamin B12) transport and metabolismR-HSA-140837:Intrinsic Pathway of Fibrin Clot Formation
|
|
Common Pathway of Fibrin Clot Formation
|
|
Gamma-carboxylation of protein precursors
|
|
Transport of gamma-carboxylated protein precursors from the endoplasmic reticulum to the Golgi apparatus
|
|
Removal of aminoterminal propeptides from gamma-carboxylated proteins
|
|
Cell surface interactions at the vascular wall
|
|
Peptide ligand-binding receptors
|
|
Regulation of Insulin-like Growth Factor (IGF) transport and uptake by Insulin-like Growth Factor Binding Proteins (IGFBPs)
|
|
G alpha (q) signalling events
|
|
Thrombin signalling through proteinase activated receptors (PARs)R-HSA-140834:Extrinsic Pathway of Fibrin Clot Formation
|
|
Intrinsic Pathway of Fibrin Clot Formation
|
|
Removal of aminoterminal propeptides from gamma-carboxylated proteinsR-HSA-1368108:BMAL1:CLOCK,NPAS2 activates circadian gene expression
|
|
Extrinsic Pathway of Fibrin Clot Formation
|
|
WikiPathways
|
Activation of Matrix MetalloproteinasesWP558:Complement and Coagulation Cascades
|
|
Regulation of Actin Cytoskeleton
|
|
IL1 and megakaryotyces in obesity
|
|
Regulation of Insulin-like Growth Factor (IGF) Transport and Uptake by Insulin-like Growth Factor Binding Proteins (IGFBPs)
|
|
PTM: gamma carboxylation, hypusine formation and arylsulfatase activation
|
|
Blood Clotting Cascade
|
|
Gastrin-CREB signalling pathway via PKC and MAPK
|
|
Thrombin signalling through proteinase activated receptors (PARs)
|
|
Platelet Aggregation (Plug Formation)
|
|
GPCR ligand binding
|
|
GPCR downstream signaling
|
|
Formation of Fibrin Clot (Clotting Cascade)
|
|
Cell surface interactions at the vascular wall
|
|
Folate Metabolism
|
|
Vitamin B12 Metabolism
|
|
Selenium Micronutrient NetworkWP558:Complement and Coagulation Cascades
|
|
Human Complement System
|
|
Formation of Fibrin Clot (Clotting Cascade)WP558:Complement and Coagulation Cascades
|
|
Circadian Clock
|
|
Selenium Micronutrient Network
|
| References |
| REF 1 | Bioorg Med Chem Lett. 2005 Feb 1;15(3):817-22.Design of selective phenylglycine amide tissue factor/factor VIIa inhibitors. |
|---|
