| Drug General Information |
| Drug ID |
D0H2PA
|
| Former ID |
DNC003860
|
| Drug Name |
PKF-242-484
|
| Synonyms |
TNF-484
|
| Drug Type |
Small molecular drug
|
| Indication |
Discovery agent
|
Investigative |
[1]
|
|---|
| Structure |
|
Download
2D MOL
3D MOL
|
| Formula |
C19H29N3O6
|
| Canonical SMILES |
CC(C)(C)C(C(=O)NC)NC(=O)C(C1=CC=C(C=C1)OC)C(CO)C(=O)NO
|
| InChI |
1S/C19H29N3O6/c1-19(2,3)15(18(26)20-4)21-17(25)14(13(10-23)16(24)22-27)11-6-8-12(28-5)9-7-11/h6-9,13-15,23,27H,10H2,1-5H3,(H,20,26)(H,21,25)(H,22,24)/t13-,14+,15+/m0/s1
|
| InChIKey |
IOLRUMINDIUCLJ-RRFJBIMHSA-N
|
| PubChem Compound ID |
|
| Target and Pathway |
| Target(s) |
ADAM 17 |
Target Info |
Inhibitor |
[2]
|
|---|
| Collagenase 3 |
Target Info |
Inhibitor |
[1]
|
| Stromelysin-1 |
Target Info |
Inhibitor |
[1]
|
| Tumor necrosis factor |
Target Info |
Inhibitor |
[3]
|
| Interstitial collagenase |
Target Info |
Inhibitor |
[1]
|
|
KEGG Pathway
|
Notch signaling pathway
|
|
Alzheimer's disease
|
|
Epithelial cell signaling in Helicobacter pylori infectionhsa04668:TNF signaling pathway
|
|
Transcriptional misregulation in cancer
|
|
Rheumatoid arthritishsa04010:MAPK signaling pathway
|
|
Cytokine-cytokine receptor interaction
|
|
NF-kappa B signaling pathway
|
|
Sphingolipid signaling pathway
|
|
mTOR signaling pathway
|
|
Apoptosis
|
|
TGF-beta signaling pathway
|
|
Osteoclast differentiation
|
|
Antigen processing and presentation
|
|
Toll-like receptor signaling pathway
|
|
NOD-like receptor signaling pathway
|
|
RIG-I-like receptor signaling pathway
|
|
Hematopoietic cell lineage
|
|
Natural killer cell mediated cytotoxicity
|
|
T cell receptor signaling pathway
|
|
Fc epsilon RI signaling pathway
|
|
TNF signaling pathway
|
|
Adipocytokine signaling pathway
|
|
Type II diabetes mellitus
|
|
Non-alcoholic fatty liver disease (NAFLD)
|
|
Type I diabetes mellitus
|
|
Amyotrophic lateral sclerosis (ALS)
|
|
Pertussis
|
|
Legionellosis
|
|
Leishmaniasis
|
|
Chagas disease (American trypanosomiasis)
|
|
African trypanosomiasis
|
|
Malaria
|
|
Toxoplasmosis
|
|
Amoebiasis
|
|
Tuberculosis
|
|
Hepatitis C
|
|
Hepatitis B
|
|
Influenza A
|
|
HTLV-I infection
|
|
Herpes simplex infection
|
|
Proteoglycans in cancer
|
|
Asthma
|
|
Inflammatory bowel disease (IBD)
|
|
Systemic lupus erythematosus
|
|
Rheumatoid arthritis
|
|
Allograft rejection
|
|
Graft-versus-host disease
|
|
Hypertrophic cardiomyopathy (HCM)
|
|
Dilated cardiomyopathyhsa03320:PPAR signaling pathway
|
|
Pathways in cancer
|
|
Bladder cancer
|
|
NetPath Pathway
|
IL1 Signaling PathwayNetPath_13:IL1 Signaling Pathway
|
|
IL4 Signaling PathwayNetPath_11:TCR Signaling Pathway
|
|
IL2 Signaling Pathway
|
|
IL3 Signaling Pathway
|
|
IL4 Signaling Pathway
|
|
Leptin Signaling Pathway
|
|
RANKL Signaling Pathway
|
|
EGFR1 Signaling Pathway
|
|
TWEAK Signaling Pathway
|
|
Wnt Signaling Pathway
|
|
PANTHER Pathway
|
Alzheimer disease-amyloid secretase pathway
|
|
Alzheimer disease-presenilin pathway
|
|
Notch signaling pathwayP00004:Alzheimer disease-presenilin pathway
|
|
Plasminogen activating cascadeP00050:Plasminogen activating cascade
|
|
CCKR signaling map STP00006:Apoptosis signaling pathway
|
|
Wnt signaling pathwayP00004:Alzheimer disease-presenilin pathway
|
|
Plasminogen activating cascade
|
|
Pathway Interaction Database
|
ErbB4 signaling events
|
|
TNF receptor signaling pathway
|
|
p75(NTR)-mediated signalingupa_upar_pathway:Urokinase-type plasminogen activator (uPA) and uPAR-mediated signalingajdiss_2pathway:Posttranslational regulation of adherens junction stability and dissassembly
|
|
p75(NTR)-mediated signaling
|
|
Urokinase-type plasminogen activator (uPA) and uPAR-mediated signalingil27pathway:IL27-mediated signaling events
|
|
Canonical NF-kappaB pathway
|
|
Calcineurin-regulated NFAT-dependent transcription in lymphocytes
|
|
Angiopoietin receptor Tie2-mediated signaling
|
|
Signaling events mediated by HDAC Class I
|
|
Ceramide signaling pathway
|
|
amb2 Integrin signaling
|
|
RXR and RAR heterodimerization with other nuclear receptor
