| Drug General Information |
| Drug ID |
D0Y5RO
|
| Former ID |
DNC006296
|
| Drug Name |
NU-6102
|
| Drug Type |
Small molecular drug
|
| Indication |
Discovery agent
|
Investigative |
[1]
|
|---|
| Structure |
|
Download
2D MOL
3D MOL
|
| Formula |
C18H22N6O3S
|
| Canonical SMILES |
C1CCC(CC1)COC2=NC(=NC3=C2NC=N3)NC4=CC=C(C=C4)S(=O)(=O)N
|
| InChI |
1S/C18H22N6O3S/c19-28(25,26)14-8-6-13(7-9-14)22-18-23-16-15(20-11-21-16)17(24-18)27-10-12-4-2-1-3-5-12/h6-9,11-12H,1-5,10H2,(H2,19,25,26)(H2,20,21,22,23,24)
|
| InChIKey |
OWXORKPNCHJYOF-UHFFFAOYSA-N
|
| PubChem Compound ID |
|
| Target and Pathway |
| Target(s) |
Cell division protein kinase 2 |
Target Info |
Inhibitor |
[1]
|
|---|
| Serine/threonine-protein kinase Chk1 |
Target Info |
Inhibitor |
[2]
|
| mRNA of PDK-1 |
Target Info |
Inhibitor |
[2]
|
| Glycogen synthase kinase-3 beta |
Target Info |
Inhibitor |
[2]
|
| Cell division protein kinase 4 |
Target Info |
Inhibitor |
[1]
|
|
KEGG Pathway
|
FoxO signaling pathway
|
|
Cell cycle
|
|
Oocyte meiosis
|
|
p53 signaling pathway
|
|
PI3K-Akt signaling pathway
|
|
Progesterone-mediated oocyte maturation
|
|
Hepatitis B
|
|
Measles
|
|
Herpes simplex infection
|
|
Epstein-Barr virus infection
|
|
Pathways in cancer
|
|
Viral carcinogenesis
|
|
Prostate cancer
|
|
Small cell lung cancerhsa04110:Cell cycle
|
|
HTLV-I infection
|
|
Viral carcinogenesishsa03320:PPAR signaling pathway
|
|
Sphingolipid signaling pathway
|
|
mTOR signaling pathway
|
|
AMPK signaling pathway
|
|
Focal adhesion
|
|
T cell receptor signaling pathway
|
|
Fc epsilon RI signaling pathway
|
|
Neurotrophin signaling pathway
|
|
Insulin signaling pathway
|
|
Thyroid hormone signaling pathway
|
|
Aldosterone-regulated sodium reabsorption
|
|
Toxoplasmosis
|
|
Hepatitis C
|
|
Proteoglycans in cancer
|
|
Endometrial cancer
|
|
Non-small cell lung cancer
|
|
Choline metabolism in cancerhsa04012:ErbB signaling pathway
|
|
Chemokine signaling pathway
|
|
Wnt signaling pathway
|
|
Hedgehog signaling pathway
|
|
Axon guidance
|
|
Hippo signaling pathway
|
|
Signaling pathways regulating pluripotency of stem cells
|
|
B cell receptor signaling pathway
|
|
Dopaminergic synapse
|
|
Melanogenesis
|
|
Prolactin signaling pathway
|
|
Non-alcoholic fatty liver disease (NAFLD)
|
|
Alzheimer's disease
|
|
Influenza A
|
|
Colorectal cancer
|
|
Basal cell carcinomahsa04110:Cell cycle
|
|
Tight junction
|
|
Pancreatic cancer
|
|
Glioma
|
|
Melanoma
|
|
Bladder cancer
|
|
Chronic myeloid leukemia
|
|
Small cell lung cancer
|
|
NetPath Pathway
|
TCR Signaling PathwayNetPath_11:TCR Signaling Pathway
|
|
EGFR1 Signaling Pathway
|
|
RANKL Signaling Pathway
|
|
PANTHER Pathway
|
p53 pathway
|
|
p53 pathway feedback loops 2P00031:Inflammation mediated by chemokine and cytokine signaling pathway
|
|
Insulin/IGF pathway-protein kinase B signaling cascade
|
|
Interleukin signaling pathway
|
|
PDGF signaling pathway
|
|
PI3 kinase pathway
|
|
Ras Pathway
|
|
p53 pathway feedback loops 2
|
|
CCKR signaling map STP00004:Alzheimer disease-presenilin pathway
|
|
Angiogenesis
|
|
Cadherin signaling pathway
|
|
Hedgehog signaling pathway
|
|
Heterotrimeric G-protein signaling pathway-Gi alpha and Gs alpha mediated pathway
|
|
Wnt signaling pathway
|
|
CCKR signaling map ST
|
|
Pathway Interaction Database
|
Regulation of nuclear SMAD2/3 signaling
|
|
Signaling events mediated by PRL
|
|
p73 transcription factor network
|
|
E2F transcription factor network
|
|
ATR signaling pathway
|
|
mTOR signaling pathway
|
|
IL2-mediated signaling events
|
|
FoxO family signaling
|
|
FOXM1 transcription factor network
|
|
BARD1 signaling events
|
|
p53 pathway
|
|
Regulation of retinoblastoma proteinfanconi_pathway:Fanconi anemia pathway
|
|
