| Drug General Information |
| Drug ID |
D0VD8B
|
| Former ID |
DIB019098
|
| Drug Name |
NSC-625987
|
| Synonyms |
NSC 625987
|
| Drug Type |
Small molecular drug
|
| Indication |
Discovery agent
|
Investigative |
[1]
|
|---|
| Structure |
|
Download
2D MOL
|
| Formula |
C15H13NO2S
|
| InChI |
InChI=1S/C15H13NO2S/c1-17-11-7-8-12(18-2)14-13(11)15(19)9-5-3-4-6-10(9)16-14/h3-8H,1-2H3,(H,16,19)
|
| InChIKey |
KFAKESMKRPNZTM-UHFFFAOYSA-N
|
| PubChem Compound ID |
|
| PubChem Substance ID |
228330, 492765, 4518451, 10037313, 11114279, 11412614, 14750566, 24724558, 26758444, 34668903, 47572930, 80045826, 85788686, 91746524, 99302674, 111614182, 123080305, 125541701, 135235549, 135685136, 135697658, 140294231, 142986298, 162023337, 162248081, 163123763, 163322669, 163688392, 175607467, 178102574, 179236067, 216088084, 228144850, 246189951, 246948954, 252156317, 252159987
|
| Target and Pathway |
| Target(s) |
Cell division protein kinase 4 |
Target Info |
Inhibitor |
[1]
|
|---|
| Cell division protein kinase 2 |
Target Info |
Inhibitor |
[1]
|
|
KEGG Pathway
|
Cell cycle
|
|
p53 signaling pathway
|
|
PI3K-Akt signaling pathway
|
|
Tight junction
|
|
T cell receptor signaling pathway
|
|
Hepatitis B
|
|
Measles
|
|
HTLV-I infection
|
|
Pathways in cancer
|
|
Viral carcinogenesis
|
|
Pancreatic cancer
|
|
Glioma
|
|
Melanoma
|
|
Bladder cancer
|
|
Chronic myeloid leukemia
|
|
Small cell lung cancer
|
|
Non-small cell lung cancerhsa04068:FoxO signaling pathway
|
|
Oocyte meiosis
|
|
Progesterone-mediated oocyte maturation
|
|
Herpes simplex infection
|
|
Epstein-Barr virus infection
|
|
Prostate cancer
|
|
NetPath Pathway
|
TCR Signaling Pathway
|
|
EGFR1 Signaling Pathway
|
|
RANKL Signaling PathwayNetPath_11:TCR Signaling Pathway
|
|
PANTHER Pathway
|
p53 pathway
|
|
p53 pathway feedback loops 2
|
|
Pathway Interaction Database
|
Regulation of nuclear SMAD2/3 signaling
|
|
Calcineurin-regulated NFAT-dependent transcription in lymphocytes
|
|
Validated targets of C-MYC transcriptional activation
|
|
ATF-2 transcription factor network
|
|
FOXM1 transcription factor network
|
|
Regulation of retinoblastoma proteinsmad2_3nuclearpathway:Regulation of nuclear SMAD2/3 signaling
|
|
Signaling events mediated by PRL
|
|
p73 transcription factor network
|
|
E2F transcription factor network
|
|
ATR signaling pathway
|
|
mTOR signaling pathway
|
|
IL2-mediated signaling events
|
|
FoxO family signaling
|
|
BARD1 signaling events
|
|
p53 pathway
|
|
Regulation of retinoblastoma protein
|
|
Reactome
|
Oxidative Stress Induced Senescence
|
|
Senescence-Associated Secretory Phenotype (SASP)
|
|
Oncogene Induced Senescence
|
|
RMTs methylate histone arginines
|
|
Transcriptional regulation of white adipocyte differentiation
|
|
Ubiquitin-dependent degradation of Cyclin D1
|
|
Cyclin D associated events in G1
|
|
Meiotic recombinationR-HSA-1538133:G0 and Early G1
|
|
Activation of ATR in response to replication stress
|
|
Regulation of APC/C activators between G1/S and early anaphase
|
|
SCF(Skp2)-mediated degradation of p27/p21
|
|
DNA Damage/Telomere Stress Induced Senescence
|
|
Processing of DNA double-strand break ends
|
|
G2 Phase
|
|
Orc1 removal from chromatin
|
|
Cyclin E associated events during G1/S transition
|
|
Cyclin A/B1 associated events during G2/M transition
|
|
p53-Dependent G1 DNA Damage Response
|
|
Cyclin A:Cdk2-associated events at S phase entry
|
|
Meiotic recombination
|
|
Factors involved in megakaryocyte development and platelet production
|
|
WikiPathways
|
DNA Damage Response
|
|
G1 to S cell cycle control
|
|
Ovarian Infertility Genes
|
|
PPAR Alpha Pathway
|
|
Bladder Cancer
|
|
S Phase
|
|
Transcriptional Regulation of White Adipocyte Differentiation
|
|
Meiotic Recombination
|
|
Retinoblastoma (RB) in Cancer
|
|
Spinal Cord Injury
|
|
Integrated Pancreatic Cancer Pathway
|
|
Prostate Cancer
|
|
Signaling Pathways in Glioblastoma
|
|
TSH signaling pathway
|
|
Integrated Breast Cancer Pathway
|
|
Integrated Cancer pathway
|
|
Mitotic G1-G1/S phases
|
|
Cell Cycle
|
|
miRNA Regulation of DNA Damage ResponseWP707:DNA Damage Response
|
|
ID signaling pathway
|
|
DNA Replication
|
|
M/G1 Transition
|
|
Aryl Hydrocarbon Receptor
|
|
ATM Signaling Pathway
|
|
Oncostatin M Signaling Pathway
|
|
Synthesis of DNA
|
|
Regulation of DNA replication
|
|
Mitotic G2-G2/M phases
|
|
Factors involved in megakaryocyte development and platelet production
|
|
APC/C-mediated degradation of cell cycle proteins
|
|
Cell Cycle Checkpoints
|
|
miRNA Regulation of DNA Damage Response
|
| References |
| REF 1 | The p16 status of tumor cell lines identifies small molecule inhibitors specific for cyclin-dependent kinase 4. Clin Cancer Res. 1999 Dec;5(12):4279-86. |
|---|
