| Drug General Information |
| Drug ID |
DX7DMX
|
| Drug Name |
3-(4-((5-(4-bromophenyl)-1,2,4-oxadiazol-3-yl)methoxy)phenyl)-2-isopropoxypropanoic acid
|
| Synonyms |
CHEMBL310962
|
| Indication |
Discovery agent
|
Investigative |
[1]
|
|---|
| Formula |
C21H21BrN2O5
|
| Canonical SMILES |
CC(C)OC(Cc1ccc(OCc2noc(n2)c3ccc(Br)cc3)cc1)C(=O)O
|
| InChI |
InChI=1S/C21H21BrN2O5/c1-13(2)28-18(21(25)26)11-14-3-9-17(10-4-14)27-12-19-23-20(29-24-19)15-5-7-16(22)8-6-15/h3-10,13,18H,11-12H2,1-2H3,(H,25,26)
|
| InChIKey |
MIXWSSHLXAJWQP-UHFFFAOYSA-N
|
| Target and Pathway |
| Target(s) |
Peroxisome proliferator activated receptor gamma |
Target Info |
|
[1]
|
|---|
| Peroxisomeproliferator activated receptor delta |
Target Info |
|
[1]
|
|
KEGG Pathway
|
PPAR signaling pathway
|
|
AMPK signaling pathway
|
|
Osteoclast differentiation
|
|
Huntington's disease
|
|
Pathways in cancer
|
|
Transcriptional misregulation in cancer
|
|
Thyroid cancerhsa03320:PPAR signaling pathway
|
|
Wnt signaling pathway
|
|
Acute myeloid leukemia
|
|
NetPath Pathway
|
IL1 Signaling Pathway
|
|
TGF_beta_Receptor Signaling Pathway
|
|
Leptin Signaling PathwayNetPath_14:IL2 Signaling Pathway
|
|
PANTHER Pathway
|
CCKR signaling map STP00057:Wnt signaling pathway
|
|
Pathway Interaction Database
|
Noncanonical Wnt signaling pathway
|
|
Calcineurin-regulated NFAT-dependent transcription in lymphocytes
|
|
Signaling events mediated by HDAC Class I
|
|
RXR and RAR heterodimerization with other nuclear receptor
|
|
Regulation of retinoblastoma proteinps1pathway:Presenilin action in Notch and Wnt signaling
|
|
Reactome
|
PPARA activates gene expression
|
|
Transcriptional regulation of white adipocyte differentiation
|
|
Nuclear Receptor transcription pathwayR-HSA-200425:Import of palmitoyl-CoA into the mitochondrial matrix
|
|
Regulation of pyruvate dehydrogenase (PDH) complex
|
|
Nuclear Receptor transcription pathway
|
|
WikiPathways
|
Wnt Signaling Pathway Netpath
|
|
Nuclear Receptors in Lipid Metabolism and Toxicity
|
|
Differentiation of white and brown adipocyte
|
|
Regulation of Lipid Metabolism by Peroxisome proliferator-activated receptor alpha (PPARalpha)
|
|
Transcriptional Regulation of White Adipocyte Differentiation
|
|
Adipogenesis
|
|
SREBP signalling
|
|
Nuclear ReceptorsWP399:Wnt Signaling Pathway and Pluripotency
|
|
NRF2 pathway
|
|
Nuclear Receptors Meta-Pathway
|
|
Vitamin D Receptor Pathway
|
|
Ectoderm Differentiation
|
|
Nuclear Receptors
|
| References |
| REF 1 | URL: https://www.ebi.ac.uk/chembl/ The ChEMBL database in 2017 |
|---|