|
|
IL23-mediated signaling events
|
|
HIV-1 Nef: Negative effector of Fas and TNF-alpha
|
|
Caspase Cascade in Apoptosis
|
|
Cellular roles of Anthrax toxin
|
|
Downstream signaling in naï
|
|
Endothelins
|
|
Validated transcriptional targets of AP1 family members Fra1 and Fra2
|
|
Glucocorticoid receptor regulatory network
|
|
AP-1 transcription factor network
|
|
Syndecan-1-mediated signaling events
|
|
PathWhiz Pathway
|
Fc Epsilon Receptor I Signaling in Mast Cells
|
|
Reactome
|
Nuclear signaling by ERBB4
|
|
Collagen degradation
|
|
Regulated proteolysis of p75NTR
|
|
Activated NOTCH1 Transmits Signal to the Nucleus
|
|
Constitutive Signaling by NOTCH1 PEST Domain Mutants
|
|
Constitutive Signaling by NOTCH1 t(7
|
|
M1580_K2555) Translocation Mutant
|
|
Constitutive Signaling by NOTCH1 HD Domain Mutants
|
|
Constitutive Signaling by NOTCH1 HD+PEST Domain Mutants
|
|
TNF signaling
|
|
Growth hormone receptor signalingR-HSA-1442490:Collagen degradation
|
|
Degradation of the extracellular matrix
|
|
Activation of Matrix Metalloproteinases
|
|
Assembly of collagen fibrils and other multimeric structuresR-HSA-1442490:Collagen degradation
|
|
Assembly of collagen fibrils and other multimeric structures
|
|
EGFR Transactivation by GastrinR-HSA-381340:Transcriptional regulation of white adipocyte differentiation
|
|
TNFR1-induced proapoptotic signaling
|
|
Regulation of TNFR1 signaling
|
|
TNFR1-induced NFkappaB signaling pathway
|
|
TNFR1-mediated ceramide production
|
|
TNFR2 non-canonical NF-kB pathway
|
|
TNF signalingR-HSA-1442490:Collagen degradation
|
|
Basigin interactions
|
|
Regulation of Insulin-like Growth Factor (IGF) transport and uptake by Insulin-like Growth Factor Binding Proteins (IGFBPs)
|
|
WikiPathways
|
Notch Signaling Pathway
|
|
Copper homeostasis
|
|
Notch Signaling Pathway
|
|
Growth hormone receptor signaling
|
|
BDNF signaling pathway
|
|
Alzheimers Disease
|
|
Signalling by NGF
|
|
Extrinsic Pathway for ApoptosisWP474:Endochondral Ossification
|
|
Activation of Matrix Metalloproteinases
|
|
Oncostatin M Signaling Pathway
|
|
AGE/RAGE pathway
|
|
Matrix MetalloproteinasesWP2769:Activation of Matrix Metalloproteinases
|
|
Gastrin-CREB signalling pathway via PKC and MAPK
|
|
Matrix MetalloproteinasesWP75:Toll-like receptor signaling pathway
|
|
Monoamine Transport
|
|
SIDS Susceptibility Pathways
|
|
TGF Beta Signaling Pathway
|
|
Cytokines and Inflammatory Response
|
|
MAPK Signaling Pathway
|
|
EV release from cardiac cells and their functional effects
|
|
FAS pathway and Stress induction of HSP regulation
|
|
Apoptosis-related network due to altered Notch3 in ovarian cancer
|
|
Cardiac Hypertrophic Response
|
|
Transcriptional Regulation of White Adipocyte Differentiation
|
|
Aryl Hydrocarbon Receptor
|
|
Apoptosis
|
|
Nanoparticle triggered regulated necrosis
|
|
Amyotrophic lateral sclerosis (ALS)
|
|
Adipogenesis
|
|
Allograft Rejection
|
|
TNF alpha Signaling Pathway
|
|
TWEAK Signaling Pathway
|
|
Extrinsic Pathway for Apoptosis
|
|
Folate Metabolism
|
|
MicroRNAs in cardiomyocyte hypertrophy
|
|
Vitamin B12 Metabolism
|
|
Selenium Micronutrient Network
|
|
Regulation of toll-like receptor signaling pathway
|
|
Matrix MetalloproteinasesWP366:TGF beta Signaling Pathway
|
|
Bladder Cancer
|
|
Degradation of collagen
|
|
Quercetin and Nf-kB/ AP-1 Induced Cell Apoptosis
|
|
Prostate Cancer
|
|
Integrated Breast Cancer Pathway
|
|
Integrated Cancer pathway
|
|
Cell surface interactions at the vascular wall
|
|
Matrix Metalloproteinases
|
| References |
| REF 1 | Bioorg Med Chem Lett. 2006 May 15;16(10):2632-6. Epub 2006 Mar 3.A cassette-dosing approach for improvement of oral bioavailability of dual TACE/MMP inhibitors. |
|---|
| REF 2 | Bioorg Med Chem. 2009 Jan 15;17(2):444-59. Epub 2008 Dec 3.Current perspective of TACE inhibitors: a review. |
|---|
| REF 3 | J Med Chem. 2002 May 23;45(11):2289-93.Beta-aryl-succinic acid hydroxamates as dual inhibitors of matrix metalloproteinases and tumor necrosis factor alpha converting enzyme. |
|---|