Circadian rhythm pathway
|
|
p53 pathwaybcr_5pathway:BCR signaling pathway
|
|
Insulin Pathway
|
|
TCR signaling in naï
|
|
Signaling events mediated by Hepatocyte Growth Factor Receptor (c-Met)
|
|
TCR signaling in naï
|
|
FAS (CD95) signaling pathway
|
|
CXCR4-mediated signaling events
|
|
IGF1 pathway
|
|
Class I PI3K signaling events
|
|
ErbB1 downstream signaling
|
|
IL8- and CXCR2-mediated signaling events
|
|
CXCR3-mediated signaling events
|
|
VEGFR1 specific signals
|
|
Signaling events mediated by Stem cell factor receptor (c-Kit)
|
|
Signaling events mediated by VEGFR1 and VEGFR2
|
|
Class I PI3K signaling events mediated by Akt
|
|
IL8- and CXCR1-mediated signaling events
|
|
Trk receptor signaling mediated by PI3K and PLC-gamma
|
|
FGF signaling pathway
|
|
TGF-beta receptor signalinglysophospholipid_pathway:LPA receptor mediated events
|
|
Degradation of beta catenin
|
|
Reelin signaling pathway
|
|
Presenilin action in Notch and Wnt signaling
|
|
Integrin-linked kinase signaling
|
|
CDC42 signaling events
|
|
LKB1 signaling events
|
|
Canonical Wnt signaling pathway
|
|
Role of Calcineurin-dependent NFAT signaling in lymphocytes
|
|
Glucocorticoid receptor regulatory network
|
|
C-MYC pathway
|
|
Regulation of Androgen receptor activity
|
|
BMP receptor signaling
|
|
Hedgehog signaling events mediated by Gli proteins
|
|
Validated transcriptional targets of deltaNp63 isoforms
|
|
Aurora A signaling
|
|
Insulin-mediated glucose transport
|
|
Trk receptor signaling mediated by PI3K and PLC-gammasmad2_3nuclearpathway:Regulation of nuclear SMAD2/3 signaling
|
|
Calcineurin-regulated NFAT-dependent transcription in lymphocytes
|
|
Validated targets of C-MYC transcriptional activation
|
|
ATF-2 transcription factor network
|
|
Regulation of retinoblastoma protein
|
|
PathWhiz Pathway
|
Intracellular Signalling Through Adenosine Receptor A2a and Adenosine
|
|
Intracellular Signalling Through Adenosine Receptor A2b and Adenosine
|
|
Insulin Signalling
|
|
Reactome
|
G0 and Early G1
|
|
Activation of ATR in response to replication stress
|
|
Regulation of APC/C activators between G1/S and early anaphase
|
|
SCF(Skp2)-mediated degradation of p27/p21
|
|
Senescence-Associated Secretory Phenotype (SASP)
|
|
DNA Damage/Telomere Stress Induced Senescence
|
|
Processing of DNA double-strand break ends
|
|
G2 Phase
|
|
Orc1 removal from chromatin
|
|
Cyclin E associated events during G1/S transition
|
|
Cyclin A/B1 associated events during G2/M transition
|
|
p53-Dependent G1 DNA Damage Response
|
|
Cyclin A:Cdk2-associated events at S phase entry
|
|
Meiotic recombination
|
|
Factors involved in megakaryocyte development and platelet productionR-HSA-176187:Activation of ATR in response to replication stress
|
|
Presynaptic phase of homologous DNA pairing and strand exchange
|
|
G2/M DNA damage checkpoint
|
|
Ubiquitin Mediated Degradation of Phosphorylated Cdc25A
|
|
Chk1/Chk2(Cds1) mediated inactivation of Cyclin B:Cdk1 complexR-HSA-114604:GPVI-mediated activation cascade
|
|
PIP3 activates AKT signaling
|
|
Activation of AKT2
|
|
Role of LAT2/NTAL/LAB on calcium mobilization
|
|
FCERI mediated NF-kB activation
|
|
Integrin alphaIIb beta3 signaling
|
|
CD28 dependent PI3K/Akt signaling
|
|
CTLA4 inhibitory signaling
|
|
G beta:gamma signalling through PI3Kgamma
|
|
VEGFR2 mediated vascular permeability
|
|
VEGFR2 mediated cell proliferation
|
|
CLEC7A (Dectin-1) signaling
|
|
RHO GTPases activate PKNs
|
|
Constitutive Signaling by AKT1 E17K in CancerR-HSA-195253:Degradation of beta-catenin by the destruction complex
|
|
AKT phosphorylates targets in the cytosol
|
|
Regulation of HSF1-mediated heat shock response
|
|
CRMPs in Sema3A signaling
|
|
