| Drug General Information |
| Drug ID |
D06OAH
|
| Former ID |
DNC007554
|
| Drug Name |
6-bromoindirubin-3-oxime
|
| Drug Type |
Small molecular drug
|
| Indication |
Discovery agent
|
Investigative |
[1]
|
|---|
| Structure |
|
Download
2D MOL
3D MOL
|
| Formula |
C16H10BrN3O2
|
| InChI |
InChI=1S/C16H10BrN3O2/c17-8-5-6-9-12(7-8)19-16(21)13(9)15-14(20-22)10-3-1-2-4-11(10)18-15/h1-7,20,22H,(H,19,21)/b15-13-
|
| InChIKey |
WNWSUJQVZJJGLF-SQFISAMPSA-N
|
| PubChem Compound ID |
|
| PubChem Substance ID |
833555, 7886348, 14747233, 15002478, 24724412, 26753605, 26753606, 26758803, 26758805, 29215160, 39320384, 46393346, 46507596, 48244433, 48431446, 56339573, 57359194, 57550078, 76874466, 85752750, 85756489, 90341740, 91148008, 99302717, 103029097, 103566428, 104074524, 104092357, 113870608, 121361652, 121560411, 123103467, 123220362, 124659179, 134344759, 135698600, 141713899, 141713900, 141713902, 141713903, 141713904, 160966566, 163338681, 163564727, 163688038, 163688040, 172089031, 172916913, 174520444, 175607663
|
| Target and Pathway |
| Target(s) |
mRNA of Aurora B |
Target Info |
Inhibitor |
[2]
|
|---|
| Aurora kinase A |
Target Info |
Inhibitor |
[2]
|
| Aurora protein kinase |
Target Info |
Inhibitor |
[2]
|
|
KEGG Pathway
|
Oocyte meiosishsa04114:Oocyte meiosis
|
|
Pathway Interaction Database
|
Aurora B signaling
|
|
Signaling by Aurora kinases
|
|
Aurora C signaling
|
|
FOXM1 transcription factor network
|
|
Aurora A signalingaurora_b_pathway:Aurora B signaling
|
|
Integrin-linked kinase signaling
|
|
PLK1 signaling events
|
|
Aurora A signaling
|
|
Reactome
|
APC/C:Cdh1 mediated degradation of Cdc20 and other APC/C:Cdh1 targeted proteins in late mitosis/early G1
|
|
Separation of Sister Chromatids
|
|
Resolution of Sister Chromatid Cohesion
|
|
RHO GTPases Activate Formins
|
|
Mitotic PrometaphaseR-HSA-174178:APC/C:Cdh1 mediated degradation of Cdc20 and other APC/C:Cdh1 targeted proteins in late mitosis/early G1
|
|
Regulation of PLK1 Activity at G2/M TransitionR-HSA-174178:APC/C:Cdh1 mediated degradation of Cdc20 and other APC/C:Cdh1 targeted proteins in late mitosis/early G1
|
|
WikiPathways
|
Mitotic Metaphase and Anaphase
|
|
Mitotic Prometaphase
|
|
Regulation of Microtubule Cytoskeleton
|
|
miR-targeted genes in lymphocytes - TarBase
|
|
miR-targeted genes in epithelium - TarBase
|
|
APC/C-mediated degradation of cell cycle proteinsWP437:EGF/EGFR Signaling Pathway
|
|
JAK/STAT
|
|
Gastric Cancer Network 1
|
|
Integrated Breast Cancer Pathway
|
|
APC/C-mediated degradation of cell cycle proteins
|
| References |
| REF 1 | (http://www.guidetopharmacology.org/) Nucleic Acids Res. 2015 Oct 12. pii: gkv1037. The IUPHAR/BPS Guide to PHARMACOLOGY in 2016: towards curated quantitative interactions between 1300 protein targets and 6000 ligands. (Ligand id: 5974). |
|---|
| REF 2 | J Med Chem. 2007 Aug 23;50(17):4027-37. Epub 2007 Aug 1.An integrated computational approach to the phenomenon of potent and selective inhibition of aurora kinases B and C by a series of 7-substituted indirubins. |
|---|
