| Drug General Information |
| Drug ID |
D0C5XQ
|
| Former ID |
DNC006063
|
| Drug Name |
5-MEO-DMT
|
| Drug Type |
Small molecular drug
|
| Indication |
Discovery agent
|
Investigative |
[1]
|
|---|
| Structure |
|
Download
2D MOL
3D MOL
|
| Formula |
C13H18N2O
|
| InChI |
InChI=1S/C13H18N2O/c1-15(2)7-6-10-9-14-13-5-4-11(16-3)8-12(10)13/h4-5,8-9,14H,6-7H2,1-3H3
|
| InChIKey |
ZSTKHSQDNIGFLM-UHFFFAOYSA-N
|
| PubChem Compound ID |
|
| PubChem Substance ID |
10507, 396190, 855873, 3133037, 5496810, 8151306, 10502422, 11111436, 11388126, 11536794, 14773502, 24278119, 26751543, 29221031, 46530517, 47291301, 47440455, 47589168, 47810950, 48035331, 48185166, 48259441, 49747340, 49830131, 49983965, 50100273, 50104133, 57321042, 58004968, 76623346, 81040716, 81093165, 85209445, 92265408, 99381478, 103165737, 104298854, 118048564, 124438278, 124749945, 124801106, 124880659, 124880660, 124880661, 124880662, 124999880, 125336666, 126524284, 126566690, 126572697
|
| Target and Pathway |
| Target(s) |
5-hydroxytryptamine 2A receptor |
Target Info |
Inhibitor |
[2]
|
|---|
| 5-hydroxytryptamine 6 receptor |
Target Info |
Inhibitor |
[3]
|
| 5-hydroxytryptamine 2B receptor |
Target Info |
Inhibitor |
[2]
|
| 5-hydroxytryptamine 2C receptor |
Target Info |
Inhibitor |
[2]
|
|
KEGG Pathway
|
Calcium signaling pathway
|
|
Neuroactive ligand-receptor interaction
|
|
Gap junction
|
|
Serotonergic synapse
|
|
Inflammatory mediator regulation of TRP channelshsa04020:Calcium signaling pathway
|
|
cAMP signaling pathway
|
|
Serotonergic synapsehsa04020:Calcium signaling pathway
|
|
Inflammatory mediator regulation of TRP channels
|
|
PANTHER Pathway
|
5HT2 type receptor mediated signaling pathwayP00026:Heterotrimeric G-protein signaling pathway-Gi alpha and Gs alpha mediated pathwayP04374:5HT2 type receptor mediated signaling pathwayP04374:5HT2 type receptor mediated signaling pathway
|
|
PathWhiz Pathway
|
Excitatory Neural Signalling Through 5-HTR 6 and Serotonin
|
|
Reactome
|
Serotonin receptors
|
|
G alpha (q) signalling eventsR-HSA-390666:Serotonin receptors
|
|
G alpha (s) signalling eventsR-HSA-390666:Serotonin receptors
|
|
G alpha (q) signalling events
|
|
WikiPathways
|
Serotonin Receptor 2 and STAT3 Signaling
|
|
Serotonin Receptor 2 and ELK-SRF/GATA4 signaling
|
|
SIDS Susceptibility Pathways
|
|
Monoamine GPCRs
|
|
GPCRs, Class A Rhodopsin-like
|
|
Gastrin-CREB signalling pathway via PKC and MAPK
|
|
GPCR ligand binding
|
|
GPCR downstream signaling
|
|
GPCRs, OtherWP734:Serotonin Receptor 4/6/7 and NR3C Signaling
|
|
GPCR downstream signalingWP732:Serotonin Receptor 2 and ELK-SRF/GATA4 signaling
|
| References |
| REF 1 | (http://www.guidetopharmacology.org/) Nucleic Acids Res. 2015 Oct 12. pii: gkv1037. The IUPHAR/BPS Guide to PHARMACOLOGY in 2016: towards curated quantitative interactions between 1300 protein targets and 6000 ligands. (Ligand id: 145). |
|---|
| REF 2 | J Med Chem. 2006 Jan 12;49(1):318-28.1-((S)-2-aminopropyl)-1H-indazol-6-ol: a potent peripherally acting 5-HT2 receptor agonist with ocular hypotensive activity. |
|---|
| REF 3 | Bioorg Med Chem Lett. 2006 Nov 15;16(22):5832-5. Epub 2006 Aug 30.Interaction of N1-unsubstituted and N1-benzenesulfonyltryptamines at h5-HT6 receptors. |
|---|
