| Drug General Information |
| Drug ID |
D0L5IC
|
| Former ID |
DNC003729
|
| Drug Name |
CP-394531
|
| Drug Type |
Small molecular drug
|
| Indication |
Discovery agent
|
Investigative |
[1]
|
|---|
| Structure |
|
Download
2D MOL
3D MOL
|
| Formula |
C23H23ClO2
|
| Canonical SMILES |
C1CC2=C(C=CC(=C2)O)C3(C1CC(CC3)(C#CCl)O)CC4=CC=CC=C4
|
| InChI |
1S/C23H23ClO2/c24-13-12-22(26)10-11-23(15-17-4-2-1-3-5-17)19(16-22)7-6-18-14-20(25)8-9-21(18)23/h1-5,8-9,14,19,25-26H,6-7,10-11,15-16H2/t19-,22+,23+/m1/s1
|
| InChIKey |
CNOAOQSZNOTZLQ-OIBXWCBGSA-N
|
| PubChem Compound ID |
|
| Target and Pathway |
| Target(s) |
Estrogen receptor beta |
Target Info |
Inhibitor |
[1]
|
|---|
| Estrogen receptor |
Target Info |
Inhibitor |
[1]
|
| mRNA of androgen receptor |
Target Info |
Inhibitor |
[1]
|
| mRNA of glucocorticoid receptor |
Target Info |
Inhibitor |
[2]
|
|
KEGG Pathway
|
Estrogen signaling pathway
|
|
Prolactin signaling pathwayhsa04915:Estrogen signaling pathway
|
|
Prolactin signaling pathway
|
|
Thyroid hormone signaling pathway
|
|
Endocrine and other factor-regulated calcium reabsorption
|
|
Proteoglycans in cancerhsa04114:Oocyte meiosis
|
|
Pathways in cancer
|
|
Prostate cancerhsa04080:Neuroactive ligand-receptor interaction
|
|
NetPath Pathway
|
FSH Signaling Pathway
|
|
EGFR1 Signaling Pathway
|
|
RANKL Signaling PathwayNetPath_4:EGFR1 Signaling Pathway
|
|
AndrogenReceptor Signaling Pathway
|
|
FSH Signaling PathwayNetPath_14:IL2 Signaling Pathway
|
|
TCR Signaling Pathway
|
|
Pathway Interaction Database
|
Plasma membrane estrogen receptor signaling
|
|
Validated nuclear estrogen receptor beta network
|
|
Validated nuclear estrogen receptor alpha networksmad2_3nuclearpathway:Regulation of nuclear SMAD2/3 signaling
|
|
Signaling events mediated by HDAC Class II
|
|
LKB1 signaling events
|
|
Regulation of Telomerase
|
|
ATF-2 transcription factor network
|
|
AP-1 transcription factor network
|
|
FOXM1 transcription factor network
|
|
Validated nuclear estrogen receptor alpha network
|
|
Signaling mediated by p38-alpha and p38-beta
|
|
FOXA1 transcription factor networksmad2_3nuclearpathway:Regulation of nuclear SMAD2/3 signaling
|
|
Coregulation of Androgen receptor activity
|
|
Regulation of Androgen receptor activity
|
|
Nongenotropic Androgen signaling
|
|
Regulation of nuclear beta catenin signaling and target gene transcription
|
|
FOXA1 transcription factor network
|
|
Notch-mediated HES/HEY networksmad2_3nuclearpathway:Regulation of nuclear SMAD2/3 signaling
|
|
FOXA2 and FOXA3 transcription factor networks
|
|
Glucocorticoid receptor regulatory network
|
|
Reactome
|
Nuclear Receptor transcription pathwayR-HSA-1251985:Nuclear signaling by ERBB4
|
|
Nuclear Receptor transcription pathwayR-HSA-383280:Nuclear Receptor transcription pathway
|
|
Activated PKN1 stimulates transcription of AR (androgen receptor) regulated genes KLK2 and KLK3R-HSA-1368108:BMAL1:CLOCK,NPAS2 activates circadian gene expression
|
|
WikiPathways
|
SIDS Susceptibility Pathways
|
|
Ovarian Infertility Genes
|
|
Integrated Pancreatic Cancer Pathway
|
|
Nuclear ReceptorsWP712:Estrogen signaling pathway
|
|
Nuclear Receptors Meta-Pathway
|
|
Estrogen Receptor Pathway
|
|
Signaling by ERBB4
|
|
JAK/STAT
|
|
Leptin signaling pathway
|
|
miR-targeted genes in muscle cell - TarBase
|
|
Integrated Breast Cancer Pathway
|
|
Nuclear ReceptorsWP706:SIDS Susceptibility Pathways
|
|
Prostate Cancer
|
|
Nuclear Receptors
|
|
Androgen receptor signaling pathwayWP734:Serotonin Receptor 4/6/7 and NR3C Signaling
|
|
Endoderm Differentiation
|
|
Hair Follicle Development: Cytodifferentiation (Part 3 of 3)
|
|
Adipogenesis
|
|
Circadian Clock
|
| References |
| REF 1 | J Med Chem. 2002 Jun 6;45(12):2417-24.Discovery of potent, nonsteroidal, and highly selective glucocorticoid receptor antagonists. |
|---|
| REF 2 | J Med Chem. 2010 Apr 22;53(8):3065-74.Virtual screening for the identification of novel nonsteroidal glucocorticoid modulators. |
|---|
