| Drug General Information |
| Drug ID |
D0N0YX
|
| Former ID |
DNC002550
|
| Drug Name |
Beta-(2-Naphthyl)-Alanine
|
| Drug Type |
Small molecular drug
|
| Indication |
Discovery agent
|
Investigative |
[1]
|
|---|
| Structure |
|
Download
2D MOL
3D MOL
|
| Formula |
C13H13NO2
|
| Canonical SMILES |
C1=CC=C2C=C(C=CC2=C1)CC(C(=O)O)N
|
| InChI |
1S/C13H13NO2/c14-12(13(15)16)8-9-5-6-10-3-1-2-4-11(10)7-9/h1-7,12H,8,14H2,(H,15,16)/t12-/m0/s1
|
| InChIKey |
JPZXHKDZASGCLU-LBPRGKRZSA-N
|
| PubChem Compound ID |
|
| PubChem Substance ID |
7889282, 10260435, 10322176, 15195828, 29199655, 33507982, 46506480, 49833633, 50819238, 53796107, 57396008, 87573958, 88801743, 92709922, 113437120, 118313528, 126632387, 126650149, 126686046, 126694697, 128310932, 135164903, 135696460, 137014439, 141970871, 143438455, 143491592, 152164976, 152238801, 160800445, 160964996, 162134027, 162173186, 162764230, 163408573, 163632472, 163811307, 164798730, 170496507, 172088310, 180189897, 184562396, 196111268, 204406390, 204939106, 219400609, 223386646, 223522408, 223674925, 223959795
|
| Target and Pathway |
| Target(s) |
Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 |
Target Info |
Inhibitor |
[1]
|
|---|
| Coagulation factor IIa |
Target Info |
Inhibitor |
[1]
|
|
KEGG Pathway
|
RIG-I-like receptor signaling pathwayhsa04080:Neuroactive ligand-receptor interaction
|
|
Complement and coagulation cascades
|
|
Regulation of actin cytoskeleton
|
|
NetPath Pathway
|
TCR Signaling Pathway
|
|
PANTHER Pathway
|
Blood coagulation
|
|
Pathway Interaction Database
|
p73 transcription factor network
|
|
C-MYC pathway
|
|
PDGFR-beta signaling pathway
|
|
p53 pathwaythrombin_pathway:Thrombin/protease-activated receptor (PAR) pathway
|
|
Angiopoietin receptor Tie2-mediated signaling
|
|
FOXA2 and FOXA3 transcription factor networks
|
|
PAR4-mediated thrombin signaling events
|
|
Syndecan-4-mediated signaling events
|
|
PAR1-mediated thrombin signaling events
|
|
PathWhiz Pathway
|
Vitamin K Metabolism
|
|
Coagulation
|
|
Reactome
|
ISG15 antiviral mechanism
|
|
Negative regulators of RIG-I/MDA5 signalingR-HSA-140837:Intrinsic Pathway of Fibrin Clot Formation
|
|
Common Pathway of Fibrin Clot Formation
|
|
Gamma-carboxylation of protein precursors
|
|
Transport of gamma-carboxylated protein precursors from the endoplasmic reticulum to the Golgi apparatus
|
|
Removal of aminoterminal propeptides from gamma-carboxylated proteins
|
|
Cell surface interactions at the vascular wall
|
|
Peptide ligand-binding receptors
|
|
Regulation of Insulin-like Growth Factor (IGF) transport and uptake by Insulin-like Growth Factor Binding Proteins (IGFBPs)
|
|
G alpha (q) signalling events
|
|
Thrombin signalling through proteinase activated receptors (PARs)
|
|
WikiPathways
|
ISG15 antiviral mechanism
|
|
RIG-I/MDA5 mediated induction of IFN-alpha/beta pathwaysWP558:Complement and Coagulation Cascades
|
|
Regulation of Actin Cytoskeleton
|
|
IL1 and megakaryotyces in obesity
|
|
Regulation of Insulin-like Growth Factor (IGF) Transport and Uptake by Insulin-like Growth Factor Binding Proteins (IGFBPs)
|
|
PTM: gamma carboxylation, hypusine formation and arylsulfatase activation
|
|
Blood Clotting Cascade
|
|
Gastrin-CREB signalling pathway via PKC and MAPK
|
|
Thrombin signalling through proteinase activated receptors (PARs)
|
|
Platelet Aggregation (Plug Formation)
|
|
GPCR ligand binding
|
|
GPCR downstream signaling
|
|
Formation of Fibrin Clot (Clotting Cascade)
|
|
Cell surface interactions at the vascular wall
|
|
Folate Metabolism
|
|
Vitamin B12 Metabolism
|
|
Selenium Micronutrient Network
|
| References |
| REF 1 | The Protein Data Bank. Nucleic Acids Res. 2000 Jan 1;28(1):235-42. |
|---|