Disassembly of the destruction complex and recruitment of AXIN to the membrane
|
|
S33 mutants of beta-catenin aren't phosphorylated
|
|
S37 mutants of beta-catenin aren't phosphorylated
|
|
S45 mutants of beta-catenin aren't phosphorylated
|
|
T41 mutants of beta-catenin aren't phosphorylated
|
|
Degradation of GLI2 by the proteasome
|
|
Constitutive Signaling by AKT1 E17K in CancerR-HSA-2559580:Oxidative Stress Induced Senescence
|
|
Oncogene Induced Senescence
|
|
RMTs methylate histone arginines
|
|
Transcriptional regulation of white adipocyte differentiation
|
|
Ubiquitin-dependent degradation of Cyclin D1
|
|
Cyclin D associated events in G1
|
|
WikiPathways
|
DNA Damage Response
|
|
ID signaling pathway
|
|
DNA Replication
|
|
G1 to S cell cycle control
|
|
M/G1 Transition
|
|
S Phase
|
|
Meiotic Recombination
|
|
Aryl Hydrocarbon Receptor
|
|
ATM Signaling Pathway
|
|
Retinoblastoma (RB) in Cancer
|
|
Spinal Cord Injury
|
|
Integrated Pancreatic Cancer Pathway
|
|
Oncostatin M Signaling Pathway
|
|
Prostate Cancer
|
|
Signaling Pathways in Glioblastoma
|
|
TSH signaling pathway
|
|
Integrated Breast Cancer Pathway
|
|
Integrated Cancer pathway
|
|
Synthesis of DNA
|
|
Regulation of DNA replication
|
|
Mitotic G2-G2/M phases
|
|
Mitotic G1-G1/S phases
|
|
Factors involved in megakaryocyte development and platelet production
|
|
Cell Cycle
|
|
APC/C-mediated degradation of cell cycle proteins
|
|
Cell Cycle Checkpoints
|
|
miRNA Regulation of DNA Damage ResponseWP707:DNA Damage Response
|
|
Signaling by SCF-KIT
|
|
miRNA Regulation of DNA Damage ResponseWP722:Serotonin HTR1 Group and FOS Pathway
|
|
TCR Signaling Pathway
|
|
Insulin Signaling
|
|
EGF/EGFR Signaling Pathway
|
|
Cardiac Hypertrophic Response
|
|
Fc epsilon receptor (FCERI) signaling
|
|
Neurotransmitter Receptor Binding And Downstream Transmission In The Postsynaptic Cell
|
|
Signaling by Type 1 Insulin-like Growth Factor 1 Receptor (IGF1R)
|
|
PIP3 activates AKT signaling
|
|
BDNF signaling pathway
|
|
Interleukin-11 Signaling Pathway
|
|
B Cell Receptor Signaling Pathway
|
|
TCR signaling
|
|
Signaling by Insulin receptor
|
|
Integrin-mediated Cell Adhesion
|
|
GPVI-mediated activation cascade
|
|
GPCR downstream signaling
|
|
Costimulation by the CD28 family
|
|
MicroRNAs in cardiomyocyte hypertrophyWP710:DNA Damage Response (only ATM dependent)
|
|
Senescence and Autophagy in Cancer
|
|
Notch Signaling Pathway
|
|
Glycogen Metabolism
|
|
Wnt Signaling Pathway
|
|
Wnt Signaling Pathway and Pluripotency
|
|
IL-6 signaling pathway
|
|
Wnt Signaling Pathway Netpath
|
|
Copper homeostasis
|
|
Focal Adhesion
|
|
Hair Follicle Development: Induction (Part 1 of 3)
|
|
Degradation of beta-catenin by the destruction complex
|
|
T-Cell Receptor and Co-stimulatory Signaling
|
|
Cardiac Progenitor Differentiation
|
|
Corticotropin-releasing hormone
|
|
IL17 signaling pathway
|
|
Neural Crest Differentiation
|
|
Alzheimers Disease
|
|
IL-7 Signaling Pathway
|
|
Regulation of Microtubule Cytoskeleton
|
|
TWEAK Signaling Pathway
|
|
Leptin signaling pathway
|
|
Semaphorin interactions
|
|
MicroRNAs in cardiomyocyte hypertrophy
|
|
Androgen receptor signaling pathway
|
|
IL-5 Signaling PathwayWP707:DNA Damage Response
|
|
Ovarian Infertility Genes
|
|
PPAR Alpha Pathway
|
|
Bladder Cancer
|
|
Transcriptional Regulation of White Adipocyte Differentiation
|
|
miRNA Regulation of DNA Damage Response
|
| References |
| REF 1 | J Med Chem. 2006 Sep 7;49(18):5470-7.Dissecting the determinants of cyclin-dependent kinase 2 and cyclin-dependent kinase 4 inhibitor selectivity. |
|---|
| REF 2 | Bioorg Med Chem Lett. 2006 Mar 1;16(5):1353-7. Epub 2005 Dec 1.Triazolo[1,5-a]pyrimidines as novel CDK2 inhibitors: protein structure-guided design and SAR. |
|---|
