| Drug General Information |
| Drug ID |
D02OOL
|
| Former ID |
DIB019814
|
| Drug Name |
EMDT
|
| Drug Type |
Small molecular drug
|
| Indication |
Discovery agent
|
Investigative |
[1]
|
|---|
| Structure |
|
Download
2D MOL
|
| Formula |
C15H22N2O
|
| InChI |
InChI=1S/C15H22N2O/c1-5-14-12(8-9-17(2)3)13-10-11(18-4)6-7-15(13)16-14/h6-7,10,16H,5,8-9H2,1-4H3
|
| InChIKey |
ZEYRDXUWJDGTLD-UHFFFAOYSA-N
|
| PubChem Compound ID |
|
| PubChem Substance ID |
15196611, 23950832, 43529883, 47583774, 48029700, 80394596, 85301150, 99381476, 103165506, 114788091, 129892993, 134345310, 135650228, 137174577, 140775885, 144240229, 162221564, 228639384
|
| Target and Pathway |
| Target(s) |
5-hydroxytryptamine 1D receptor |
Target Info |
Agonist |
[2]
|
|---|
| 5-hydroxytryptamine 1A receptor |
Target Info |
Agonist |
[2]
|
| 5-hydroxytryptamine 6 receptor |
Target Info |
Agonist |
[2]
|
| 5-hydroxytryptamine 7 receptor |
Target Info |
Agonist |
[2]
|
| 5-hydroxytryptamine 5A receptor |
Target Info |
Agonist |
[2]
|
| 5-hydroxytryptamine 1E receptor |
Target Info |
Agonist |
[2]
|
|
KEGG Pathway
|
cAMP signaling pathway
|
|
Neuroactive ligand-receptor interaction
|
|
Serotonergic synapsehsa04024:cAMP signaling pathway
|
|
Serotonergic synapsehsa04020:Calcium signaling pathway
|
|
Serotonergic synapsehsa04014:Ras signaling pathway
|
|
Calcium signaling pathway
|
|
Serotonergic synapse
|
|
PANTHER Pathway
|
Heterotrimeric G-protein signaling pathway-Gi alpha and Gs alpha mediated pathway
|
|
5HT1 type receptor mediated signaling pathwayP00026:Heterotrimeric G-protein signaling pathway-Gi alpha and Gs alpha mediated pathway
|
|
5HT1 type receptor mediated signaling pathwayP00026:Heterotrimeric G-protein signaling pathway-Gi alpha and Gs alpha mediated pathwayP00026:Heterotrimeric G-protein signaling pathway-Gi alpha and Gs alpha mediated pathwayP00026:Heterotrimeric G-protein signaling pathway-Gi alpha and Gs alpha mediated pathwayP00026:Heterotrimeric G-protein signaling pathway-Gi alpha and Gs alpha mediated pathway
|
|
5HT1 type receptor mediated signaling pathway
|
|
PathWhiz Pathway
|
Excitatory Neural Signalling Through 5-HTR 6 and SerotoninPW000443:Excitatory Neural Signalling Through 5-HTR 7 and Serotonin
|
|
Reactome
|
Serotonin receptors
|
|
G alpha (i) signalling eventsR-HSA-390666:Serotonin receptors
|
|
G alpha (s) signalling eventsR-HSA-390666:Serotonin receptors
|
|
G alpha (i) signalling events
|
|
WikiPathways
|
Serotonin HTR1 Group and FOS Pathway
|
|
Monoamine GPCRs
|
|
GPCRs, Class A Rhodopsin-like
|
|
GPCR ligand binding
|
|
GPCR downstream signalingWP722:Serotonin HTR1 Group and FOS Pathway
|
|
SIDS Susceptibility Pathways
|
|
GPCR downstream signalingWP734:Serotonin Receptor 4/6/7 and NR3C Signaling
|
|
GPCR downstream signaling
|
|
GPCRs, OtherWP58:Monoamine GPCRs
|
| References |
| REF 1 | (http://www.guidetopharmacology.org/) Nucleic Acids Res. 2015 Oct 12. pii: gkv1037. The IUPHAR/BPS Guide to PHARMACOLOGY in 2016: towards curated quantitative interactions between 1300 protein targets and 6000 ligands. (Ligand id: 12). |
|---|
| REF 2 | 2-Substituted tryptamines: agents with selectivity for 5-HT(6) serotonin receptors. J Med Chem. 2000 Mar 9;43(5):1011-8. |
|---|
